xref: /csrg-svn/sbin/restore/interactive.c (revision 69155)
121166Sdist /*
261536Sbostic  * Copyright (c) 1985, 1993
361536Sbostic  *	The Regents of the University of California.  All rights reserved.
436105Sbostic  *
542708Sbostic  * %sccs.include.redist.c%
621166Sdist  */
717752Smckusick 
817752Smckusick #ifndef lint
9*69155Smckusick static char sccsid[] = "@(#)interactive.c	8.5 (Berkeley) 05/01/95";
1036105Sbostic #endif /* not lint */
1117752Smckusick 
1256567Sbostic #include <sys/param.h>
1356567Sbostic #include <sys/time.h>
1456948Smckusick #include <sys/stat.h>
1556567Sbostic 
1656567Sbostic #include <ufs/ufs/dinode.h>
1756567Sbostic #include <ufs/ufs/dir.h>
18*69155Smckusick #include <ufs/ffs/fs.h>
1923546Smckusick #include <protocols/dumprestore.h>
2056567Sbostic 
2117752Smckusick #include <setjmp.h>
2256948Smckusick #include <glob.h>
2356567Sbostic #include <stdio.h>
2456567Sbostic #include <stdlib.h>
2556567Sbostic #include <string.h>
2617752Smckusick 
2756567Sbostic #include "restore.h"
2856567Sbostic #include "extern.h"
2956567Sbostic 
3017756Smckusick #define round(a, b) (((a) + (b) - 1) / (b) * (b))
3117756Smckusick 
3217752Smckusick /*
3317752Smckusick  * Things to handle interruptions.
3417752Smckusick  */
3556429Smckusick static int runshell;
3617752Smckusick static jmp_buf reset;
3717752Smckusick static char *nextarg = NULL;
3817752Smckusick 
3917752Smckusick /*
4017752Smckusick  * Structure and routines associated with listing directories.
4117752Smckusick  */
4217752Smckusick struct afile {
4317752Smckusick 	ino_t	fnum;		/* inode number of file */
4417752Smckusick 	char	*fname;		/* file name */
4556948Smckusick 	short	len;		/* name length */
4656948Smckusick 	char	prefix;		/* prefix character */
4756948Smckusick 	char	postfix;	/* postfix character */
4817752Smckusick };
4918003Smckusick struct arglist {
5056948Smckusick 	int	freeglob;	/* glob structure needs to be freed */
5156948Smckusick 	int	argcnt;		/* next globbed argument to return */
5256948Smckusick 	glob_t	glob;		/* globbing information */
5356948Smckusick 	char	*cmd;		/* the current command */
5418003Smckusick };
5517752Smckusick 
5656567Sbostic static char	*copynext __P((char *, char *));
5756567Sbostic static int	 fcmp __P((const void *, const void *));
5856948Smckusick static void	 formatf __P((struct afile *, int));
5956567Sbostic static void	 getcmd __P((char *, char *, char *, struct arglist *));
6056948Smckusick struct dirent	*glob_readdir __P((RST_DIR *dirp));
6157896Sbostic static int	 glob_stat __P((const char *, struct stat *));
6267757Smckusick static void	 mkentry __P((char *, struct direct *, struct afile *));
6356948Smckusick static void	 printlist __P((char *, char *));
6456567Sbostic 
6517752Smckusick /*
6617752Smckusick  * Read and execute commands from the terminal.
6717752Smckusick  */
6856567Sbostic void
runcmdshell()6917752Smckusick runcmdshell()
7017752Smckusick {
7117752Smckusick 	register struct entry *np;
7217752Smckusick 	ino_t ino;
7356948Smckusick 	struct arglist arglist;
7417752Smckusick 	char curdir[MAXPATHLEN];
7517752Smckusick 	char name[MAXPATHLEN];
7617752Smckusick 	char cmd[BUFSIZ];
7717752Smckusick 
7856948Smckusick 	arglist.freeglob = 0;
7956948Smckusick 	arglist.argcnt = 0;
8056948Smckusick 	arglist.glob.gl_flags = GLOB_ALTDIRFUNC;
8156948Smckusick 	arglist.glob.gl_opendir = (void *)rst_opendir;
8256948Smckusick 	arglist.glob.gl_readdir = (void *)glob_readdir;
8360607Sbostic 	arglist.glob.gl_closedir = (void *)rst_closedir;
8456948Smckusick 	arglist.glob.gl_lstat = glob_stat;
8556948Smckusick 	arglist.glob.gl_stat = glob_stat;
8617752Smckusick 	canon("/", curdir);
8717752Smckusick loop:
8817752Smckusick 	if (setjmp(reset) != 0) {
8956948Smckusick 		if (arglist.freeglob != 0) {
9056948Smckusick 			arglist.freeglob = 0;
9156948Smckusick 			arglist.argcnt = 0;
9256948Smckusick 			globfree(&arglist.glob);
9356948Smckusick 		}
9417752Smckusick 		nextarg = NULL;
9517752Smckusick 		volno = 0;
9617752Smckusick 	}
9756429Smckusick 	runshell = 1;
9856948Smckusick 	getcmd(curdir, cmd, name, &arglist);
9917752Smckusick 	switch (cmd[0]) {
10017752Smckusick 	/*
10117752Smckusick 	 * Add elements to the extraction list.
10217752Smckusick 	 */
10317752Smckusick 	case 'a':
10429903Smckusick 		if (strncmp(cmd, "add", strlen(cmd)) != 0)
10529903Smckusick 			goto bad;
10617752Smckusick 		ino = dirlookup(name);
10717752Smckusick 		if (ino == 0)
10817752Smckusick 			break;
10917752Smckusick 		if (mflag)
11017752Smckusick 			pathcheck(name);
11117752Smckusick 		treescan(name, ino, addfile);
11217752Smckusick 		break;
11317752Smckusick 	/*
11417752Smckusick 	 * Change working directory.
11517752Smckusick 	 */
11617752Smckusick 	case 'c':
11729903Smckusick 		if (strncmp(cmd, "cd", strlen(cmd)) != 0)
11829903Smckusick 			goto bad;
11917752Smckusick 		ino = dirlookup(name);
12017752Smckusick 		if (ino == 0)
12117752Smckusick 			break;
12217752Smckusick 		if (inodetype(ino) == LEAF) {
12317752Smckusick 			fprintf(stderr, "%s: not a directory\n", name);
12417752Smckusick 			break;
12517752Smckusick 		}
12617752Smckusick 		(void) strcpy(curdir, name);
12717752Smckusick 		break;
12817752Smckusick 	/*
12917752Smckusick 	 * Delete elements from the extraction list.
13017752Smckusick 	 */
13117752Smckusick 	case 'd':
13229903Smckusick 		if (strncmp(cmd, "delete", strlen(cmd)) != 0)
13329903Smckusick 			goto bad;
13417752Smckusick 		np = lookupname(name);
13556567Sbostic 		if (np == NULL || (np->e_flags & NEW) == 0) {
13617752Smckusick 			fprintf(stderr, "%s: not on extraction list\n", name);
13717752Smckusick 			break;
13817752Smckusick 		}
13917752Smckusick 		treescan(name, np->e_ino, deletefile);
14017752Smckusick 		break;
14117752Smckusick 	/*
14217752Smckusick 	 * Extract the requested list.
14317752Smckusick 	 */
14417752Smckusick 	case 'e':
14529903Smckusick 		if (strncmp(cmd, "extract", strlen(cmd)) != 0)
14629903Smckusick 			goto bad;
14717752Smckusick 		createfiles();
14817752Smckusick 		createlinks();
14955880Smckusick 		setdirmodes(0);
15017752Smckusick 		if (dflag)
15117752Smckusick 			checkrestore();
15217752Smckusick 		volno = 0;
15317752Smckusick 		break;
15417752Smckusick 	/*
15517752Smckusick 	 * List available commands.
15617752Smckusick 	 */
15717752Smckusick 	case 'h':
15829903Smckusick 		if (strncmp(cmd, "help", strlen(cmd)) != 0)
15929903Smckusick 			goto bad;
16017752Smckusick 	case '?':
16129903Smckusick 		fprintf(stderr, "%s%s%s%s%s%s%s%s%s%s%s%s%s%s%s%s%s",
16217752Smckusick 			"Available commands are:\n",
16317752Smckusick 			"\tls [arg] - list directory\n",
16417752Smckusick 			"\tcd arg - change directory\n",
16517752Smckusick 			"\tpwd - print current directory\n",
16617752Smckusick 			"\tadd [arg] - add `arg' to list of",
16717752Smckusick 			" files to be extracted\n",
16817752Smckusick 			"\tdelete [arg] - delete `arg' from",
16917752Smckusick 			" list of files to be extracted\n",
17017752Smckusick 			"\textract - extract requested files\n",
17121096Smckusick 			"\tsetmodes - set modes of requested directories\n",
17217752Smckusick 			"\tquit - immediately exit program\n",
17329903Smckusick 			"\twhat - list dump header information\n",
17417752Smckusick 			"\tverbose - toggle verbose flag",
17517752Smckusick 			" (useful with ``ls'')\n",
17617752Smckusick 			"\thelp or `?' - print this list\n",
17717752Smckusick 			"If no `arg' is supplied, the current",
17817752Smckusick 			" directory is used\n");
17917752Smckusick 		break;
18017752Smckusick 	/*
18117752Smckusick 	 * List a directory.
18217752Smckusick 	 */
18317752Smckusick 	case 'l':
18429903Smckusick 		if (strncmp(cmd, "ls", strlen(cmd)) != 0)
18529903Smckusick 			goto bad;
18656948Smckusick 		printlist(name, curdir);
18717752Smckusick 		break;
18817752Smckusick 	/*
18917752Smckusick 	 * Print current directory.
19017752Smckusick 	 */
19117752Smckusick 	case 'p':
19229903Smckusick 		if (strncmp(cmd, "pwd", strlen(cmd)) != 0)
19329903Smckusick 			goto bad;
19417752Smckusick 		if (curdir[1] == '\0')
19517752Smckusick 			fprintf(stderr, "/\n");
19617752Smckusick 		else
19717752Smckusick 			fprintf(stderr, "%s\n", &curdir[1]);
19817752Smckusick 		break;
19917752Smckusick 	/*
20017752Smckusick 	 * Quit.
20117752Smckusick 	 */
20217752Smckusick 	case 'q':
20329903Smckusick 		if (strncmp(cmd, "quit", strlen(cmd)) != 0)
20429903Smckusick 			goto bad;
20529903Smckusick 		return;
20617752Smckusick 	case 'x':
20729903Smckusick 		if (strncmp(cmd, "xit", strlen(cmd)) != 0)
20829903Smckusick 			goto bad;
20917752Smckusick 		return;
21017752Smckusick 	/*
21117752Smckusick 	 * Toggle verbose mode.
21217752Smckusick 	 */
21317752Smckusick 	case 'v':
21429903Smckusick 		if (strncmp(cmd, "verbose", strlen(cmd)) != 0)
21529903Smckusick 			goto bad;
21617752Smckusick 		if (vflag) {
21717752Smckusick 			fprintf(stderr, "verbose mode off\n");
21817752Smckusick 			vflag = 0;
21917752Smckusick 			break;
22017752Smckusick 		}
22117752Smckusick 		fprintf(stderr, "verbose mode on\n");
22217752Smckusick 		vflag++;
22317752Smckusick 		break;
22417752Smckusick 	/*
22517752Smckusick 	 * Just restore requested directory modes.
22617752Smckusick 	 */
22721096Smckusick 	case 's':
22829903Smckusick 		if (strncmp(cmd, "setmodes", strlen(cmd)) != 0)
22929903Smckusick 			goto bad;
23055880Smckusick 		setdirmodes(FORCE);
23117752Smckusick 		break;
23217752Smckusick 	/*
23329903Smckusick 	 * Print out dump header information.
23429903Smckusick 	 */
23529903Smckusick 	case 'w':
23629903Smckusick 		if (strncmp(cmd, "what", strlen(cmd)) != 0)
23729903Smckusick 			goto bad;
23829903Smckusick 		printdumpinfo();
23929903Smckusick 		break;
24029903Smckusick 	/*
24117752Smckusick 	 * Turn on debugging.
24217752Smckusick 	 */
24317752Smckusick 	case 'D':
24429903Smckusick 		if (strncmp(cmd, "Debug", strlen(cmd)) != 0)
24529903Smckusick 			goto bad;
24617752Smckusick 		if (dflag) {
24717752Smckusick 			fprintf(stderr, "debugging mode off\n");
24817752Smckusick 			dflag = 0;
24917752Smckusick 			break;
25017752Smckusick 		}
25117752Smckusick 		fprintf(stderr, "debugging mode on\n");
25217752Smckusick 		dflag++;
25317752Smckusick 		break;
25417752Smckusick 	/*
25517752Smckusick 	 * Unknown command.
25617752Smckusick 	 */
25717752Smckusick 	default:
25829903Smckusick 	bad:
25917752Smckusick 		fprintf(stderr, "%s: unknown command; type ? for help\n", cmd);
26017752Smckusick 		break;
26117752Smckusick 	}
26217752Smckusick 	goto loop;
26317752Smckusick }
26417752Smckusick 
26517752Smckusick /*
26617752Smckusick  * Read and parse an interactive command.
26717752Smckusick  * The first word on the line is assigned to "cmd". If
26817752Smckusick  * there are no arguments on the command line, then "curdir"
26917752Smckusick  * is returned as the argument. If there are arguments
27017752Smckusick  * on the line they are returned one at a time on each
27117752Smckusick  * successive call to getcmd. Each argument is first assigned
27217752Smckusick  * to "name". If it does not start with "/" the pathname in
27317752Smckusick  * "curdir" is prepended to it. Finally "canon" is called to
27417752Smckusick  * eliminate any embedded ".." components.
27517752Smckusick  */
27656567Sbostic static void
getcmd(curdir,cmd,name,ap)27718003Smckusick getcmd(curdir, cmd, name, ap)
27817752Smckusick 	char *curdir, *cmd, *name;
27918003Smckusick 	struct arglist *ap;
28017752Smckusick {
28117752Smckusick 	register char *cp;
28217752Smckusick 	static char input[BUFSIZ];
28317752Smckusick 	char output[BUFSIZ];
28417752Smckusick #	define rawname input	/* save space by reusing input buffer */
28517752Smckusick 
28617752Smckusick 	/*
28717752Smckusick 	 * Check to see if still processing arguments.
28817752Smckusick 	 */
28956948Smckusick 	if (ap->argcnt > 0)
29056948Smckusick 		goto retnext;
29117752Smckusick 	if (nextarg != NULL)
29217752Smckusick 		goto getnext;
29317752Smckusick 	/*
29417752Smckusick 	 * Read a command line and trim off trailing white space.
29517752Smckusick 	 */
29617752Smckusick 	do	{
29717752Smckusick 		fprintf(stderr, "restore > ");
29817752Smckusick 		(void) fflush(stderr);
29917752Smckusick 		(void) fgets(input, BUFSIZ, terminal);
30017752Smckusick 	} while (!feof(terminal) && input[0] == '\n');
30117752Smckusick 	if (feof(terminal)) {
30217752Smckusick 		(void) strcpy(cmd, "quit");
30317752Smckusick 		return;
30417752Smckusick 	}
30517752Smckusick 	for (cp = &input[strlen(input) - 2]; *cp == ' ' || *cp == '\t'; cp--)
30617752Smckusick 		/* trim off trailing white space and newline */;
30717752Smckusick 	*++cp = '\0';
30817752Smckusick 	/*
30917752Smckusick 	 * Copy the command into "cmd".
31017752Smckusick 	 */
31117752Smckusick 	cp = copynext(input, cmd);
31218003Smckusick 	ap->cmd = cmd;
31317752Smckusick 	/*
31417752Smckusick 	 * If no argument, use curdir as the default.
31517752Smckusick 	 */
31617752Smckusick 	if (*cp == '\0') {
31717752Smckusick 		(void) strcpy(name, curdir);
31817752Smckusick 		return;
31917752Smckusick 	}
32017752Smckusick 	nextarg = cp;
32117752Smckusick 	/*
32217752Smckusick 	 * Find the next argument.
32317752Smckusick 	 */
32417752Smckusick getnext:
32517752Smckusick 	cp = copynext(nextarg, rawname);
32617752Smckusick 	if (*cp == '\0')
32717752Smckusick 		nextarg = NULL;
32817752Smckusick 	else
32917752Smckusick 		nextarg = cp;
33017752Smckusick 	/*
33156948Smckusick 	 * If it is an absolute pathname, canonicalize it and return it.
33217752Smckusick 	 */
33317752Smckusick 	if (rawname[0] == '/') {
33417752Smckusick 		canon(rawname, name);
33517752Smckusick 	} else {
33617752Smckusick 		/*
33717752Smckusick 		 * For relative pathnames, prepend the current directory to
33817752Smckusick 		 * it then canonicalize and return it.
33917752Smckusick 		 */
34017752Smckusick 		(void) strcpy(output, curdir);
34117752Smckusick 		(void) strcat(output, "/");
34217752Smckusick 		(void) strcat(output, rawname);
34317752Smckusick 		canon(output, name);
34417752Smckusick 	}
34556948Smckusick 	if (glob(name, GLOB_ALTDIRFUNC, NULL, &ap->glob) < 0)
34656948Smckusick 		fprintf(stderr, "%s: out of memory\n", ap->cmd);
34756948Smckusick 	if (ap->glob.gl_pathc == 0)
34856948Smckusick 		return;
34956948Smckusick 	ap->freeglob = 1;
35056948Smckusick 	ap->argcnt = ap->glob.gl_pathc;
35156948Smckusick 
35256948Smckusick retnext:
35356948Smckusick 	strcpy(name, ap->glob.gl_pathv[ap->glob.gl_pathc - ap->argcnt]);
35456948Smckusick 	if (--ap->argcnt == 0) {
35556948Smckusick 		ap->freeglob = 0;
35656948Smckusick 		globfree(&ap->glob);
35756948Smckusick 	}
35817752Smckusick #	undef rawname
35917752Smckusick }
36017752Smckusick 
36117752Smckusick /*
36217752Smckusick  * Strip off the next token of the input.
36317752Smckusick  */
36456567Sbostic static char *
copynext(input,output)36517752Smckusick copynext(input, output)
36617752Smckusick 	char *input, *output;
36717752Smckusick {
36817752Smckusick 	register char *cp, *bp;
36917752Smckusick 	char quote;
37017752Smckusick 
37117752Smckusick 	for (cp = input; *cp == ' ' || *cp == '\t'; cp++)
37217752Smckusick 		/* skip to argument */;
37317752Smckusick 	bp = output;
37417752Smckusick 	while (*cp != ' ' && *cp != '\t' && *cp != '\0') {
37517752Smckusick 		/*
37617752Smckusick 		 * Handle back slashes.
37717752Smckusick 		 */
37817752Smckusick 		if (*cp == '\\') {
37917752Smckusick 			if (*++cp == '\0') {
38017752Smckusick 				fprintf(stderr,
38117752Smckusick 					"command lines cannot be continued\n");
38217752Smckusick 				continue;
38317752Smckusick 			}
38417752Smckusick 			*bp++ = *cp++;
38517752Smckusick 			continue;
38617752Smckusick 		}
38717752Smckusick 		/*
38817752Smckusick 		 * The usual unquoted case.
38917752Smckusick 		 */
39017752Smckusick 		if (*cp != '\'' && *cp != '"') {
39117752Smckusick 			*bp++ = *cp++;
39217752Smckusick 			continue;
39317752Smckusick 		}
39417752Smckusick 		/*
39517752Smckusick 		 * Handle single and double quotes.
39617752Smckusick 		 */
39717752Smckusick 		quote = *cp++;
39817752Smckusick 		while (*cp != quote && *cp != '\0')
39917752Smckusick 			*bp++ = *cp++ | 0200;
40017752Smckusick 		if (*cp++ == '\0') {
40117752Smckusick 			fprintf(stderr, "missing %c\n", quote);
40217752Smckusick 			cp--;
40317752Smckusick 			continue;
40417752Smckusick 		}
40517752Smckusick 	}
40617752Smckusick 	*bp = '\0';
40717752Smckusick 	return (cp);
40817752Smckusick }
40917752Smckusick 
41017752Smckusick /*
41117752Smckusick  * Canonicalize file names to always start with ``./'' and
41218003Smckusick  * remove any imbedded "." and ".." components.
41317752Smckusick  */
41456567Sbostic void
canon(rawname,canonname)41517752Smckusick canon(rawname, canonname)
41617752Smckusick 	char *rawname, *canonname;
41717752Smckusick {
41817752Smckusick 	register char *cp, *np;
41917752Smckusick 
42017752Smckusick 	if (strcmp(rawname, ".") == 0 || strncmp(rawname, "./", 2) == 0)
42117752Smckusick 		(void) strcpy(canonname, "");
42217752Smckusick 	else if (rawname[0] == '/')
42317752Smckusick 		(void) strcpy(canonname, ".");
42417752Smckusick 	else
42517752Smckusick 		(void) strcpy(canonname, "./");
42617752Smckusick 	(void) strcat(canonname, rawname);
42717752Smckusick 	/*
42818003Smckusick 	 * Eliminate multiple and trailing '/'s
42917752Smckusick 	 */
43018003Smckusick 	for (cp = np = canonname; *np != '\0'; cp++) {
43118003Smckusick 		*cp = *np++;
43218003Smckusick 		while (*cp == '/' && *np == '/')
43318003Smckusick 			np++;
43418003Smckusick 	}
43518003Smckusick 	*cp = '\0';
43618003Smckusick 	if (*--cp == '/')
43718003Smckusick 		*cp = '\0';
43818003Smckusick 	/*
43918003Smckusick 	 * Eliminate extraneous "." and ".." from pathnames.
44018003Smckusick 	 */
44117752Smckusick 	for (np = canonname; *np != '\0'; ) {
44217752Smckusick 		np++;
44317752Smckusick 		cp = np;
44417752Smckusick 		while (*np != '/' && *np != '\0')
44517752Smckusick 			np++;
44618003Smckusick 		if (np - cp == 1 && *cp == '.') {
44718003Smckusick 			cp--;
44818003Smckusick 			(void) strcpy(cp, np);
44918003Smckusick 			np = cp;
45018003Smckusick 		}
45117752Smckusick 		if (np - cp == 2 && strncmp(cp, "..", 2) == 0) {
45217752Smckusick 			cp--;
45317752Smckusick 			while (cp > &canonname[1] && *--cp != '/')
45417752Smckusick 				/* find beginning of name */;
45517752Smckusick 			(void) strcpy(cp, np);
45617752Smckusick 			np = cp;
45717752Smckusick 		}
45817752Smckusick 	}
45917752Smckusick }
46017752Smckusick 
46117752Smckusick /*
46217752Smckusick  * Do an "ls" style listing of a directory
46317752Smckusick  */
46456567Sbostic static void
printlist(name,basename)46556948Smckusick printlist(name, basename)
46617752Smckusick 	char *name;
46717752Smckusick 	char *basename;
46817752Smckusick {
46956948Smckusick 	register struct afile *fp, *list, *listp;
47018003Smckusick 	register struct direct *dp;
47117752Smckusick 	struct afile single;
47250655Smckusick 	RST_DIR *dirp;
47367757Smckusick 	int entries, len, namelen;
47467757Smckusick 	char locname[MAXPATHLEN + 1];
47517752Smckusick 
47656948Smckusick 	dp = pathsearch(name);
47767757Smckusick 	if (dp == NULL || (!dflag && TSTINO(dp->d_ino, dumpmap) == 0) ||
47867757Smckusick 	    (!vflag && dp->d_ino == WINO))
47956948Smckusick 		return;
48017752Smckusick 	if ((dirp = rst_opendir(name)) == NULL) {
48156948Smckusick 		entries = 1;
48256948Smckusick 		list = &single;
48367757Smckusick 		mkentry(name, dp, list);
48456948Smckusick 		len = strlen(basename) + 1;
48556948Smckusick 		if (strlen(name) - len > single.len) {
48656948Smckusick 			freename(single.fname);
48756948Smckusick 			single.fname = savename(&name[len]);
48856948Smckusick 			single.len = strlen(single.fname);
48956948Smckusick 		}
49017752Smckusick 	} else {
49156948Smckusick 		entries = 0;
49256948Smckusick 		while (dp = rst_readdir(dirp))
49356948Smckusick 			entries++;
49456948Smckusick 		rst_closedir(dirp);
49556948Smckusick 		list = (struct afile *)malloc(entries * sizeof(struct afile));
49656948Smckusick 		if (list == NULL) {
49756948Smckusick 			fprintf(stderr, "ls: out of memory\n");
49856948Smckusick 			return;
49956948Smckusick 		}
50056948Smckusick 		if ((dirp = rst_opendir(name)) == NULL)
50156948Smckusick 			panic("directory reopen failed\n");
50218003Smckusick 		fprintf(stderr, "%s:\n", name);
50356948Smckusick 		entries = 0;
50456948Smckusick 		listp = list;
50567757Smckusick 		(void) strncpy(locname, name, MAXPATHLEN);
50667757Smckusick 		(void) strncat(locname, "/", MAXPATHLEN);
50767757Smckusick 		namelen = strlen(locname);
50818003Smckusick 		while (dp = rst_readdir(dirp)) {
50967757Smckusick 			if (dp == NULL)
51018003Smckusick 				break;
51156427Smckusick 			if (!dflag && TSTINO(dp->d_ino, dumpmap) == 0)
51218003Smckusick 				continue;
51367757Smckusick 			if (!vflag && (dp->d_ino == WINO ||
51467757Smckusick 			     strcmp(dp->d_name, ".") == 0 ||
51518003Smckusick 			     strcmp(dp->d_name, "..") == 0))
51618003Smckusick 				continue;
51767757Smckusick 			locname[namelen] = '\0';
51867757Smckusick 			if (namelen + dp->d_namlen >= MAXPATHLEN) {
51967757Smckusick 				fprintf(stderr, "%s%s: name exceeds %d char\n",
52067757Smckusick 					locname, dp->d_name, MAXPATHLEN);
52167757Smckusick 			} else {
52267757Smckusick 				(void) strncat(locname, dp->d_name,
52367757Smckusick 				    (int)dp->d_namlen);
52467757Smckusick 				mkentry(locname, dp, listp++);
52567757Smckusick 				entries++;
52667757Smckusick 			}
52718003Smckusick 		}
52856948Smckusick 		rst_closedir(dirp);
52956948Smckusick 		if (entries == 0) {
53056948Smckusick 			fprintf(stderr, "\n");
53156948Smckusick 			free(list);
53256948Smckusick 			return;
53356948Smckusick 		}
53456948Smckusick 		qsort((char *)list, entries, sizeof(struct afile), fcmp);
53517752Smckusick 	}
53656948Smckusick 	formatf(list, entries);
53756948Smckusick 	if (dirp != NULL) {
53856948Smckusick 		for (fp = listp - 1; fp >= list; fp--)
53918003Smckusick 			freename(fp->fname);
54056948Smckusick 		fprintf(stderr, "\n");
54156948Smckusick 		free(list);
54218003Smckusick 	}
54317752Smckusick }
54417752Smckusick 
54517752Smckusick /*
54617752Smckusick  * Read the contents of a directory.
54717752Smckusick  */
54856948Smckusick static void
mkentry(name,dp,fp)54967757Smckusick mkentry(name, dp, fp)
55067757Smckusick 	char *name;
55154593Smckusick 	struct direct *dp;
55256948Smckusick 	register struct afile *fp;
55317752Smckusick {
55456948Smckusick 	char *cp;
55556948Smckusick 	struct entry *np;
55617752Smckusick 
55754593Smckusick 	fp->fnum = dp->d_ino;
55856948Smckusick 	fp->fname = savename(dp->d_name);
55956948Smckusick 	for (cp = fp->fname; *cp; cp++)
56056948Smckusick 		if (!vflag && (*cp < ' ' || *cp >= 0177))
56156948Smckusick 			*cp = '?';
56256948Smckusick 	fp->len = cp - fp->fname;
56356948Smckusick 	if (dflag && TSTINO(fp->fnum, dumpmap) == 0)
56456948Smckusick 		fp->prefix = '^';
56567757Smckusick 	else if ((np = lookupname(name)) != NULL && (np->e_flags & NEW))
56656948Smckusick 		fp->prefix = '*';
56754593Smckusick 	else
56856948Smckusick 		fp->prefix = ' ';
56956948Smckusick 	switch(dp->d_type) {
57056948Smckusick 
57156948Smckusick 	default:
57256948Smckusick 		fprintf(stderr, "Warning: undefined file type %d\n",
57356948Smckusick 		    dp->d_type);
57456948Smckusick 		/* fall through */
57556948Smckusick 	case DT_REG:
57656948Smckusick 		fp->postfix = ' ';
57756948Smckusick 		break;
57856948Smckusick 
57956948Smckusick 	case DT_LNK:
58056948Smckusick 		fp->postfix = '@';
58156948Smckusick 		break;
58256948Smckusick 
58356948Smckusick 	case DT_FIFO:
58456948Smckusick 	case DT_SOCK:
58556948Smckusick 		fp->postfix = '=';
58656948Smckusick 		break;
58756948Smckusick 
58856948Smckusick 	case DT_CHR:
58956948Smckusick 	case DT_BLK:
59056948Smckusick 		fp->postfix = '#';
59156948Smckusick 		break;
59256948Smckusick 
59367777Smckusick 	case DT_WHT:
59467777Smckusick 		fp->postfix = '%';
59567777Smckusick 		break;
59667777Smckusick 
59756948Smckusick 	case DT_UNKNOWN:
59856948Smckusick 	case DT_DIR:
59956948Smckusick 		if (inodetype(dp->d_ino) == NODE)
60056948Smckusick 			fp->postfix = '/';
60156948Smckusick 		else
60256948Smckusick 			fp->postfix = ' ';
60356948Smckusick 		break;
60417752Smckusick 	}
60556948Smckusick 	return;
60617752Smckusick }
60717752Smckusick 
60817752Smckusick /*
60917752Smckusick  * Print out a pretty listing of a directory
61017752Smckusick  */
61156567Sbostic static void
formatf(list,nentry)61256948Smckusick formatf(list, nentry)
61356948Smckusick 	register struct afile *list;
61456948Smckusick 	int nentry;
61517752Smckusick {
61656948Smckusick 	register struct afile *fp, *endlist;
61756948Smckusick 	int width, bigino, haveprefix, havepostfix;
61856948Smckusick 	int i, j, w, precision, columns, lines;
61917752Smckusick 
62056948Smckusick 	width = 0;
62156948Smckusick 	haveprefix = 0;
62256948Smckusick 	havepostfix = 0;
62356948Smckusick 	bigino = ROOTINO;
62456948Smckusick 	endlist = &list[nentry];
62556948Smckusick 	for (fp = &list[0]; fp < endlist; fp++) {
62656948Smckusick 		if (bigino < fp->fnum)
62756948Smckusick 			bigino = fp->fnum;
62856948Smckusick 		if (width < fp->len)
62956948Smckusick 			width = fp->len;
63056948Smckusick 		if (fp->prefix != ' ')
63156948Smckusick 			haveprefix = 1;
63256948Smckusick 		if (fp->postfix != ' ')
63356948Smckusick 			havepostfix = 1;
63417752Smckusick 	}
63556948Smckusick 	if (haveprefix)
63656948Smckusick 		width++;
63756948Smckusick 	if (havepostfix)
63856948Smckusick 		width++;
63956948Smckusick 	if (vflag) {
64056948Smckusick 		for (precision = 0, i = bigino; i > 0; i /= 10)
64156948Smckusick 			precision++;
64256948Smckusick 		width += precision + 1;
64356948Smckusick 	}
64456948Smckusick 	width++;
64556948Smckusick 	columns = 81 / width;
64617752Smckusick 	if (columns == 0)
64717752Smckusick 		columns = 1;
64817752Smckusick 	lines = (nentry + columns - 1) / columns;
64917752Smckusick 	for (i = 0; i < lines; i++) {
65017752Smckusick 		for (j = 0; j < columns; j++) {
65156948Smckusick 			fp = &list[j * lines + i];
65256948Smckusick 			if (vflag) {
65356948Smckusick 				fprintf(stderr, "%*d ", precision, fp->fnum);
65456948Smckusick 				fp->len += precision + 1;
65556948Smckusick 			}
65656948Smckusick 			if (haveprefix) {
65756948Smckusick 				putc(fp->prefix, stderr);
65856948Smckusick 				fp->len++;
65956948Smckusick 			}
66056948Smckusick 			fprintf(stderr, "%s", fp->fname);
66156948Smckusick 			if (havepostfix) {
66256948Smckusick 				putc(fp->postfix, stderr);
66356948Smckusick 				fp->len++;
66456948Smckusick 			}
66556948Smckusick 			if (fp + lines >= endlist) {
66617752Smckusick 				fprintf(stderr, "\n");
66717752Smckusick 				break;
66817752Smckusick 			}
66956948Smckusick 			for (w = fp->len; w < width; w++)
67056948Smckusick 				putc(' ', stderr);
67117752Smckusick 		}
67217752Smckusick 	}
67317752Smckusick }
67417752Smckusick 
67517752Smckusick /*
67656948Smckusick  * Skip over directory entries that are not on the tape
67756948Smckusick  *
67856948Smckusick  * First have to get definition of a dirent.
67917752Smckusick  */
68056948Smckusick #undef DIRBLKSIZ
68156948Smckusick #include <dirent.h>
68256948Smckusick #undef d_ino
68356948Smckusick 
68456948Smckusick struct dirent *
glob_readdir(dirp)68556948Smckusick glob_readdir(dirp)
68656948Smckusick 	RST_DIR *dirp;
68717752Smckusick {
68856948Smckusick 	struct direct *dp;
68956948Smckusick 	static struct dirent adirent;
69056948Smckusick 
69156948Smckusick 	while ((dp = rst_readdir(dirp)) != NULL) {
69267777Smckusick 		if (!vflag && dp->d_ino == WINO)
69356948Smckusick 			continue;
69456948Smckusick 		if (dflag || TSTINO(dp->d_ino, dumpmap))
69556948Smckusick 			break;
69656948Smckusick 	}
69756948Smckusick 	if (dp == NULL)
69856948Smckusick 		return (NULL);
69956948Smckusick 	adirent.d_fileno = dp->d_ino;
70056948Smckusick 	adirent.d_namlen = dp->d_namlen;
70169001Sbostic 	memmove(adirent.d_name, dp->d_name, dp->d_namlen + 1);
70256948Smckusick 	return (&adirent);
70317752Smckusick }
70417752Smckusick 
70517752Smckusick /*
70656948Smckusick  * Return st_mode information in response to stat or lstat calls
70717752Smckusick  */
70856948Smckusick static int
glob_stat(name,stp)70956948Smckusick glob_stat(name, stp)
71057896Sbostic 	const char *name;
71156948Smckusick 	struct stat *stp;
71217752Smckusick {
71356948Smckusick 	register struct direct *dp;
71417752Smckusick 
71556948Smckusick 	dp = pathsearch(name);
71667777Smckusick 	if (dp == NULL || (!dflag && TSTINO(dp->d_ino, dumpmap) == 0) ||
71767777Smckusick 	    (!vflag && dp->d_ino == WINO))
71856948Smckusick 		return (-1);
71956948Smckusick 	if (inodetype(dp->d_ino) == NODE)
72056948Smckusick 		stp->st_mode = IFDIR;
72117752Smckusick 	else
72256948Smckusick 		stp->st_mode = IFREG;
72356948Smckusick 	return (0);
72456948Smckusick }
72554593Smckusick 
72656948Smckusick /*
72756948Smckusick  * Comparison routine for qsort.
72856948Smckusick  */
72956948Smckusick static int
fcmp(f1,f2)73056948Smckusick fcmp(f1, f2)
73156948Smckusick 	register const void *f1, *f2;
73256948Smckusick {
73356948Smckusick 	return (strcmp(((struct afile *)f1)->fname,
73456948Smckusick 	    ((struct afile *)f2)->fname));
73517752Smckusick }
73617752Smckusick 
73717752Smckusick /*
73817752Smckusick  * respond to interrupts
73917752Smckusick  */
74039942Sbostic void
onintr(signo)74156567Sbostic onintr(signo)
74256567Sbostic 	int signo;
74317752Smckusick {
74456429Smckusick 	if (command == 'i' && runshell)
74517752Smckusick 		longjmp(reset, 1);
74617752Smckusick 	if (reply("restore interrupted, continue") == FAIL)
74717752Smckusick 		done(1);
74817752Smckusick }
749