xref: /csrg-svn/bin/sh/parser.c (revision 69509)
147139Sbostic /*-
260698Sbostic  * Copyright (c) 1991, 1993
360698Sbostic  *	The Regents of the University of California.  All rights reserved.
447139Sbostic  *
547139Sbostic  * This code is derived from software contributed to Berkeley by
647139Sbostic  * Kenneth Almquist.
747139Sbostic  *
847139Sbostic  * %sccs.include.redist.c%
947139Sbostic  */
1047139Sbostic 
1147139Sbostic #ifndef lint
12*69509Schristos static char sccsid[] = "@(#)parser.c	8.7 (Berkeley) 05/16/95";
1347139Sbostic #endif /* not lint */
1447139Sbostic 
1569272Schristos #include <stdlib.h>
1669272Schristos 
1747139Sbostic #include "shell.h"
1847139Sbostic #include "parser.h"
1947139Sbostic #include "nodes.h"
2047139Sbostic #include "expand.h"	/* defines rmescapes() */
2147139Sbostic #include "redir.h"	/* defines copyfd() */
2247139Sbostic #include "syntax.h"
2347139Sbostic #include "options.h"
2447139Sbostic #include "input.h"
2547139Sbostic #include "output.h"
2647139Sbostic #include "var.h"
2747139Sbostic #include "error.h"
2847139Sbostic #include "memalloc.h"
2947139Sbostic #include "mystring.h"
3054322Smarc #include "alias.h"
3169272Schristos #include "show.h"
3269272Schristos #ifndef NO_HISTORY
3354330Smarc #include "myhistedit.h"
3469272Schristos #endif
3547139Sbostic 
3647139Sbostic /*
3747139Sbostic  * Shell command parser.
3847139Sbostic  */
3947139Sbostic 
4047139Sbostic #define EOFMARKLEN 79
4147139Sbostic 
4247139Sbostic /* values returned by readtoken */
4347139Sbostic #include "token.def"
4447139Sbostic 
4547139Sbostic 
4647139Sbostic 
4747139Sbostic struct heredoc {
4847139Sbostic 	struct heredoc *next;	/* next here document in list */
4947139Sbostic 	union node *here;		/* redirection node */
5047139Sbostic 	char *eofmark;		/* string indicating end of input */
5147139Sbostic 	int striptabs;		/* if set, strip leading tabs */
5247139Sbostic };
5347139Sbostic 
5447139Sbostic 
5547139Sbostic 
5647139Sbostic struct heredoc *heredoclist;	/* list of here documents to read */
5747139Sbostic int parsebackquote;		/* nonzero if we are inside backquotes */
5847139Sbostic int doprompt;			/* if set, prompt the user */
5947139Sbostic int needprompt;			/* true if interactive and at start of line */
6047139Sbostic int lasttoken;			/* last token read */
6147139Sbostic MKINIT int tokpushback;		/* last token pushed back */
6247139Sbostic char *wordtext;			/* text of last word returned by readtoken */
6354322Smarc MKINIT int checkkwd;            /* 1 == check for kwds, 2 == also eat newlines */
6447139Sbostic struct nodelist *backquotelist;
6547139Sbostic union node *redirnode;
6647139Sbostic struct heredoc *heredoc;
6747139Sbostic int quoteflag;			/* set if (part of) last token was quoted */
6847139Sbostic int startlinno;			/* line # where last token started */
6947139Sbostic 
7047139Sbostic 
7147139Sbostic #define GDB_HACK 1 /* avoid local declarations which gdb can't handle */
7247139Sbostic #ifdef GDB_HACK
7347139Sbostic static const char argvars[5] = {CTLVAR, VSNORMAL|VSQUOTE, '@', '=', '\0'};
7447139Sbostic static const char types[] = "}-+?=";
7547139Sbostic #endif
7647139Sbostic 
7747139Sbostic 
7847981Smarc STATIC union node *list __P((int));
7947981Smarc STATIC union node *andor __P((void));
8047981Smarc STATIC union node *pipeline __P((void));
8147981Smarc STATIC union node *command __P((void));
8260296Smarc STATIC union node *simplecmd __P((union node **, union node *));
8369272Schristos STATIC union node *makename __P((void));
8447981Smarc STATIC void parsefname __P((void));
8547981Smarc STATIC void parseheredoc __P((void));
8669272Schristos STATIC int peektoken __P((void));
8747981Smarc STATIC int readtoken __P((void));
8869272Schristos STATIC int xxreadtoken __P((void));
8947981Smarc STATIC int readtoken1 __P((int, char const *, char *, int));
9047981Smarc STATIC int noexpand __P((char *));
9147981Smarc STATIC void synexpect __P((int));
9247981Smarc STATIC void synerror __P((char *));
9369272Schristos STATIC void setprompt __P((int));
9447139Sbostic 
9569272Schristos 
9647139Sbostic /*
9747139Sbostic  * Read and parse a command.  Returns NEOF on end of file.  (NULL is a
9847139Sbostic  * valid parse tree indicating a blank line.)
9947139Sbostic  */
10047139Sbostic 
10147139Sbostic union node *
parsecmd(interact)10269272Schristos parsecmd(interact)
10369272Schristos 	int interact;
10469272Schristos {
10547139Sbostic 	int t;
10647139Sbostic 
10747139Sbostic 	doprompt = interact;
10847139Sbostic 	if (doprompt)
10954322Smarc 		setprompt(1);
11054322Smarc 	else
11154322Smarc 		setprompt(0);
11247139Sbostic 	needprompt = 0;
11354322Smarc 	t = readtoken();
11454322Smarc 	if (t == TEOF)
11547139Sbostic 		return NEOF;
11647139Sbostic 	if (t == TNL)
11747139Sbostic 		return NULL;
11847139Sbostic 	tokpushback++;
11947139Sbostic 	return list(1);
12047139Sbostic }
12147139Sbostic 
12247139Sbostic 
12347139Sbostic STATIC union node *
list(nlflag)12469272Schristos list(nlflag)
12569272Schristos 	int nlflag;
12669272Schristos {
12747139Sbostic 	union node *n1, *n2, *n3;
12868927Sbostic 	int tok;
12947139Sbostic 
13047981Smarc 	checkkwd = 2;
13147981Smarc 	if (nlflag == 0 && tokendlist[peektoken()])
13247139Sbostic 		return NULL;
13368927Sbostic 	n1 = NULL;
13447139Sbostic 	for (;;) {
13568927Sbostic 		n2 = andor();
13668927Sbostic 		tok = readtoken();
13768927Sbostic 		if (tok == TBACKGND) {
13868927Sbostic 			if (n2->type == NCMD || n2->type == NPIPE) {
13968927Sbostic 				n2->ncmd.backgnd = 1;
14068927Sbostic 			} else if (n2->type == NREDIR) {
14168927Sbostic 				n2->type = NBACKGND;
14247139Sbostic 			} else {
14347139Sbostic 				n3 = (union node *)stalloc(sizeof (struct nredir));
14447139Sbostic 				n3->type = NBACKGND;
14568927Sbostic 				n3->nredir.n = n2;
14647139Sbostic 				n3->nredir.redirect = NULL;
14768927Sbostic 				n2 = n3;
14847139Sbostic 			}
14968927Sbostic 		}
15068927Sbostic 		if (n1 == NULL) {
15168927Sbostic 			n1 = n2;
15268927Sbostic 		}
15368927Sbostic 		else {
15468927Sbostic 			n3 = (union node *)stalloc(sizeof (struct nbinary));
15568927Sbostic 			n3->type = NSEMI;
15668927Sbostic 			n3->nbinary.ch1 = n1;
15768927Sbostic 			n3->nbinary.ch2 = n2;
15868927Sbostic 			n1 = n3;
15968927Sbostic 		}
16068927Sbostic 		switch (tok) {
16168927Sbostic 		case TBACKGND:
16268927Sbostic 		case TSEMI:
16368927Sbostic 			tok = readtoken();
16468927Sbostic 			/* fall through */
16547139Sbostic 		case TNL:
16668927Sbostic 			if (tok == TNL) {
16747139Sbostic 				parseheredoc();
16847139Sbostic 				if (nlflag)
16947139Sbostic 					return n1;
17047139Sbostic 			} else {
17147139Sbostic 				tokpushback++;
17247139Sbostic 			}
17347981Smarc 			checkkwd = 2;
17447981Smarc 			if (tokendlist[peektoken()])
17547139Sbostic 				return n1;
17647139Sbostic 			break;
17747139Sbostic 		case TEOF:
17847139Sbostic 			if (heredoclist)
17947139Sbostic 				parseheredoc();
18047139Sbostic 			else
18147139Sbostic 				pungetc();		/* push back EOF on input */
18247139Sbostic 			return n1;
18347139Sbostic 		default:
18447139Sbostic 			if (nlflag)
18547139Sbostic 				synexpect(-1);
18647139Sbostic 			tokpushback++;
18747139Sbostic 			return n1;
18847139Sbostic 		}
18947139Sbostic 	}
19047139Sbostic }
19147139Sbostic 
19247139Sbostic 
19347139Sbostic 
19447139Sbostic STATIC union node *
andor()19547139Sbostic andor() {
19647139Sbostic 	union node *n1, *n2, *n3;
19747139Sbostic 	int t;
19847139Sbostic 
19947139Sbostic 	n1 = pipeline();
20047139Sbostic 	for (;;) {
20147139Sbostic 		if ((t = readtoken()) == TAND) {
20247139Sbostic 			t = NAND;
20347139Sbostic 		} else if (t == TOR) {
20447139Sbostic 			t = NOR;
20547139Sbostic 		} else {
20647139Sbostic 			tokpushback++;
20747139Sbostic 			return n1;
20847139Sbostic 		}
20947139Sbostic 		n2 = pipeline();
21047139Sbostic 		n3 = (union node *)stalloc(sizeof (struct nbinary));
21147139Sbostic 		n3->type = t;
21247139Sbostic 		n3->nbinary.ch1 = n1;
21347139Sbostic 		n3->nbinary.ch2 = n2;
21447139Sbostic 		n1 = n3;
21547139Sbostic 	}
21647139Sbostic }
21747139Sbostic 
21847139Sbostic 
21947139Sbostic 
22047139Sbostic STATIC union node *
pipeline()22147139Sbostic pipeline() {
22253178Smarc 	union node *n1, *pipenode, *notnode;
22347139Sbostic 	struct nodelist *lp, *prev;
22453178Smarc 	int negate = 0;
22547139Sbostic 
22653178Smarc 	TRACE(("pipeline: entered\n"));
22753178Smarc 	while (readtoken() == TNOT) {
22853178Smarc 		TRACE(("pipeline: TNOT recognized\n"));
22953178Smarc 		negate = !negate;
23053178Smarc 	}
23153178Smarc 	tokpushback++;
23247139Sbostic 	n1 = command();
23347139Sbostic 	if (readtoken() == TPIPE) {
23447139Sbostic 		pipenode = (union node *)stalloc(sizeof (struct npipe));
23547139Sbostic 		pipenode->type = NPIPE;
23647139Sbostic 		pipenode->npipe.backgnd = 0;
23747139Sbostic 		lp = (struct nodelist *)stalloc(sizeof (struct nodelist));
23847139Sbostic 		pipenode->npipe.cmdlist = lp;
23947139Sbostic 		lp->n = n1;
24047139Sbostic 		do {
24147139Sbostic 			prev = lp;
24247139Sbostic 			lp = (struct nodelist *)stalloc(sizeof (struct nodelist));
24347139Sbostic 			lp->n = command();
24447139Sbostic 			prev->next = lp;
24547139Sbostic 		} while (readtoken() == TPIPE);
24647139Sbostic 		lp->next = NULL;
24747139Sbostic 		n1 = pipenode;
24847139Sbostic 	}
24947139Sbostic 	tokpushback++;
25053178Smarc 	if (negate) {
25153178Smarc 		notnode = (union node *)stalloc(sizeof (struct nnot));
25253178Smarc 		notnode->type = NNOT;
25353178Smarc 		notnode->nnot.com = n1;
25453178Smarc 		n1 = notnode;
25553178Smarc 	}
25647139Sbostic 	return n1;
25747139Sbostic }
25847139Sbostic 
25947139Sbostic 
26047139Sbostic 
26147139Sbostic STATIC union node *
command()26247139Sbostic command() {
26347139Sbostic 	union node *n1, *n2;
26447139Sbostic 	union node *ap, **app;
26547139Sbostic 	union node *cp, **cpp;
26647139Sbostic 	union node *redir, **rpp;
26747139Sbostic 	int t;
26847139Sbostic 
26947981Smarc 	checkkwd = 2;
27069272Schristos 	redir = NULL;
27169272Schristos 	n1 = NULL;
27260296Smarc 	rpp = &redir;
27360296Smarc 	/* Check for redirection which may precede command */
27460296Smarc 	while (readtoken() == TREDIR) {
27560296Smarc 		*rpp = n2 = redirnode;
27660296Smarc 		rpp = &n2->nfile.next;
27760296Smarc 		parsefname();
27860296Smarc 	}
27960296Smarc 	tokpushback++;
28060296Smarc 
28147139Sbostic 	switch (readtoken()) {
28247139Sbostic 	case TIF:
28347139Sbostic 		n1 = (union node *)stalloc(sizeof (struct nif));
28447139Sbostic 		n1->type = NIF;
28547139Sbostic 		n1->nif.test = list(0);
28647139Sbostic 		if (readtoken() != TTHEN)
28747139Sbostic 			synexpect(TTHEN);
28847139Sbostic 		n1->nif.ifpart = list(0);
28947139Sbostic 		n2 = n1;
29047139Sbostic 		while (readtoken() == TELIF) {
29147139Sbostic 			n2->nif.elsepart = (union node *)stalloc(sizeof (struct nif));
29247139Sbostic 			n2 = n2->nif.elsepart;
29347139Sbostic 			n2->type = NIF;
29447139Sbostic 			n2->nif.test = list(0);
29547139Sbostic 			if (readtoken() != TTHEN)
29647139Sbostic 				synexpect(TTHEN);
29747139Sbostic 			n2->nif.ifpart = list(0);
29847139Sbostic 		}
29947139Sbostic 		if (lasttoken == TELSE)
30047139Sbostic 			n2->nif.elsepart = list(0);
30147139Sbostic 		else {
30247139Sbostic 			n2->nif.elsepart = NULL;
30347139Sbostic 			tokpushback++;
30447139Sbostic 		}
30547139Sbostic 		if (readtoken() != TFI)
30647139Sbostic 			synexpect(TFI);
30747981Smarc 		checkkwd = 1;
30847139Sbostic 		break;
30947139Sbostic 	case TWHILE:
31047981Smarc 	case TUNTIL: {
31147981Smarc 		int got;
31247139Sbostic 		n1 = (union node *)stalloc(sizeof (struct nbinary));
31347139Sbostic 		n1->type = (lasttoken == TWHILE)? NWHILE : NUNTIL;
31447139Sbostic 		n1->nbinary.ch1 = list(0);
31547981Smarc 		if ((got=readtoken()) != TDO) {
31647981Smarc TRACE(("expecting DO got %s %s\n", tokname[got], got == TWORD ? wordtext : ""));
31747139Sbostic 			synexpect(TDO);
31847981Smarc 		}
31947139Sbostic 		n1->nbinary.ch2 = list(0);
32047139Sbostic 		if (readtoken() != TDONE)
32147139Sbostic 			synexpect(TDONE);
32247981Smarc 		checkkwd = 1;
32347139Sbostic 		break;
32447981Smarc 	}
32547139Sbostic 	case TFOR:
32647139Sbostic 		if (readtoken() != TWORD || quoteflag || ! goodname(wordtext))
32747139Sbostic 			synerror("Bad for loop variable");
32847139Sbostic 		n1 = (union node *)stalloc(sizeof (struct nfor));
32947139Sbostic 		n1->type = NFOR;
33047139Sbostic 		n1->nfor.var = wordtext;
33147139Sbostic 		if (readtoken() == TWORD && ! quoteflag && equal(wordtext, "in")) {
33247139Sbostic 			app = &ap;
33347139Sbostic 			while (readtoken() == TWORD) {
33447139Sbostic 				n2 = (union node *)stalloc(sizeof (struct narg));
33547139Sbostic 				n2->type = NARG;
33647139Sbostic 				n2->narg.text = wordtext;
33747139Sbostic 				n2->narg.backquote = backquotelist;
33847139Sbostic 				*app = n2;
33947139Sbostic 				app = &n2->narg.next;
34047139Sbostic 			}
34147139Sbostic 			*app = NULL;
34247139Sbostic 			n1->nfor.args = ap;
34359178Storek 			if (lasttoken != TNL && lasttoken != TSEMI)
34459178Storek 				synexpect(-1);
34547139Sbostic 		} else {
34647139Sbostic #ifndef GDB_HACK
34747139Sbostic 			static const char argvars[5] = {CTLVAR, VSNORMAL|VSQUOTE,
34847139Sbostic 								   '@', '=', '\0'};
34947139Sbostic #endif
35047139Sbostic 			n2 = (union node *)stalloc(sizeof (struct narg));
35147139Sbostic 			n2->type = NARG;
35247139Sbostic 			n2->narg.text = (char *)argvars;
35347139Sbostic 			n2->narg.backquote = NULL;
35447139Sbostic 			n2->narg.next = NULL;
35547139Sbostic 			n1->nfor.args = n2;
35659178Storek 			/*
35759178Storek 			 * Newline or semicolon here is optional (but note
35859178Storek 			 * that the original Bourne shell only allowed NL).
35959178Storek 			 */
36059178Storek 			if (lasttoken != TNL && lasttoken != TSEMI)
36159178Storek 				tokpushback++;
36247139Sbostic 		}
36347981Smarc 		checkkwd = 2;
36447139Sbostic 		if ((t = readtoken()) == TDO)
36547139Sbostic 			t = TDONE;
36647139Sbostic 		else if (t == TBEGIN)
36747139Sbostic 			t = TEND;
36847139Sbostic 		else
36947139Sbostic 			synexpect(-1);
37047139Sbostic 		n1->nfor.body = list(0);
37147139Sbostic 		if (readtoken() != t)
37247139Sbostic 			synexpect(t);
37347981Smarc 		checkkwd = 1;
37447139Sbostic 		break;
37547139Sbostic 	case TCASE:
37647139Sbostic 		n1 = (union node *)stalloc(sizeof (struct ncase));
37747139Sbostic 		n1->type = NCASE;
37847139Sbostic 		if (readtoken() != TWORD)
37947139Sbostic 			synexpect(TWORD);
38047139Sbostic 		n1->ncase.expr = n2 = (union node *)stalloc(sizeof (struct narg));
38147139Sbostic 		n2->type = NARG;
38247139Sbostic 		n2->narg.text = wordtext;
38347139Sbostic 		n2->narg.backquote = backquotelist;
38447139Sbostic 		n2->narg.next = NULL;
38547139Sbostic 		while (readtoken() == TNL);
38647139Sbostic 		if (lasttoken != TWORD || ! equal(wordtext, "in"))
38747139Sbostic 			synerror("expecting \"in\"");
38847139Sbostic 		cpp = &n1->ncase.cases;
38969272Schristos 		checkkwd = 2, readtoken();
39069272Schristos 		do {
39147139Sbostic 			*cpp = cp = (union node *)stalloc(sizeof (struct nclist));
39247139Sbostic 			cp->type = NCLIST;
39347139Sbostic 			app = &cp->nclist.pattern;
39447139Sbostic 			for (;;) {
39547139Sbostic 				*app = ap = (union node *)stalloc(sizeof (struct narg));
39647139Sbostic 				ap->type = NARG;
39747139Sbostic 				ap->narg.text = wordtext;
39847139Sbostic 				ap->narg.backquote = backquotelist;
39969272Schristos 				if (checkkwd = 2, readtoken() != TPIPE)
40047139Sbostic 					break;
40147139Sbostic 				app = &ap->narg.next;
40269272Schristos 				readtoken();
40347139Sbostic 			}
40447139Sbostic 			ap->narg.next = NULL;
40547139Sbostic 			if (lasttoken != TRP)
40647139Sbostic 				synexpect(TRP);
40747139Sbostic 			cp->nclist.body = list(0);
40869272Schristos 
40969272Schristos 			checkkwd = 2;
41069272Schristos 			if ((t = readtoken()) != TESAC) {
41169272Schristos 				if (t != TENDCASE)
41269272Schristos 					synexpect(TENDCASE);
41369272Schristos 				else
41469272Schristos 					checkkwd = 2, readtoken();
41569272Schristos 			}
41647139Sbostic 			cpp = &cp->nclist.next;
41769272Schristos 		} while(lasttoken != TESAC);
41847139Sbostic 		*cpp = NULL;
41947981Smarc 		checkkwd = 1;
42047139Sbostic 		break;
42147139Sbostic 	case TLP:
42247139Sbostic 		n1 = (union node *)stalloc(sizeof (struct nredir));
42347139Sbostic 		n1->type = NSUBSHELL;
42447139Sbostic 		n1->nredir.n = list(0);
42547139Sbostic 		n1->nredir.redirect = NULL;
42647139Sbostic 		if (readtoken() != TRP)
42747139Sbostic 			synexpect(TRP);
42847981Smarc 		checkkwd = 1;
42947139Sbostic 		break;
43047139Sbostic 	case TBEGIN:
43147139Sbostic 		n1 = list(0);
43247139Sbostic 		if (readtoken() != TEND)
43347139Sbostic 			synexpect(TEND);
43447981Smarc 		checkkwd = 1;
43547139Sbostic 		break;
43660296Smarc 	/* Handle an empty command like other simple commands.  */
43768944Sbostic 	case TSEMI:
43868944Sbostic 		/*
43968944Sbostic 		 * An empty command before a ; doesn't make much sense, and
44068944Sbostic 		 * should certainly be disallowed in the case of `if ;'.
44168944Sbostic 		 */
44268944Sbostic 		if (!redir)
44368944Sbostic 			synexpect(-1);
44460296Smarc 	case TNL:
44569272Schristos 	case TEOF:
44647139Sbostic 	case TWORD:
44768944Sbostic 	case TRP:
44847139Sbostic 		tokpushback++;
44960296Smarc 		return simplecmd(rpp, redir);
45047139Sbostic 	default:
45147139Sbostic 		synexpect(-1);
45247139Sbostic 	}
45347139Sbostic 
45447139Sbostic 	/* Now check for redirection which may follow command */
45547139Sbostic 	while (readtoken() == TREDIR) {
45647139Sbostic 		*rpp = n2 = redirnode;
45747139Sbostic 		rpp = &n2->nfile.next;
45847139Sbostic 		parsefname();
45947139Sbostic 	}
46047139Sbostic 	tokpushback++;
46147139Sbostic 	*rpp = NULL;
46247139Sbostic 	if (redir) {
46347139Sbostic 		if (n1->type != NSUBSHELL) {
46447139Sbostic 			n2 = (union node *)stalloc(sizeof (struct nredir));
46547139Sbostic 			n2->type = NREDIR;
46647139Sbostic 			n2->nredir.n = n1;
46747139Sbostic 			n1 = n2;
46847139Sbostic 		}
46947139Sbostic 		n1->nredir.redirect = redir;
47047139Sbostic 	}
47147139Sbostic 	return n1;
47247139Sbostic }
47347139Sbostic 
47447139Sbostic 
47547139Sbostic STATIC union node *
simplecmd(rpp,redir)47660296Smarc simplecmd(rpp, redir)
47760296Smarc 	union node **rpp, *redir;
47860296Smarc 	{
47947139Sbostic 	union node *args, **app;
48060296Smarc 	union node **orig_rpp = rpp;
48147139Sbostic 	union node *n;
48247139Sbostic 
48360296Smarc 	/* If we don't have any redirections already, then we must reset */
48460296Smarc 	/* rpp to be the address of the local redir variable.  */
48560296Smarc 	if (redir == 0)
48660296Smarc 		rpp = &redir;
48760296Smarc 
48847139Sbostic 	args = NULL;
48947139Sbostic 	app = &args;
49060296Smarc 	/*
49160296Smarc 	 * We save the incoming value, because we need this for shell
49260296Smarc 	 * functions.  There can not be a redirect or an argument between
49360296Smarc 	 * the function name and the open parenthesis.
49460296Smarc 	 */
49560296Smarc 	orig_rpp = rpp;
49660296Smarc 
49747139Sbostic 	for (;;) {
49847139Sbostic 		if (readtoken() == TWORD) {
49947139Sbostic 			n = (union node *)stalloc(sizeof (struct narg));
50047139Sbostic 			n->type = NARG;
50147139Sbostic 			n->narg.text = wordtext;
50247139Sbostic 			n->narg.backquote = backquotelist;
50347139Sbostic 			*app = n;
50447139Sbostic 			app = &n->narg.next;
50547139Sbostic 		} else if (lasttoken == TREDIR) {
50647139Sbostic 			*rpp = n = redirnode;
50747139Sbostic 			rpp = &n->nfile.next;
50847139Sbostic 			parsefname();	/* read name of redirection file */
50947139Sbostic 		} else if (lasttoken == TLP && app == &args->narg.next
51060296Smarc 					    && rpp == orig_rpp) {
51147139Sbostic 			/* We have a function */
51247139Sbostic 			if (readtoken() != TRP)
51347139Sbostic 				synexpect(TRP);
51447300Smarc #ifdef notdef
51547139Sbostic 			if (! goodname(n->narg.text))
51647139Sbostic 				synerror("Bad function name");
51747300Smarc #endif
51847139Sbostic 			n->type = NDEFUN;
51947139Sbostic 			n->narg.next = command();
52047139Sbostic 			return n;
52147139Sbostic 		} else {
52247139Sbostic 			tokpushback++;
52347139Sbostic 			break;
52447139Sbostic 		}
52547139Sbostic 	}
52647139Sbostic 	*app = NULL;
52747139Sbostic 	*rpp = NULL;
52847139Sbostic 	n = (union node *)stalloc(sizeof (struct ncmd));
52947139Sbostic 	n->type = NCMD;
53047139Sbostic 	n->ncmd.backgnd = 0;
53147139Sbostic 	n->ncmd.args = args;
53247139Sbostic 	n->ncmd.redirect = redir;
53347139Sbostic 	return n;
53447139Sbostic }
53547139Sbostic 
53669272Schristos STATIC union node *
makename()53769272Schristos makename() {
53869272Schristos 	union node *n;
53947139Sbostic 
54069272Schristos 	n = (union node *)stalloc(sizeof (struct narg));
54169272Schristos 	n->type = NARG;
54269272Schristos 	n->narg.next = NULL;
54369272Schristos 	n->narg.text = wordtext;
54469272Schristos 	n->narg.backquote = backquotelist;
54569272Schristos 	return n;
54669272Schristos }
54769272Schristos 
fixredir(n,text,err)54869272Schristos void fixredir(n, text, err)
54969272Schristos 	union node *n;
55069272Schristos 	const char *text;
55169272Schristos 	int err;
55269272Schristos 	{
55369272Schristos 	TRACE(("Fix redir %s %d\n", text, err));
55469272Schristos 	if (!err)
55569272Schristos 		n->ndup.vname = NULL;
55669272Schristos 
55769272Schristos 	if (is_digit(text[0]) && text[1] == '\0')
55869272Schristos 		n->ndup.dupfd = digit_val(text[0]);
55969272Schristos 	else if (text[0] == '-' && text[1] == '\0')
56069272Schristos 		n->ndup.dupfd = -1;
56169272Schristos 	else {
56269272Schristos 
56369272Schristos 		if (err)
56469272Schristos 			synerror("Bad fd number");
56569272Schristos 		else
56669272Schristos 			n->ndup.vname = makename();
56769272Schristos 	}
56869272Schristos }
56969272Schristos 
57069272Schristos 
57147139Sbostic STATIC void
parsefname()57247139Sbostic parsefname() {
57347139Sbostic 	union node *n = redirnode;
57447139Sbostic 
57547139Sbostic 	if (readtoken() != TWORD)
57647139Sbostic 		synexpect(-1);
57747139Sbostic 	if (n->type == NHERE) {
57847139Sbostic 		struct heredoc *here = heredoc;
57947139Sbostic 		struct heredoc *p;
58047139Sbostic 		int i;
58147139Sbostic 
58247139Sbostic 		if (quoteflag == 0)
58347139Sbostic 			n->type = NXHERE;
58447139Sbostic 		TRACE(("Here document %d\n", n->type));
58547139Sbostic 		if (here->striptabs) {
58647139Sbostic 			while (*wordtext == '\t')
58747139Sbostic 				wordtext++;
58847139Sbostic 		}
58947139Sbostic 		if (! noexpand(wordtext) || (i = strlen(wordtext)) == 0 || i > EOFMARKLEN)
59047139Sbostic 			synerror("Illegal eof marker for << redirection");
59147139Sbostic 		rmescapes(wordtext);
59247139Sbostic 		here->eofmark = wordtext;
59347139Sbostic 		here->next = NULL;
59447139Sbostic 		if (heredoclist == NULL)
59547139Sbostic 			heredoclist = here;
59647139Sbostic 		else {
59747139Sbostic 			for (p = heredoclist ; p->next ; p = p->next);
59847139Sbostic 			p->next = here;
59947139Sbostic 		}
60047139Sbostic 	} else if (n->type == NTOFD || n->type == NFROMFD) {
60169272Schristos 		fixredir(n, wordtext, 0);
60247139Sbostic 	} else {
60369272Schristos 		n->nfile.fname = makename();
60447139Sbostic 	}
60547139Sbostic }
60647139Sbostic 
60747139Sbostic 
60847139Sbostic /*
60947139Sbostic  * Input any here documents.
61047139Sbostic  */
61147139Sbostic 
61247139Sbostic STATIC void
parseheredoc()61347139Sbostic parseheredoc() {
61447139Sbostic 	struct heredoc *here;
61547139Sbostic 	union node *n;
61647139Sbostic 
61747139Sbostic 	while (heredoclist) {
61847139Sbostic 		here = heredoclist;
61947139Sbostic 		heredoclist = here->next;
62047139Sbostic 		if (needprompt) {
62154322Smarc 			setprompt(2);
62247139Sbostic 			needprompt = 0;
62347139Sbostic 		}
62447139Sbostic 		readtoken1(pgetc(), here->here->type == NHERE? SQSYNTAX : DQSYNTAX,
62547139Sbostic 				here->eofmark, here->striptabs);
62647139Sbostic 		n = (union node *)stalloc(sizeof (struct narg));
62747139Sbostic 		n->narg.type = NARG;
62847139Sbostic 		n->narg.next = NULL;
62947139Sbostic 		n->narg.text = wordtext;
63047139Sbostic 		n->narg.backquote = backquotelist;
63147139Sbostic 		here->here->nhere.doc = n;
63247139Sbostic 	}
63347139Sbostic }
63447139Sbostic 
63547981Smarc STATIC int
peektoken()63647981Smarc peektoken() {
63747139Sbostic 	int t;
63847139Sbostic 
63947981Smarc 	t = readtoken();
64047139Sbostic 	tokpushback++;
64147981Smarc 	return (t);
64247139Sbostic }
64347139Sbostic 
64447139Sbostic STATIC int xxreadtoken();
64547139Sbostic 
64647139Sbostic STATIC int
readtoken()64747139Sbostic readtoken() {
64847139Sbostic 	int t;
64954322Smarc 	int savecheckkwd = checkkwd;
65054322Smarc 	struct alias *ap;
65147981Smarc #ifdef DEBUG
65247981Smarc 	int alreadyseen = tokpushback;
65347981Smarc #endif
65447981Smarc 
65554322Smarc 	top:
65647981Smarc 	t = xxreadtoken();
65747139Sbostic 
65847981Smarc 	if (checkkwd) {
65947981Smarc 		/*
66047981Smarc 		 * eat newlines
66147981Smarc 		 */
66247981Smarc 		if (checkkwd == 2) {
66347981Smarc 			checkkwd = 0;
66447981Smarc 			while (t == TNL) {
66547981Smarc 				parseheredoc();
66647981Smarc 				t = xxreadtoken();
66747981Smarc 			}
66847981Smarc 		} else
66947981Smarc 			checkkwd = 0;
67047981Smarc 		/*
67154322Smarc 		 * check for keywords and aliases
67247981Smarc 		 */
67369272Schristos 		if (t == TWORD && !quoteflag)
67469272Schristos 		{
67569272Schristos 			register char * const *pp;
67647981Smarc 
67760296Smarc 			for (pp = (char **)parsekwd; *pp; pp++) {
67869272Schristos 				if (**pp == *wordtext && equal(*pp, wordtext))
67969272Schristos 				{
68047981Smarc 					lasttoken = t = pp - parsekwd + KWDOFFSET;
68147981Smarc 					TRACE(("keyword %s recognized\n", tokname[t]));
68254322Smarc 					goto out;
68347981Smarc 				}
68447981Smarc 			}
68569272Schristos 			if ((ap = lookupalias(wordtext, 1)) != NULL) {
68654322Smarc 				pushstring(ap->val, strlen(ap->val), ap);
68754322Smarc 				checkkwd = savecheckkwd;
68854322Smarc 				goto top;
68954322Smarc 			}
69047981Smarc 		}
69154322Smarc out:
69254322Smarc 		checkkwd = 0;
69347139Sbostic 	}
69447981Smarc #ifdef DEBUG
69547981Smarc 	if (!alreadyseen)
69647981Smarc 	    TRACE(("token %s %s\n", tokname[t], t == TWORD ? wordtext : ""));
69747981Smarc 	else
69847981Smarc 	    TRACE(("reread token %s %s\n", tokname[t], t == TWORD ? wordtext : ""));
69947981Smarc #endif
70047981Smarc 	return (t);
70147139Sbostic }
70247139Sbostic 
70347139Sbostic 
70447139Sbostic /*
70547139Sbostic  * Read the next input token.
70647139Sbostic  * If the token is a word, we set backquotelist to the list of cmds in
70747139Sbostic  *	backquotes.  We set quoteflag to true if any part of the word was
70847139Sbostic  *	quoted.
70947139Sbostic  * If the token is TREDIR, then we set redirnode to a structure containing
71047139Sbostic  *	the redirection.
71147139Sbostic  * In all cases, the variable startlinno is set to the number of the line
71247139Sbostic  *	on which the token starts.
71347139Sbostic  *
71447139Sbostic  * [Change comment:  here documents and internal procedures]
71547139Sbostic  * [Readtoken shouldn't have any arguments.  Perhaps we should make the
71647139Sbostic  *  word parsing code into a separate routine.  In this case, readtoken
71747139Sbostic  *  doesn't need to have any internal procedures, but parseword does.
71847139Sbostic  *  We could also make parseoperator in essence the main routine, and
71947139Sbostic  *  have parseword (readtoken1?) handle both words and redirection.]
72047139Sbostic  */
72147139Sbostic 
72247139Sbostic #define RETURN(token)	return lasttoken = token
72347139Sbostic 
72447139Sbostic STATIC int
xxreadtoken()72547139Sbostic xxreadtoken() {
72647139Sbostic 	register c;
72747139Sbostic 
72847139Sbostic 	if (tokpushback) {
72947139Sbostic 		tokpushback = 0;
73047139Sbostic 		return lasttoken;
73147139Sbostic 	}
73247139Sbostic 	if (needprompt) {
73354322Smarc 		setprompt(2);
73447139Sbostic 		needprompt = 0;
73547139Sbostic 	}
73647139Sbostic 	startlinno = plinno;
73747139Sbostic 	for (;;) {	/* until token or start of word found */
73847139Sbostic 		c = pgetc_macro();
73947139Sbostic 		if (c == ' ' || c == '\t')
74047139Sbostic 			continue;		/* quick check for white space first */
74147139Sbostic 		switch (c) {
74247139Sbostic 		case ' ': case '\t':
74347139Sbostic 			continue;
74447139Sbostic 		case '#':
74547139Sbostic 			while ((c = pgetc()) != '\n' && c != PEOF);
74647139Sbostic 			pungetc();
74747139Sbostic 			continue;
74847139Sbostic 		case '\\':
74947139Sbostic 			if (pgetc() == '\n') {
75047139Sbostic 				startlinno = ++plinno;
75147139Sbostic 				if (doprompt)
75254322Smarc 					setprompt(2);
75354322Smarc 				else
75454322Smarc 					setprompt(0);
75547139Sbostic 				continue;
75647139Sbostic 			}
75747139Sbostic 			pungetc();
75847139Sbostic 			goto breakloop;
75947139Sbostic 		case '\n':
76047139Sbostic 			plinno++;
76147139Sbostic 			needprompt = doprompt;
76247139Sbostic 			RETURN(TNL);
76347139Sbostic 		case PEOF:
76447139Sbostic 			RETURN(TEOF);
76547139Sbostic 		case '&':
76647139Sbostic 			if (pgetc() == '&')
76747139Sbostic 				RETURN(TAND);
76847139Sbostic 			pungetc();
76947139Sbostic 			RETURN(TBACKGND);
77047139Sbostic 		case '|':
77147139Sbostic 			if (pgetc() == '|')
77247139Sbostic 				RETURN(TOR);
77347139Sbostic 			pungetc();
77447139Sbostic 			RETURN(TPIPE);
77547139Sbostic 		case ';':
77647139Sbostic 			if (pgetc() == ';')
77747139Sbostic 				RETURN(TENDCASE);
77847139Sbostic 			pungetc();
77947139Sbostic 			RETURN(TSEMI);
78047139Sbostic 		case '(':
78147139Sbostic 			RETURN(TLP);
78247139Sbostic 		case ')':
78347139Sbostic 			RETURN(TRP);
78447139Sbostic 		default:
78547139Sbostic 			goto breakloop;
78647139Sbostic 		}
78747139Sbostic 	}
78847139Sbostic breakloop:
78947139Sbostic 	return readtoken1(c, BASESYNTAX, (char *)NULL, 0);
79047139Sbostic #undef RETURN
79147139Sbostic }
79247139Sbostic 
79347139Sbostic 
79447139Sbostic 
79547139Sbostic /*
79647139Sbostic  * If eofmark is NULL, read a word or a redirection symbol.  If eofmark
79747139Sbostic  * is not NULL, read a here document.  In the latter case, eofmark is the
79847139Sbostic  * word which marks the end of the document and striptabs is true if
79947139Sbostic  * leading tabs should be stripped from the document.  The argument firstc
80047139Sbostic  * is the first character of the input token or document.
80147139Sbostic  *
80247139Sbostic  * Because C does not have internal subroutines, I have simulated them
80347139Sbostic  * using goto's to implement the subroutine linkage.  The following macros
80447139Sbostic  * will run code that appears at the end of readtoken1.
80547139Sbostic  */
80647139Sbostic 
80747139Sbostic #define CHECKEND()	{goto checkend; checkend_return:;}
80847139Sbostic #define PARSEREDIR()	{goto parseredir; parseredir_return:;}
80947139Sbostic #define PARSESUB()	{goto parsesub; parsesub_return:;}
81047139Sbostic #define PARSEBACKQOLD()	{oldstyle = 1; goto parsebackq; parsebackq_oldreturn:;}
81147139Sbostic #define PARSEBACKQNEW()	{oldstyle = 0; goto parsebackq; parsebackq_newreturn:;}
81253302Smarc #define	PARSEARITH()	{goto parsearith; parsearith_return:;}
81347139Sbostic 
81447139Sbostic STATIC int
readtoken1(firstc,syntax,eofmark,striptabs)81547139Sbostic readtoken1(firstc, syntax, eofmark, striptabs)
81647139Sbostic 	int firstc;
81747139Sbostic 	char const *syntax;
81847139Sbostic 	char *eofmark;
81947139Sbostic 	int striptabs;
82047139Sbostic 	{
82169272Schristos 	int c = firstc;
82269272Schristos 	char *out;
82347139Sbostic 	int len;
82447139Sbostic 	char line[EOFMARKLEN + 1];
82547139Sbostic 	struct nodelist *bqlist;
82647139Sbostic 	int quotef;
82747139Sbostic 	int dblquote;
82853302Smarc 	int varnest;	/* levels of variables expansion */
82953302Smarc 	int arinest;	/* levels of arithmetic expansion */
83053302Smarc 	int parenlevel;	/* levels of parens in arithmetic */
83147139Sbostic 	int oldstyle;
83253302Smarc 	char const *prevsyntax;	/* syntax before arithmetic */
83369272Schristos #if __GNUC__
83469272Schristos 	/* Avoid longjmp clobbering */
83569272Schristos 	(void) &out;
83669272Schristos 	(void) &quotef;
83769272Schristos 	(void) &dblquote;
83869272Schristos 	(void) &varnest;
83969272Schristos 	(void) &arinest;
84069272Schristos 	(void) &parenlevel;
84169272Schristos 	(void) &oldstyle;
84269272Schristos 	(void) &prevsyntax;
84369272Schristos 	(void) &syntax;
84469272Schristos #endif
84547139Sbostic 
84647139Sbostic 	startlinno = plinno;
84747139Sbostic 	dblquote = 0;
84847139Sbostic 	if (syntax == DQSYNTAX)
84947139Sbostic 		dblquote = 1;
85047139Sbostic 	quotef = 0;
85147139Sbostic 	bqlist = NULL;
85247139Sbostic 	varnest = 0;
85353302Smarc 	arinest = 0;
85453302Smarc 	parenlevel = 0;
85553302Smarc 
85647139Sbostic 	STARTSTACKSTR(out);
85747139Sbostic 	loop: {	/* for each line, until end of word */
85847139Sbostic #if ATTY
85947139Sbostic 		if (c == '\034' && doprompt
86047139Sbostic 		 && attyset() && ! equal(termval(), "emacs")) {
86147139Sbostic 			attyline();
86247139Sbostic 			if (syntax == BASESYNTAX)
86347139Sbostic 				return readtoken();
86447139Sbostic 			c = pgetc();
86547139Sbostic 			goto loop;
86647139Sbostic 		}
86747139Sbostic #endif
86847139Sbostic 		CHECKEND();	/* set c to PEOF if at end of here document */
86947139Sbostic 		for (;;) {	/* until end of line or end of word */
87047139Sbostic 			CHECKSTRSPACE(3, out);	/* permit 3 calls to USTPUTC */
87147139Sbostic 			switch(syntax[c]) {
87247139Sbostic 			case CNL:	/* '\n' */
87347139Sbostic 				if (syntax == BASESYNTAX)
87447139Sbostic 					goto endword;	/* exit outer loop */
87547139Sbostic 				USTPUTC(c, out);
87647139Sbostic 				plinno++;
87754322Smarc 				if (doprompt)
87854322Smarc 					setprompt(2);
87954322Smarc 				else
88054322Smarc 					setprompt(0);
88147139Sbostic 				c = pgetc();
88247139Sbostic 				goto loop;		/* continue outer loop */
88347139Sbostic 			case CWORD:
88447139Sbostic 				USTPUTC(c, out);
88547139Sbostic 				break;
88647139Sbostic 			case CCTL:
88747139Sbostic 				if (eofmark == NULL || dblquote)
88847139Sbostic 					USTPUTC(CTLESC, out);
88947139Sbostic 				USTPUTC(c, out);
89047139Sbostic 				break;
89147139Sbostic 			case CBACK:	/* backslash */
89247139Sbostic 				c = pgetc();
89347139Sbostic 				if (c == PEOF) {
89447139Sbostic 					USTPUTC('\\', out);
89547139Sbostic 					pungetc();
89647139Sbostic 				} else if (c == '\n') {
89747139Sbostic 					if (doprompt)
89854322Smarc 						setprompt(2);
89954322Smarc 					else
90054322Smarc 						setprompt(0);
90147139Sbostic 				} else {
90247139Sbostic 					if (dblquote && c != '\\' && c != '`' && c != '$'
90347139Sbostic 							 && (c != '"' || eofmark != NULL))
90447139Sbostic 						USTPUTC('\\', out);
90547139Sbostic 					if (SQSYNTAX[c] == CCTL)
90647139Sbostic 						USTPUTC(CTLESC, out);
90747139Sbostic 					USTPUTC(c, out);
90847139Sbostic 					quotef++;
90947139Sbostic 				}
91047139Sbostic 				break;
91147139Sbostic 			case CSQUOTE:
91247139Sbostic 				syntax = SQSYNTAX;
91347139Sbostic 				break;
91447139Sbostic 			case CDQUOTE:
91547139Sbostic 				syntax = DQSYNTAX;
91647139Sbostic 				dblquote = 1;
91747139Sbostic 				break;
91847139Sbostic 			case CENDQUOTE:
91947139Sbostic 				if (eofmark) {
92047139Sbostic 					USTPUTC(c, out);
92147139Sbostic 				} else {
92253302Smarc 					if (arinest)
92353302Smarc 						syntax = ARISYNTAX;
92453302Smarc 					else
92553302Smarc 						syntax = BASESYNTAX;
92647139Sbostic 					quotef++;
92747139Sbostic 					dblquote = 0;
92847139Sbostic 				}
92947139Sbostic 				break;
93047139Sbostic 			case CVAR:	/* '$' */
93147139Sbostic 				PARSESUB();		/* parse substitution */
93247139Sbostic 				break;
93347139Sbostic 			case CENDVAR:	/* '}' */
93447139Sbostic 				if (varnest > 0) {
93547139Sbostic 					varnest--;
93647139Sbostic 					USTPUTC(CTLENDVAR, out);
93747139Sbostic 				} else {
93847139Sbostic 					USTPUTC(c, out);
93947139Sbostic 				}
94047139Sbostic 				break;
94153302Smarc 			case CLP:	/* '(' in arithmetic */
94253302Smarc 				parenlevel++;
94353302Smarc 				USTPUTC(c, out);
94453302Smarc 				break;
94553302Smarc 			case CRP:	/* ')' in arithmetic */
94653302Smarc 				if (parenlevel > 0) {
94753302Smarc 					USTPUTC(c, out);
94853302Smarc 					--parenlevel;
94953302Smarc 				} else {
95053302Smarc 					if (pgetc() == ')') {
95153302Smarc 						if (--arinest == 0) {
95253302Smarc 							USTPUTC(CTLENDARI, out);
95353302Smarc 							syntax = prevsyntax;
95453302Smarc 						} else
95553302Smarc 							USTPUTC(')', out);
95653302Smarc 					} else {
95753302Smarc 						/*
95853302Smarc 						 * unbalanced parens
95953302Smarc 						 *  (don't 2nd guess - no error)
96053302Smarc 						 */
96153302Smarc 						pungetc();
96253302Smarc 						USTPUTC(')', out);
96353302Smarc 					}
96453302Smarc 				}
96553302Smarc 				break;
96647139Sbostic 			case CBQUOTE:	/* '`' */
96747139Sbostic 				PARSEBACKQOLD();
96847139Sbostic 				break;
96947139Sbostic 			case CEOF:
97047139Sbostic 				goto endword;		/* exit outer loop */
97147139Sbostic 			default:
97247139Sbostic 				if (varnest == 0)
97347139Sbostic 					goto endword;	/* exit outer loop */
97447139Sbostic 				USTPUTC(c, out);
97547139Sbostic 			}
97647139Sbostic 			c = pgetc_macro();
97747139Sbostic 		}
97847139Sbostic 	}
97947139Sbostic endword:
98053302Smarc 	if (syntax == ARISYNTAX)
98153302Smarc 		synerror("Missing '))'");
98260296Smarc 	if (syntax != BASESYNTAX && ! parsebackquote && eofmark == NULL)
98347139Sbostic 		synerror("Unterminated quoted string");
98447139Sbostic 	if (varnest != 0) {
98547139Sbostic 		startlinno = plinno;
98647139Sbostic 		synerror("Missing '}'");
98747139Sbostic 	}
98847139Sbostic 	USTPUTC('\0', out);
98947139Sbostic 	len = out - stackblock();
99047139Sbostic 	out = stackblock();
99147139Sbostic 	if (eofmark == NULL) {
99247139Sbostic 		if ((c == '>' || c == '<')
99347139Sbostic 		 && quotef == 0
99447139Sbostic 		 && len <= 2
99547139Sbostic 		 && (*out == '\0' || is_digit(*out))) {
99647139Sbostic 			PARSEREDIR();
99747139Sbostic 			return lasttoken = TREDIR;
99847139Sbostic 		} else {
99947139Sbostic 			pungetc();
100047139Sbostic 		}
100147139Sbostic 	}
100247139Sbostic 	quoteflag = quotef;
100347139Sbostic 	backquotelist = bqlist;
100447139Sbostic 	grabstackblock(len);
100547139Sbostic 	wordtext = out;
100647139Sbostic 	return lasttoken = TWORD;
100747139Sbostic /* end of readtoken routine */
100847139Sbostic 
100947139Sbostic 
101047139Sbostic 
101147139Sbostic /*
101247139Sbostic  * Check to see whether we are at the end of the here document.  When this
101347139Sbostic  * is called, c is set to the first character of the next input line.  If
101447139Sbostic  * we are at the end of the here document, this routine sets the c to PEOF.
101547139Sbostic  */
101647139Sbostic 
101747139Sbostic checkend: {
101847139Sbostic 	if (eofmark) {
101947139Sbostic 		if (striptabs) {
102047139Sbostic 			while (c == '\t')
102147139Sbostic 				c = pgetc();
102247139Sbostic 		}
102347139Sbostic 		if (c == *eofmark) {
102447139Sbostic 			if (pfgets(line, sizeof line) != NULL) {
102547139Sbostic 				register char *p, *q;
102647139Sbostic 
102747139Sbostic 				p = line;
102847139Sbostic 				for (q = eofmark + 1 ; *q && *p == *q ; p++, q++);
102947139Sbostic 				if (*p == '\n' && *q == '\0') {
103047139Sbostic 					c = PEOF;
103147139Sbostic 					plinno++;
103247139Sbostic 					needprompt = doprompt;
103347139Sbostic 				} else {
103454322Smarc 					pushstring(line, strlen(line), NULL);
103547139Sbostic 				}
103647139Sbostic 			}
103747139Sbostic 		}
103847139Sbostic 	}
103947139Sbostic 	goto checkend_return;
104047139Sbostic }
104147139Sbostic 
104247139Sbostic 
104347139Sbostic /*
104447139Sbostic  * Parse a redirection operator.  The variable "out" points to a string
104547139Sbostic  * specifying the fd to be redirected.  The variable "c" contains the
104647139Sbostic  * first character of the redirection operator.
104747139Sbostic  */
104847139Sbostic 
104947139Sbostic parseredir: {
105047139Sbostic 	char fd = *out;
105147139Sbostic 	union node *np;
105247139Sbostic 
105347139Sbostic 	np = (union node *)stalloc(sizeof (struct nfile));
105447139Sbostic 	if (c == '>') {
105547139Sbostic 		np->nfile.fd = 1;
105647139Sbostic 		c = pgetc();
105747139Sbostic 		if (c == '>')
105847139Sbostic 			np->type = NAPPEND;
105947139Sbostic 		else if (c == '&')
106047139Sbostic 			np->type = NTOFD;
106147139Sbostic 		else {
106247139Sbostic 			np->type = NTO;
106347139Sbostic 			pungetc();
106447139Sbostic 		}
106547139Sbostic 	} else {	/* c == '<' */
106647139Sbostic 		np->nfile.fd = 0;
106747139Sbostic 		c = pgetc();
106847139Sbostic 		if (c == '<') {
106947139Sbostic 			if (sizeof (struct nfile) != sizeof (struct nhere)) {
107047139Sbostic 				np = (union node *)stalloc(sizeof (struct nhere));
107147139Sbostic 				np->nfile.fd = 0;
107247139Sbostic 			}
107347139Sbostic 			np->type = NHERE;
107447139Sbostic 			heredoc = (struct heredoc *)stalloc(sizeof (struct heredoc));
107547139Sbostic 			heredoc->here = np;
107647139Sbostic 			if ((c = pgetc()) == '-') {
107747139Sbostic 				heredoc->striptabs = 1;
107847139Sbostic 			} else {
107947139Sbostic 				heredoc->striptabs = 0;
108047139Sbostic 				pungetc();
108147139Sbostic 			}
108247139Sbostic 		} else if (c == '&')
108347139Sbostic 			np->type = NFROMFD;
108447139Sbostic 		else {
108547139Sbostic 			np->type = NFROM;
108647139Sbostic 			pungetc();
108747139Sbostic 		}
108847139Sbostic 	}
108947139Sbostic 	if (fd != '\0')
109047139Sbostic 		np->nfile.fd = digit_val(fd);
109147139Sbostic 	redirnode = np;
109247139Sbostic 	goto parseredir_return;
109347139Sbostic }
109447139Sbostic 
109547139Sbostic 
109647139Sbostic /*
109747139Sbostic  * Parse a substitution.  At this point, we have read the dollar sign
109847139Sbostic  * and nothing else.
109947139Sbostic  */
110047139Sbostic 
110147139Sbostic parsesub: {
110247139Sbostic 	int subtype;
110347139Sbostic 	int typeloc;
110447139Sbostic 	int flags;
110547139Sbostic 	char *p;
110647139Sbostic #ifndef GDB_HACK
110747139Sbostic 	static const char types[] = "}-+?=";
110847139Sbostic #endif
110947139Sbostic 
111047139Sbostic 	c = pgetc();
111147300Smarc 	if (c != '(' && c != '{' && !is_name(c) && !is_special(c)) {
111247139Sbostic 		USTPUTC('$', out);
111347139Sbostic 		pungetc();
111453302Smarc 	} else if (c == '(') {	/* $(command) or $((arith)) */
111553302Smarc 		if (pgetc() == '(') {
111653302Smarc 			PARSEARITH();
111753302Smarc 		} else {
111853302Smarc 			pungetc();
111953302Smarc 			PARSEBACKQNEW();
112053302Smarc 		}
112147139Sbostic 	} else {
112247139Sbostic 		USTPUTC(CTLVAR, out);
112347139Sbostic 		typeloc = out - stackblock();
112447139Sbostic 		USTPUTC(VSNORMAL, out);
112547139Sbostic 		subtype = VSNORMAL;
112647139Sbostic 		if (c == '{') {
112747139Sbostic 			c = pgetc();
112869090Sbostic 			if (c == '#') {
1129*69509Schristos 				if ((c = pgetc()) == '}')
1130*69509Schristos 					c = '#';
1131*69509Schristos 				else
1132*69509Schristos 					subtype = VSLENGTH;
113369090Sbostic 			}
113469090Sbostic 			else
113569090Sbostic 				subtype = 0;
113647139Sbostic 		}
113747139Sbostic 		if (is_name(c)) {
113847139Sbostic 			do {
113947139Sbostic 				STPUTC(c, out);
114047139Sbostic 				c = pgetc();
114147139Sbostic 			} while (is_in_name(c));
114247139Sbostic 		} else {
114347139Sbostic 			if (! is_special(c))
114447300Smarc badsub:				synerror("Bad substitution");
114547139Sbostic 			USTPUTC(c, out);
114647139Sbostic 			c = pgetc();
114747139Sbostic 		}
114847139Sbostic 		STPUTC('=', out);
114947139Sbostic 		flags = 0;
115047139Sbostic 		if (subtype == 0) {
115169090Sbostic 			switch (c) {
115269090Sbostic 			case ':':
115347139Sbostic 				flags = VSNUL;
115447139Sbostic 				c = pgetc();
115569090Sbostic 				/*FALLTHROUGH*/
115669090Sbostic 			default:
115769090Sbostic 				p = strchr(types, c);
115869090Sbostic 				if (p == NULL)
115969090Sbostic 					goto badsub;
116069090Sbostic 				subtype = p - types + VSNORMAL;
116169090Sbostic 				break;
116269090Sbostic 			case '%':
116369090Sbostic 			case '#':
116469090Sbostic 				{
116569090Sbostic 					int cc = c;
116669090Sbostic 					subtype = c == '#' ? VSTRIMLEFT :
116769090Sbostic 							     VSTRIMRIGHT;
116869090Sbostic 					c = pgetc();
116969090Sbostic 					if (c == cc)
117069090Sbostic 						subtype++;
117169090Sbostic 					else
117269090Sbostic 						pungetc();
117369090Sbostic 					break;
117469090Sbostic 				}
117547139Sbostic 			}
117647139Sbostic 		} else {
117747139Sbostic 			pungetc();
117847139Sbostic 		}
117953302Smarc 		if (dblquote || arinest)
118047139Sbostic 			flags |= VSQUOTE;
118147139Sbostic 		*(stackblock() + typeloc) = subtype | flags;
118247139Sbostic 		if (subtype != VSNORMAL)
118347139Sbostic 			varnest++;
118447139Sbostic 	}
118547139Sbostic 	goto parsesub_return;
118647139Sbostic }
118747139Sbostic 
118847139Sbostic 
118947139Sbostic /*
119047139Sbostic  * Called to parse command substitutions.  Newstyle is set if the command
119147139Sbostic  * is enclosed inside $(...); nlpp is a pointer to the head of the linked
119247139Sbostic  * list of commands (passed by reference), and savelen is the number of
119347139Sbostic  * characters on the top of the stack which must be preserved.
119447139Sbostic  */
119547139Sbostic 
119647139Sbostic parsebackq: {
119747139Sbostic 	struct nodelist **nlpp;
119847139Sbostic 	int savepbq;
119947139Sbostic 	union node *n;
120047139Sbostic 	char *volatile str;
120147139Sbostic 	struct jmploc jmploc;
120247139Sbostic 	struct jmploc *volatile savehandler;
120347139Sbostic 	int savelen;
120447139Sbostic 
120547139Sbostic 	savepbq = parsebackquote;
120647139Sbostic 	if (setjmp(jmploc.loc)) {
120747139Sbostic 		if (str)
120847139Sbostic 			ckfree(str);
120947139Sbostic 		parsebackquote = 0;
121047139Sbostic 		handler = savehandler;
121154322Smarc 		longjmp(handler->loc, 1);
121247139Sbostic 	}
121347139Sbostic 	INTOFF;
121447139Sbostic 	str = NULL;
121547139Sbostic 	savelen = out - stackblock();
121647139Sbostic 	if (savelen > 0) {
121747139Sbostic 		str = ckmalloc(savelen);
121869272Schristos 		memcpy(str, stackblock(), savelen);
121947139Sbostic 	}
122047139Sbostic 	savehandler = handler;
122147139Sbostic 	handler = &jmploc;
122247139Sbostic 	INTON;
122360296Smarc         if (oldstyle) {
122460296Smarc                 /* We must read until the closing backquote, giving special
122560296Smarc                    treatment to some slashes, and then push the string and
122660296Smarc                    reread it as input, interpreting it normally.  */
122760296Smarc                 register char *out;
122860296Smarc                 register c;
122960296Smarc                 int savelen;
123060296Smarc                 char *str;
123160296Smarc 
123260296Smarc                 STARTSTACKSTR(out);
123360296Smarc                 while ((c = pgetc ()) != '`') {
123460296Smarc                        if (c == '\\') {
123560296Smarc                                 c = pgetc ();
123660296Smarc                                 if (c != '\\' && c != '`' && c != '$'
123760296Smarc                                     && (!dblquote || c != '"'))
123860296Smarc                                         STPUTC('\\', out);
123960296Smarc                        }
124060296Smarc                        STPUTC(c, out);
124160296Smarc                 }
124260296Smarc                 STPUTC('\0', out);
124360296Smarc                 savelen = out - stackblock();
124460296Smarc                 if (savelen > 0) {
124560296Smarc                         str = ckmalloc(savelen);
124669272Schristos                         memcpy(str, stackblock(), savelen);
124769272Schristos 			setinputstring(str, 1);
124860296Smarc                 }
124960296Smarc         }
125047139Sbostic 	nlpp = &bqlist;
125147139Sbostic 	while (*nlpp)
125247139Sbostic 		nlpp = &(*nlpp)->next;
125347139Sbostic 	*nlpp = (struct nodelist *)stalloc(sizeof (struct nodelist));
125447139Sbostic 	(*nlpp)->next = NULL;
125547139Sbostic 	parsebackquote = oldstyle;
125647139Sbostic 	n = list(0);
125760296Smarc         if (!oldstyle && (readtoken() != TRP))
125860296Smarc                 synexpect(TRP);
125947139Sbostic 	(*nlpp)->n = n;
126060296Smarc         /* Start reading from old file again.  */
126160296Smarc         if (oldstyle)
126260296Smarc                 popfile();
126347139Sbostic 	while (stackblocksize() <= savelen)
126447139Sbostic 		growstackblock();
126547139Sbostic 	STARTSTACKSTR(out);
126647139Sbostic 	if (str) {
126769272Schristos 		memcpy(out, str, savelen);
126847139Sbostic 		STADJUST(savelen, out);
126947139Sbostic 		INTOFF;
127047139Sbostic 		ckfree(str);
127147139Sbostic 		str = NULL;
127247139Sbostic 		INTON;
127347139Sbostic 	}
127447139Sbostic 	parsebackquote = savepbq;
127547139Sbostic 	handler = savehandler;
127653302Smarc 	if (arinest || dblquote)
127753302Smarc 		USTPUTC(CTLBACKQ | CTLQUOTE, out);
127853302Smarc 	else
127953302Smarc 		USTPUTC(CTLBACKQ, out);
128047139Sbostic 	if (oldstyle)
128147139Sbostic 		goto parsebackq_oldreturn;
128247139Sbostic 	else
128347139Sbostic 		goto parsebackq_newreturn;
128447139Sbostic }
128547139Sbostic 
128653302Smarc /*
128753302Smarc  * Parse an arithmetic expansion (indicate start of one and set state)
128853302Smarc  */
128953302Smarc parsearith: {
129053302Smarc 
129153302Smarc 	if (++arinest == 1) {
129253302Smarc 		prevsyntax = syntax;
129353302Smarc 		syntax = ARISYNTAX;
129453302Smarc 		USTPUTC(CTLARI, out);
129553302Smarc 	} else {
129653302Smarc 		/*
129753302Smarc 		 * we collapse embedded arithmetic expansion to
129853302Smarc 		 * parenthesis, which should be equivalent
129953302Smarc 		 */
130053302Smarc 		USTPUTC('(', out);
130153302Smarc 	}
130253302Smarc 	goto parsearith_return;
130353302Smarc }
130453302Smarc 
130547139Sbostic } /* end of readtoken */
130647139Sbostic 
130747139Sbostic 
130847139Sbostic 
130947139Sbostic #ifdef mkinit
131047139Sbostic RESET {
131147139Sbostic 	tokpushback = 0;
131254322Smarc 	checkkwd = 0;
131347139Sbostic }
131447139Sbostic #endif
131547139Sbostic 
131647139Sbostic /*
131747139Sbostic  * Returns true if the text contains nothing to expand (no dollar signs
131847139Sbostic  * or backquotes).
131947139Sbostic  */
132047139Sbostic 
132147139Sbostic STATIC int
noexpand(text)132247139Sbostic noexpand(text)
132347139Sbostic 	char *text;
132447139Sbostic 	{
132547139Sbostic 	register char *p;
132647139Sbostic 	register char c;
132747139Sbostic 
132847139Sbostic 	p = text;
132947139Sbostic 	while ((c = *p++) != '\0') {
133047139Sbostic 		if (c == CTLESC)
133147139Sbostic 			p++;
133247139Sbostic 		else if (BASESYNTAX[c] == CCTL)
133347139Sbostic 			return 0;
133447139Sbostic 	}
133547139Sbostic 	return 1;
133647139Sbostic }
133747139Sbostic 
133847139Sbostic 
133947139Sbostic /*
134047139Sbostic  * Return true if the argument is a legal variable name (a letter or
134147139Sbostic  * underscore followed by zero or more letters, underscores, and digits).
134247139Sbostic  */
134347139Sbostic 
134447139Sbostic int
goodname(name)134547139Sbostic goodname(name)
134647139Sbostic 	char *name;
134747139Sbostic 	{
134847139Sbostic 	register char *p;
134947139Sbostic 
135047139Sbostic 	p = name;
135147139Sbostic 	if (! is_name(*p))
135247139Sbostic 		return 0;
135347139Sbostic 	while (*++p) {
135447139Sbostic 		if (! is_in_name(*p))
135547139Sbostic 			return 0;
135647139Sbostic 	}
135747139Sbostic 	return 1;
135847139Sbostic }
135947139Sbostic 
136047139Sbostic 
136147139Sbostic /*
136247139Sbostic  * Called when an unexpected token is read during the parse.  The argument
136347139Sbostic  * is the token that is expected, or -1 if more than one type of token can
136447139Sbostic  * occur at this point.
136547139Sbostic  */
136647139Sbostic 
136747139Sbostic STATIC void
synexpect(token)136869272Schristos synexpect(token)
136969272Schristos 	int token;
137069272Schristos {
137147139Sbostic 	char msg[64];
137247139Sbostic 
137347139Sbostic 	if (token >= 0) {
137447139Sbostic 		fmtstr(msg, 64, "%s unexpected (expecting %s)",
137547139Sbostic 			tokname[lasttoken], tokname[token]);
137647139Sbostic 	} else {
137747139Sbostic 		fmtstr(msg, 64, "%s unexpected", tokname[lasttoken]);
137847139Sbostic 	}
137947139Sbostic 	synerror(msg);
138047139Sbostic }
138147139Sbostic 
138247139Sbostic 
138347139Sbostic STATIC void
synerror(msg)138447139Sbostic synerror(msg)
138547139Sbostic 	char *msg;
138647139Sbostic 	{
138747139Sbostic 	if (commandname)
138847139Sbostic 		outfmt(&errout, "%s: %d: ", commandname, startlinno);
138947139Sbostic 	outfmt(&errout, "Syntax error: %s\n", msg);
139047139Sbostic 	error((char *)NULL);
139147139Sbostic }
139254322Smarc 
139354322Smarc STATIC void
setprompt(which)139454322Smarc setprompt(which)
139554322Smarc 	int which;
139654322Smarc 	{
139754322Smarc 	whichprompt = which;
139854322Smarc 
139969272Schristos #ifndef NO_HISTORY
140054322Smarc 	if (!el)
140169272Schristos #endif
140254322Smarc 		out2str(getprompt(NULL));
140354322Smarc }
140454322Smarc 
140554322Smarc /*
140654322Smarc  * called by editline -- any expansions to the prompt
140754322Smarc  *    should be added here.
140854322Smarc  */
140954322Smarc char *
getprompt(unused)141054322Smarc getprompt(unused)
141154322Smarc 	void *unused;
141254322Smarc 	{
141354322Smarc 	switch (whichprompt) {
141454322Smarc 	case 0:
141554322Smarc 		return "";
141654322Smarc 	case 1:
141754322Smarc 		return ps1val();
141854322Smarc 	case 2:
141954322Smarc 		return ps2val();
142054322Smarc 	default:
142154322Smarc 		return "<internal prompt error>";
142254322Smarc 	}
142354322Smarc }
1424