147139Sbostic /*-
260698Sbostic * Copyright (c) 1991, 1993
360698Sbostic * The Regents of the University of California. All rights reserved.
447139Sbostic *
547139Sbostic * This code is derived from software contributed to Berkeley by
647139Sbostic * Kenneth Almquist.
747139Sbostic *
847139Sbostic * %sccs.include.redist.c%
947139Sbostic */
1047139Sbostic
1147139Sbostic #ifndef lint
12*69509Schristos static char sccsid[] = "@(#)parser.c 8.7 (Berkeley) 05/16/95";
1347139Sbostic #endif /* not lint */
1447139Sbostic
1569272Schristos #include <stdlib.h>
1669272Schristos
1747139Sbostic #include "shell.h"
1847139Sbostic #include "parser.h"
1947139Sbostic #include "nodes.h"
2047139Sbostic #include "expand.h" /* defines rmescapes() */
2147139Sbostic #include "redir.h" /* defines copyfd() */
2247139Sbostic #include "syntax.h"
2347139Sbostic #include "options.h"
2447139Sbostic #include "input.h"
2547139Sbostic #include "output.h"
2647139Sbostic #include "var.h"
2747139Sbostic #include "error.h"
2847139Sbostic #include "memalloc.h"
2947139Sbostic #include "mystring.h"
3054322Smarc #include "alias.h"
3169272Schristos #include "show.h"
3269272Schristos #ifndef NO_HISTORY
3354330Smarc #include "myhistedit.h"
3469272Schristos #endif
3547139Sbostic
3647139Sbostic /*
3747139Sbostic * Shell command parser.
3847139Sbostic */
3947139Sbostic
4047139Sbostic #define EOFMARKLEN 79
4147139Sbostic
4247139Sbostic /* values returned by readtoken */
4347139Sbostic #include "token.def"
4447139Sbostic
4547139Sbostic
4647139Sbostic
4747139Sbostic struct heredoc {
4847139Sbostic struct heredoc *next; /* next here document in list */
4947139Sbostic union node *here; /* redirection node */
5047139Sbostic char *eofmark; /* string indicating end of input */
5147139Sbostic int striptabs; /* if set, strip leading tabs */
5247139Sbostic };
5347139Sbostic
5447139Sbostic
5547139Sbostic
5647139Sbostic struct heredoc *heredoclist; /* list of here documents to read */
5747139Sbostic int parsebackquote; /* nonzero if we are inside backquotes */
5847139Sbostic int doprompt; /* if set, prompt the user */
5947139Sbostic int needprompt; /* true if interactive and at start of line */
6047139Sbostic int lasttoken; /* last token read */
6147139Sbostic MKINIT int tokpushback; /* last token pushed back */
6247139Sbostic char *wordtext; /* text of last word returned by readtoken */
6354322Smarc MKINIT int checkkwd; /* 1 == check for kwds, 2 == also eat newlines */
6447139Sbostic struct nodelist *backquotelist;
6547139Sbostic union node *redirnode;
6647139Sbostic struct heredoc *heredoc;
6747139Sbostic int quoteflag; /* set if (part of) last token was quoted */
6847139Sbostic int startlinno; /* line # where last token started */
6947139Sbostic
7047139Sbostic
7147139Sbostic #define GDB_HACK 1 /* avoid local declarations which gdb can't handle */
7247139Sbostic #ifdef GDB_HACK
7347139Sbostic static const char argvars[5] = {CTLVAR, VSNORMAL|VSQUOTE, '@', '=', '\0'};
7447139Sbostic static const char types[] = "}-+?=";
7547139Sbostic #endif
7647139Sbostic
7747139Sbostic
7847981Smarc STATIC union node *list __P((int));
7947981Smarc STATIC union node *andor __P((void));
8047981Smarc STATIC union node *pipeline __P((void));
8147981Smarc STATIC union node *command __P((void));
8260296Smarc STATIC union node *simplecmd __P((union node **, union node *));
8369272Schristos STATIC union node *makename __P((void));
8447981Smarc STATIC void parsefname __P((void));
8547981Smarc STATIC void parseheredoc __P((void));
8669272Schristos STATIC int peektoken __P((void));
8747981Smarc STATIC int readtoken __P((void));
8869272Schristos STATIC int xxreadtoken __P((void));
8947981Smarc STATIC int readtoken1 __P((int, char const *, char *, int));
9047981Smarc STATIC int noexpand __P((char *));
9147981Smarc STATIC void synexpect __P((int));
9247981Smarc STATIC void synerror __P((char *));
9369272Schristos STATIC void setprompt __P((int));
9447139Sbostic
9569272Schristos
9647139Sbostic /*
9747139Sbostic * Read and parse a command. Returns NEOF on end of file. (NULL is a
9847139Sbostic * valid parse tree indicating a blank line.)
9947139Sbostic */
10047139Sbostic
10147139Sbostic union node *
parsecmd(interact)10269272Schristos parsecmd(interact)
10369272Schristos int interact;
10469272Schristos {
10547139Sbostic int t;
10647139Sbostic
10747139Sbostic doprompt = interact;
10847139Sbostic if (doprompt)
10954322Smarc setprompt(1);
11054322Smarc else
11154322Smarc setprompt(0);
11247139Sbostic needprompt = 0;
11354322Smarc t = readtoken();
11454322Smarc if (t == TEOF)
11547139Sbostic return NEOF;
11647139Sbostic if (t == TNL)
11747139Sbostic return NULL;
11847139Sbostic tokpushback++;
11947139Sbostic return list(1);
12047139Sbostic }
12147139Sbostic
12247139Sbostic
12347139Sbostic STATIC union node *
list(nlflag)12469272Schristos list(nlflag)
12569272Schristos int nlflag;
12669272Schristos {
12747139Sbostic union node *n1, *n2, *n3;
12868927Sbostic int tok;
12947139Sbostic
13047981Smarc checkkwd = 2;
13147981Smarc if (nlflag == 0 && tokendlist[peektoken()])
13247139Sbostic return NULL;
13368927Sbostic n1 = NULL;
13447139Sbostic for (;;) {
13568927Sbostic n2 = andor();
13668927Sbostic tok = readtoken();
13768927Sbostic if (tok == TBACKGND) {
13868927Sbostic if (n2->type == NCMD || n2->type == NPIPE) {
13968927Sbostic n2->ncmd.backgnd = 1;
14068927Sbostic } else if (n2->type == NREDIR) {
14168927Sbostic n2->type = NBACKGND;
14247139Sbostic } else {
14347139Sbostic n3 = (union node *)stalloc(sizeof (struct nredir));
14447139Sbostic n3->type = NBACKGND;
14568927Sbostic n3->nredir.n = n2;
14647139Sbostic n3->nredir.redirect = NULL;
14768927Sbostic n2 = n3;
14847139Sbostic }
14968927Sbostic }
15068927Sbostic if (n1 == NULL) {
15168927Sbostic n1 = n2;
15268927Sbostic }
15368927Sbostic else {
15468927Sbostic n3 = (union node *)stalloc(sizeof (struct nbinary));
15568927Sbostic n3->type = NSEMI;
15668927Sbostic n3->nbinary.ch1 = n1;
15768927Sbostic n3->nbinary.ch2 = n2;
15868927Sbostic n1 = n3;
15968927Sbostic }
16068927Sbostic switch (tok) {
16168927Sbostic case TBACKGND:
16268927Sbostic case TSEMI:
16368927Sbostic tok = readtoken();
16468927Sbostic /* fall through */
16547139Sbostic case TNL:
16668927Sbostic if (tok == TNL) {
16747139Sbostic parseheredoc();
16847139Sbostic if (nlflag)
16947139Sbostic return n1;
17047139Sbostic } else {
17147139Sbostic tokpushback++;
17247139Sbostic }
17347981Smarc checkkwd = 2;
17447981Smarc if (tokendlist[peektoken()])
17547139Sbostic return n1;
17647139Sbostic break;
17747139Sbostic case TEOF:
17847139Sbostic if (heredoclist)
17947139Sbostic parseheredoc();
18047139Sbostic else
18147139Sbostic pungetc(); /* push back EOF on input */
18247139Sbostic return n1;
18347139Sbostic default:
18447139Sbostic if (nlflag)
18547139Sbostic synexpect(-1);
18647139Sbostic tokpushback++;
18747139Sbostic return n1;
18847139Sbostic }
18947139Sbostic }
19047139Sbostic }
19147139Sbostic
19247139Sbostic
19347139Sbostic
19447139Sbostic STATIC union node *
andor()19547139Sbostic andor() {
19647139Sbostic union node *n1, *n2, *n3;
19747139Sbostic int t;
19847139Sbostic
19947139Sbostic n1 = pipeline();
20047139Sbostic for (;;) {
20147139Sbostic if ((t = readtoken()) == TAND) {
20247139Sbostic t = NAND;
20347139Sbostic } else if (t == TOR) {
20447139Sbostic t = NOR;
20547139Sbostic } else {
20647139Sbostic tokpushback++;
20747139Sbostic return n1;
20847139Sbostic }
20947139Sbostic n2 = pipeline();
21047139Sbostic n3 = (union node *)stalloc(sizeof (struct nbinary));
21147139Sbostic n3->type = t;
21247139Sbostic n3->nbinary.ch1 = n1;
21347139Sbostic n3->nbinary.ch2 = n2;
21447139Sbostic n1 = n3;
21547139Sbostic }
21647139Sbostic }
21747139Sbostic
21847139Sbostic
21947139Sbostic
22047139Sbostic STATIC union node *
pipeline()22147139Sbostic pipeline() {
22253178Smarc union node *n1, *pipenode, *notnode;
22347139Sbostic struct nodelist *lp, *prev;
22453178Smarc int negate = 0;
22547139Sbostic
22653178Smarc TRACE(("pipeline: entered\n"));
22753178Smarc while (readtoken() == TNOT) {
22853178Smarc TRACE(("pipeline: TNOT recognized\n"));
22953178Smarc negate = !negate;
23053178Smarc }
23153178Smarc tokpushback++;
23247139Sbostic n1 = command();
23347139Sbostic if (readtoken() == TPIPE) {
23447139Sbostic pipenode = (union node *)stalloc(sizeof (struct npipe));
23547139Sbostic pipenode->type = NPIPE;
23647139Sbostic pipenode->npipe.backgnd = 0;
23747139Sbostic lp = (struct nodelist *)stalloc(sizeof (struct nodelist));
23847139Sbostic pipenode->npipe.cmdlist = lp;
23947139Sbostic lp->n = n1;
24047139Sbostic do {
24147139Sbostic prev = lp;
24247139Sbostic lp = (struct nodelist *)stalloc(sizeof (struct nodelist));
24347139Sbostic lp->n = command();
24447139Sbostic prev->next = lp;
24547139Sbostic } while (readtoken() == TPIPE);
24647139Sbostic lp->next = NULL;
24747139Sbostic n1 = pipenode;
24847139Sbostic }
24947139Sbostic tokpushback++;
25053178Smarc if (negate) {
25153178Smarc notnode = (union node *)stalloc(sizeof (struct nnot));
25253178Smarc notnode->type = NNOT;
25353178Smarc notnode->nnot.com = n1;
25453178Smarc n1 = notnode;
25553178Smarc }
25647139Sbostic return n1;
25747139Sbostic }
25847139Sbostic
25947139Sbostic
26047139Sbostic
26147139Sbostic STATIC union node *
command()26247139Sbostic command() {
26347139Sbostic union node *n1, *n2;
26447139Sbostic union node *ap, **app;
26547139Sbostic union node *cp, **cpp;
26647139Sbostic union node *redir, **rpp;
26747139Sbostic int t;
26847139Sbostic
26947981Smarc checkkwd = 2;
27069272Schristos redir = NULL;
27169272Schristos n1 = NULL;
27260296Smarc rpp = &redir;
27360296Smarc /* Check for redirection which may precede command */
27460296Smarc while (readtoken() == TREDIR) {
27560296Smarc *rpp = n2 = redirnode;
27660296Smarc rpp = &n2->nfile.next;
27760296Smarc parsefname();
27860296Smarc }
27960296Smarc tokpushback++;
28060296Smarc
28147139Sbostic switch (readtoken()) {
28247139Sbostic case TIF:
28347139Sbostic n1 = (union node *)stalloc(sizeof (struct nif));
28447139Sbostic n1->type = NIF;
28547139Sbostic n1->nif.test = list(0);
28647139Sbostic if (readtoken() != TTHEN)
28747139Sbostic synexpect(TTHEN);
28847139Sbostic n1->nif.ifpart = list(0);
28947139Sbostic n2 = n1;
29047139Sbostic while (readtoken() == TELIF) {
29147139Sbostic n2->nif.elsepart = (union node *)stalloc(sizeof (struct nif));
29247139Sbostic n2 = n2->nif.elsepart;
29347139Sbostic n2->type = NIF;
29447139Sbostic n2->nif.test = list(0);
29547139Sbostic if (readtoken() != TTHEN)
29647139Sbostic synexpect(TTHEN);
29747139Sbostic n2->nif.ifpart = list(0);
29847139Sbostic }
29947139Sbostic if (lasttoken == TELSE)
30047139Sbostic n2->nif.elsepart = list(0);
30147139Sbostic else {
30247139Sbostic n2->nif.elsepart = NULL;
30347139Sbostic tokpushback++;
30447139Sbostic }
30547139Sbostic if (readtoken() != TFI)
30647139Sbostic synexpect(TFI);
30747981Smarc checkkwd = 1;
30847139Sbostic break;
30947139Sbostic case TWHILE:
31047981Smarc case TUNTIL: {
31147981Smarc int got;
31247139Sbostic n1 = (union node *)stalloc(sizeof (struct nbinary));
31347139Sbostic n1->type = (lasttoken == TWHILE)? NWHILE : NUNTIL;
31447139Sbostic n1->nbinary.ch1 = list(0);
31547981Smarc if ((got=readtoken()) != TDO) {
31647981Smarc TRACE(("expecting DO got %s %s\n", tokname[got], got == TWORD ? wordtext : ""));
31747139Sbostic synexpect(TDO);
31847981Smarc }
31947139Sbostic n1->nbinary.ch2 = list(0);
32047139Sbostic if (readtoken() != TDONE)
32147139Sbostic synexpect(TDONE);
32247981Smarc checkkwd = 1;
32347139Sbostic break;
32447981Smarc }
32547139Sbostic case TFOR:
32647139Sbostic if (readtoken() != TWORD || quoteflag || ! goodname(wordtext))
32747139Sbostic synerror("Bad for loop variable");
32847139Sbostic n1 = (union node *)stalloc(sizeof (struct nfor));
32947139Sbostic n1->type = NFOR;
33047139Sbostic n1->nfor.var = wordtext;
33147139Sbostic if (readtoken() == TWORD && ! quoteflag && equal(wordtext, "in")) {
33247139Sbostic app = ≈
33347139Sbostic while (readtoken() == TWORD) {
33447139Sbostic n2 = (union node *)stalloc(sizeof (struct narg));
33547139Sbostic n2->type = NARG;
33647139Sbostic n2->narg.text = wordtext;
33747139Sbostic n2->narg.backquote = backquotelist;
33847139Sbostic *app = n2;
33947139Sbostic app = &n2->narg.next;
34047139Sbostic }
34147139Sbostic *app = NULL;
34247139Sbostic n1->nfor.args = ap;
34359178Storek if (lasttoken != TNL && lasttoken != TSEMI)
34459178Storek synexpect(-1);
34547139Sbostic } else {
34647139Sbostic #ifndef GDB_HACK
34747139Sbostic static const char argvars[5] = {CTLVAR, VSNORMAL|VSQUOTE,
34847139Sbostic '@', '=', '\0'};
34947139Sbostic #endif
35047139Sbostic n2 = (union node *)stalloc(sizeof (struct narg));
35147139Sbostic n2->type = NARG;
35247139Sbostic n2->narg.text = (char *)argvars;
35347139Sbostic n2->narg.backquote = NULL;
35447139Sbostic n2->narg.next = NULL;
35547139Sbostic n1->nfor.args = n2;
35659178Storek /*
35759178Storek * Newline or semicolon here is optional (but note
35859178Storek * that the original Bourne shell only allowed NL).
35959178Storek */
36059178Storek if (lasttoken != TNL && lasttoken != TSEMI)
36159178Storek tokpushback++;
36247139Sbostic }
36347981Smarc checkkwd = 2;
36447139Sbostic if ((t = readtoken()) == TDO)
36547139Sbostic t = TDONE;
36647139Sbostic else if (t == TBEGIN)
36747139Sbostic t = TEND;
36847139Sbostic else
36947139Sbostic synexpect(-1);
37047139Sbostic n1->nfor.body = list(0);
37147139Sbostic if (readtoken() != t)
37247139Sbostic synexpect(t);
37347981Smarc checkkwd = 1;
37447139Sbostic break;
37547139Sbostic case TCASE:
37647139Sbostic n1 = (union node *)stalloc(sizeof (struct ncase));
37747139Sbostic n1->type = NCASE;
37847139Sbostic if (readtoken() != TWORD)
37947139Sbostic synexpect(TWORD);
38047139Sbostic n1->ncase.expr = n2 = (union node *)stalloc(sizeof (struct narg));
38147139Sbostic n2->type = NARG;
38247139Sbostic n2->narg.text = wordtext;
38347139Sbostic n2->narg.backquote = backquotelist;
38447139Sbostic n2->narg.next = NULL;
38547139Sbostic while (readtoken() == TNL);
38647139Sbostic if (lasttoken != TWORD || ! equal(wordtext, "in"))
38747139Sbostic synerror("expecting \"in\"");
38847139Sbostic cpp = &n1->ncase.cases;
38969272Schristos checkkwd = 2, readtoken();
39069272Schristos do {
39147139Sbostic *cpp = cp = (union node *)stalloc(sizeof (struct nclist));
39247139Sbostic cp->type = NCLIST;
39347139Sbostic app = &cp->nclist.pattern;
39447139Sbostic for (;;) {
39547139Sbostic *app = ap = (union node *)stalloc(sizeof (struct narg));
39647139Sbostic ap->type = NARG;
39747139Sbostic ap->narg.text = wordtext;
39847139Sbostic ap->narg.backquote = backquotelist;
39969272Schristos if (checkkwd = 2, readtoken() != TPIPE)
40047139Sbostic break;
40147139Sbostic app = &ap->narg.next;
40269272Schristos readtoken();
40347139Sbostic }
40447139Sbostic ap->narg.next = NULL;
40547139Sbostic if (lasttoken != TRP)
40647139Sbostic synexpect(TRP);
40747139Sbostic cp->nclist.body = list(0);
40869272Schristos
40969272Schristos checkkwd = 2;
41069272Schristos if ((t = readtoken()) != TESAC) {
41169272Schristos if (t != TENDCASE)
41269272Schristos synexpect(TENDCASE);
41369272Schristos else
41469272Schristos checkkwd = 2, readtoken();
41569272Schristos }
41647139Sbostic cpp = &cp->nclist.next;
41769272Schristos } while(lasttoken != TESAC);
41847139Sbostic *cpp = NULL;
41947981Smarc checkkwd = 1;
42047139Sbostic break;
42147139Sbostic case TLP:
42247139Sbostic n1 = (union node *)stalloc(sizeof (struct nredir));
42347139Sbostic n1->type = NSUBSHELL;
42447139Sbostic n1->nredir.n = list(0);
42547139Sbostic n1->nredir.redirect = NULL;
42647139Sbostic if (readtoken() != TRP)
42747139Sbostic synexpect(TRP);
42847981Smarc checkkwd = 1;
42947139Sbostic break;
43047139Sbostic case TBEGIN:
43147139Sbostic n1 = list(0);
43247139Sbostic if (readtoken() != TEND)
43347139Sbostic synexpect(TEND);
43447981Smarc checkkwd = 1;
43547139Sbostic break;
43660296Smarc /* Handle an empty command like other simple commands. */
43768944Sbostic case TSEMI:
43868944Sbostic /*
43968944Sbostic * An empty command before a ; doesn't make much sense, and
44068944Sbostic * should certainly be disallowed in the case of `if ;'.
44168944Sbostic */
44268944Sbostic if (!redir)
44368944Sbostic synexpect(-1);
44460296Smarc case TNL:
44569272Schristos case TEOF:
44647139Sbostic case TWORD:
44768944Sbostic case TRP:
44847139Sbostic tokpushback++;
44960296Smarc return simplecmd(rpp, redir);
45047139Sbostic default:
45147139Sbostic synexpect(-1);
45247139Sbostic }
45347139Sbostic
45447139Sbostic /* Now check for redirection which may follow command */
45547139Sbostic while (readtoken() == TREDIR) {
45647139Sbostic *rpp = n2 = redirnode;
45747139Sbostic rpp = &n2->nfile.next;
45847139Sbostic parsefname();
45947139Sbostic }
46047139Sbostic tokpushback++;
46147139Sbostic *rpp = NULL;
46247139Sbostic if (redir) {
46347139Sbostic if (n1->type != NSUBSHELL) {
46447139Sbostic n2 = (union node *)stalloc(sizeof (struct nredir));
46547139Sbostic n2->type = NREDIR;
46647139Sbostic n2->nredir.n = n1;
46747139Sbostic n1 = n2;
46847139Sbostic }
46947139Sbostic n1->nredir.redirect = redir;
47047139Sbostic }
47147139Sbostic return n1;
47247139Sbostic }
47347139Sbostic
47447139Sbostic
47547139Sbostic STATIC union node *
simplecmd(rpp,redir)47660296Smarc simplecmd(rpp, redir)
47760296Smarc union node **rpp, *redir;
47860296Smarc {
47947139Sbostic union node *args, **app;
48060296Smarc union node **orig_rpp = rpp;
48147139Sbostic union node *n;
48247139Sbostic
48360296Smarc /* If we don't have any redirections already, then we must reset */
48460296Smarc /* rpp to be the address of the local redir variable. */
48560296Smarc if (redir == 0)
48660296Smarc rpp = &redir;
48760296Smarc
48847139Sbostic args = NULL;
48947139Sbostic app = &args;
49060296Smarc /*
49160296Smarc * We save the incoming value, because we need this for shell
49260296Smarc * functions. There can not be a redirect or an argument between
49360296Smarc * the function name and the open parenthesis.
49460296Smarc */
49560296Smarc orig_rpp = rpp;
49660296Smarc
49747139Sbostic for (;;) {
49847139Sbostic if (readtoken() == TWORD) {
49947139Sbostic n = (union node *)stalloc(sizeof (struct narg));
50047139Sbostic n->type = NARG;
50147139Sbostic n->narg.text = wordtext;
50247139Sbostic n->narg.backquote = backquotelist;
50347139Sbostic *app = n;
50447139Sbostic app = &n->narg.next;
50547139Sbostic } else if (lasttoken == TREDIR) {
50647139Sbostic *rpp = n = redirnode;
50747139Sbostic rpp = &n->nfile.next;
50847139Sbostic parsefname(); /* read name of redirection file */
50947139Sbostic } else if (lasttoken == TLP && app == &args->narg.next
51060296Smarc && rpp == orig_rpp) {
51147139Sbostic /* We have a function */
51247139Sbostic if (readtoken() != TRP)
51347139Sbostic synexpect(TRP);
51447300Smarc #ifdef notdef
51547139Sbostic if (! goodname(n->narg.text))
51647139Sbostic synerror("Bad function name");
51747300Smarc #endif
51847139Sbostic n->type = NDEFUN;
51947139Sbostic n->narg.next = command();
52047139Sbostic return n;
52147139Sbostic } else {
52247139Sbostic tokpushback++;
52347139Sbostic break;
52447139Sbostic }
52547139Sbostic }
52647139Sbostic *app = NULL;
52747139Sbostic *rpp = NULL;
52847139Sbostic n = (union node *)stalloc(sizeof (struct ncmd));
52947139Sbostic n->type = NCMD;
53047139Sbostic n->ncmd.backgnd = 0;
53147139Sbostic n->ncmd.args = args;
53247139Sbostic n->ncmd.redirect = redir;
53347139Sbostic return n;
53447139Sbostic }
53547139Sbostic
53669272Schristos STATIC union node *
makename()53769272Schristos makename() {
53869272Schristos union node *n;
53947139Sbostic
54069272Schristos n = (union node *)stalloc(sizeof (struct narg));
54169272Schristos n->type = NARG;
54269272Schristos n->narg.next = NULL;
54369272Schristos n->narg.text = wordtext;
54469272Schristos n->narg.backquote = backquotelist;
54569272Schristos return n;
54669272Schristos }
54769272Schristos
fixredir(n,text,err)54869272Schristos void fixredir(n, text, err)
54969272Schristos union node *n;
55069272Schristos const char *text;
55169272Schristos int err;
55269272Schristos {
55369272Schristos TRACE(("Fix redir %s %d\n", text, err));
55469272Schristos if (!err)
55569272Schristos n->ndup.vname = NULL;
55669272Schristos
55769272Schristos if (is_digit(text[0]) && text[1] == '\0')
55869272Schristos n->ndup.dupfd = digit_val(text[0]);
55969272Schristos else if (text[0] == '-' && text[1] == '\0')
56069272Schristos n->ndup.dupfd = -1;
56169272Schristos else {
56269272Schristos
56369272Schristos if (err)
56469272Schristos synerror("Bad fd number");
56569272Schristos else
56669272Schristos n->ndup.vname = makename();
56769272Schristos }
56869272Schristos }
56969272Schristos
57069272Schristos
57147139Sbostic STATIC void
parsefname()57247139Sbostic parsefname() {
57347139Sbostic union node *n = redirnode;
57447139Sbostic
57547139Sbostic if (readtoken() != TWORD)
57647139Sbostic synexpect(-1);
57747139Sbostic if (n->type == NHERE) {
57847139Sbostic struct heredoc *here = heredoc;
57947139Sbostic struct heredoc *p;
58047139Sbostic int i;
58147139Sbostic
58247139Sbostic if (quoteflag == 0)
58347139Sbostic n->type = NXHERE;
58447139Sbostic TRACE(("Here document %d\n", n->type));
58547139Sbostic if (here->striptabs) {
58647139Sbostic while (*wordtext == '\t')
58747139Sbostic wordtext++;
58847139Sbostic }
58947139Sbostic if (! noexpand(wordtext) || (i = strlen(wordtext)) == 0 || i > EOFMARKLEN)
59047139Sbostic synerror("Illegal eof marker for << redirection");
59147139Sbostic rmescapes(wordtext);
59247139Sbostic here->eofmark = wordtext;
59347139Sbostic here->next = NULL;
59447139Sbostic if (heredoclist == NULL)
59547139Sbostic heredoclist = here;
59647139Sbostic else {
59747139Sbostic for (p = heredoclist ; p->next ; p = p->next);
59847139Sbostic p->next = here;
59947139Sbostic }
60047139Sbostic } else if (n->type == NTOFD || n->type == NFROMFD) {
60169272Schristos fixredir(n, wordtext, 0);
60247139Sbostic } else {
60369272Schristos n->nfile.fname = makename();
60447139Sbostic }
60547139Sbostic }
60647139Sbostic
60747139Sbostic
60847139Sbostic /*
60947139Sbostic * Input any here documents.
61047139Sbostic */
61147139Sbostic
61247139Sbostic STATIC void
parseheredoc()61347139Sbostic parseheredoc() {
61447139Sbostic struct heredoc *here;
61547139Sbostic union node *n;
61647139Sbostic
61747139Sbostic while (heredoclist) {
61847139Sbostic here = heredoclist;
61947139Sbostic heredoclist = here->next;
62047139Sbostic if (needprompt) {
62154322Smarc setprompt(2);
62247139Sbostic needprompt = 0;
62347139Sbostic }
62447139Sbostic readtoken1(pgetc(), here->here->type == NHERE? SQSYNTAX : DQSYNTAX,
62547139Sbostic here->eofmark, here->striptabs);
62647139Sbostic n = (union node *)stalloc(sizeof (struct narg));
62747139Sbostic n->narg.type = NARG;
62847139Sbostic n->narg.next = NULL;
62947139Sbostic n->narg.text = wordtext;
63047139Sbostic n->narg.backquote = backquotelist;
63147139Sbostic here->here->nhere.doc = n;
63247139Sbostic }
63347139Sbostic }
63447139Sbostic
63547981Smarc STATIC int
peektoken()63647981Smarc peektoken() {
63747139Sbostic int t;
63847139Sbostic
63947981Smarc t = readtoken();
64047139Sbostic tokpushback++;
64147981Smarc return (t);
64247139Sbostic }
64347139Sbostic
64447139Sbostic STATIC int xxreadtoken();
64547139Sbostic
64647139Sbostic STATIC int
readtoken()64747139Sbostic readtoken() {
64847139Sbostic int t;
64954322Smarc int savecheckkwd = checkkwd;
65054322Smarc struct alias *ap;
65147981Smarc #ifdef DEBUG
65247981Smarc int alreadyseen = tokpushback;
65347981Smarc #endif
65447981Smarc
65554322Smarc top:
65647981Smarc t = xxreadtoken();
65747139Sbostic
65847981Smarc if (checkkwd) {
65947981Smarc /*
66047981Smarc * eat newlines
66147981Smarc */
66247981Smarc if (checkkwd == 2) {
66347981Smarc checkkwd = 0;
66447981Smarc while (t == TNL) {
66547981Smarc parseheredoc();
66647981Smarc t = xxreadtoken();
66747981Smarc }
66847981Smarc } else
66947981Smarc checkkwd = 0;
67047981Smarc /*
67154322Smarc * check for keywords and aliases
67247981Smarc */
67369272Schristos if (t == TWORD && !quoteflag)
67469272Schristos {
67569272Schristos register char * const *pp;
67647981Smarc
67760296Smarc for (pp = (char **)parsekwd; *pp; pp++) {
67869272Schristos if (**pp == *wordtext && equal(*pp, wordtext))
67969272Schristos {
68047981Smarc lasttoken = t = pp - parsekwd + KWDOFFSET;
68147981Smarc TRACE(("keyword %s recognized\n", tokname[t]));
68254322Smarc goto out;
68347981Smarc }
68447981Smarc }
68569272Schristos if ((ap = lookupalias(wordtext, 1)) != NULL) {
68654322Smarc pushstring(ap->val, strlen(ap->val), ap);
68754322Smarc checkkwd = savecheckkwd;
68854322Smarc goto top;
68954322Smarc }
69047981Smarc }
69154322Smarc out:
69254322Smarc checkkwd = 0;
69347139Sbostic }
69447981Smarc #ifdef DEBUG
69547981Smarc if (!alreadyseen)
69647981Smarc TRACE(("token %s %s\n", tokname[t], t == TWORD ? wordtext : ""));
69747981Smarc else
69847981Smarc TRACE(("reread token %s %s\n", tokname[t], t == TWORD ? wordtext : ""));
69947981Smarc #endif
70047981Smarc return (t);
70147139Sbostic }
70247139Sbostic
70347139Sbostic
70447139Sbostic /*
70547139Sbostic * Read the next input token.
70647139Sbostic * If the token is a word, we set backquotelist to the list of cmds in
70747139Sbostic * backquotes. We set quoteflag to true if any part of the word was
70847139Sbostic * quoted.
70947139Sbostic * If the token is TREDIR, then we set redirnode to a structure containing
71047139Sbostic * the redirection.
71147139Sbostic * In all cases, the variable startlinno is set to the number of the line
71247139Sbostic * on which the token starts.
71347139Sbostic *
71447139Sbostic * [Change comment: here documents and internal procedures]
71547139Sbostic * [Readtoken shouldn't have any arguments. Perhaps we should make the
71647139Sbostic * word parsing code into a separate routine. In this case, readtoken
71747139Sbostic * doesn't need to have any internal procedures, but parseword does.
71847139Sbostic * We could also make parseoperator in essence the main routine, and
71947139Sbostic * have parseword (readtoken1?) handle both words and redirection.]
72047139Sbostic */
72147139Sbostic
72247139Sbostic #define RETURN(token) return lasttoken = token
72347139Sbostic
72447139Sbostic STATIC int
xxreadtoken()72547139Sbostic xxreadtoken() {
72647139Sbostic register c;
72747139Sbostic
72847139Sbostic if (tokpushback) {
72947139Sbostic tokpushback = 0;
73047139Sbostic return lasttoken;
73147139Sbostic }
73247139Sbostic if (needprompt) {
73354322Smarc setprompt(2);
73447139Sbostic needprompt = 0;
73547139Sbostic }
73647139Sbostic startlinno = plinno;
73747139Sbostic for (;;) { /* until token or start of word found */
73847139Sbostic c = pgetc_macro();
73947139Sbostic if (c == ' ' || c == '\t')
74047139Sbostic continue; /* quick check for white space first */
74147139Sbostic switch (c) {
74247139Sbostic case ' ': case '\t':
74347139Sbostic continue;
74447139Sbostic case '#':
74547139Sbostic while ((c = pgetc()) != '\n' && c != PEOF);
74647139Sbostic pungetc();
74747139Sbostic continue;
74847139Sbostic case '\\':
74947139Sbostic if (pgetc() == '\n') {
75047139Sbostic startlinno = ++plinno;
75147139Sbostic if (doprompt)
75254322Smarc setprompt(2);
75354322Smarc else
75454322Smarc setprompt(0);
75547139Sbostic continue;
75647139Sbostic }
75747139Sbostic pungetc();
75847139Sbostic goto breakloop;
75947139Sbostic case '\n':
76047139Sbostic plinno++;
76147139Sbostic needprompt = doprompt;
76247139Sbostic RETURN(TNL);
76347139Sbostic case PEOF:
76447139Sbostic RETURN(TEOF);
76547139Sbostic case '&':
76647139Sbostic if (pgetc() == '&')
76747139Sbostic RETURN(TAND);
76847139Sbostic pungetc();
76947139Sbostic RETURN(TBACKGND);
77047139Sbostic case '|':
77147139Sbostic if (pgetc() == '|')
77247139Sbostic RETURN(TOR);
77347139Sbostic pungetc();
77447139Sbostic RETURN(TPIPE);
77547139Sbostic case ';':
77647139Sbostic if (pgetc() == ';')
77747139Sbostic RETURN(TENDCASE);
77847139Sbostic pungetc();
77947139Sbostic RETURN(TSEMI);
78047139Sbostic case '(':
78147139Sbostic RETURN(TLP);
78247139Sbostic case ')':
78347139Sbostic RETURN(TRP);
78447139Sbostic default:
78547139Sbostic goto breakloop;
78647139Sbostic }
78747139Sbostic }
78847139Sbostic breakloop:
78947139Sbostic return readtoken1(c, BASESYNTAX, (char *)NULL, 0);
79047139Sbostic #undef RETURN
79147139Sbostic }
79247139Sbostic
79347139Sbostic
79447139Sbostic
79547139Sbostic /*
79647139Sbostic * If eofmark is NULL, read a word or a redirection symbol. If eofmark
79747139Sbostic * is not NULL, read a here document. In the latter case, eofmark is the
79847139Sbostic * word which marks the end of the document and striptabs is true if
79947139Sbostic * leading tabs should be stripped from the document. The argument firstc
80047139Sbostic * is the first character of the input token or document.
80147139Sbostic *
80247139Sbostic * Because C does not have internal subroutines, I have simulated them
80347139Sbostic * using goto's to implement the subroutine linkage. The following macros
80447139Sbostic * will run code that appears at the end of readtoken1.
80547139Sbostic */
80647139Sbostic
80747139Sbostic #define CHECKEND() {goto checkend; checkend_return:;}
80847139Sbostic #define PARSEREDIR() {goto parseredir; parseredir_return:;}
80947139Sbostic #define PARSESUB() {goto parsesub; parsesub_return:;}
81047139Sbostic #define PARSEBACKQOLD() {oldstyle = 1; goto parsebackq; parsebackq_oldreturn:;}
81147139Sbostic #define PARSEBACKQNEW() {oldstyle = 0; goto parsebackq; parsebackq_newreturn:;}
81253302Smarc #define PARSEARITH() {goto parsearith; parsearith_return:;}
81347139Sbostic
81447139Sbostic STATIC int
readtoken1(firstc,syntax,eofmark,striptabs)81547139Sbostic readtoken1(firstc, syntax, eofmark, striptabs)
81647139Sbostic int firstc;
81747139Sbostic char const *syntax;
81847139Sbostic char *eofmark;
81947139Sbostic int striptabs;
82047139Sbostic {
82169272Schristos int c = firstc;
82269272Schristos char *out;
82347139Sbostic int len;
82447139Sbostic char line[EOFMARKLEN + 1];
82547139Sbostic struct nodelist *bqlist;
82647139Sbostic int quotef;
82747139Sbostic int dblquote;
82853302Smarc int varnest; /* levels of variables expansion */
82953302Smarc int arinest; /* levels of arithmetic expansion */
83053302Smarc int parenlevel; /* levels of parens in arithmetic */
83147139Sbostic int oldstyle;
83253302Smarc char const *prevsyntax; /* syntax before arithmetic */
83369272Schristos #if __GNUC__
83469272Schristos /* Avoid longjmp clobbering */
83569272Schristos (void) &out;
83669272Schristos (void) "ef;
83769272Schristos (void) &dblquote;
83869272Schristos (void) &varnest;
83969272Schristos (void) &arinest;
84069272Schristos (void) &parenlevel;
84169272Schristos (void) &oldstyle;
84269272Schristos (void) &prevsyntax;
84369272Schristos (void) &syntax;
84469272Schristos #endif
84547139Sbostic
84647139Sbostic startlinno = plinno;
84747139Sbostic dblquote = 0;
84847139Sbostic if (syntax == DQSYNTAX)
84947139Sbostic dblquote = 1;
85047139Sbostic quotef = 0;
85147139Sbostic bqlist = NULL;
85247139Sbostic varnest = 0;
85353302Smarc arinest = 0;
85453302Smarc parenlevel = 0;
85553302Smarc
85647139Sbostic STARTSTACKSTR(out);
85747139Sbostic loop: { /* for each line, until end of word */
85847139Sbostic #if ATTY
85947139Sbostic if (c == '\034' && doprompt
86047139Sbostic && attyset() && ! equal(termval(), "emacs")) {
86147139Sbostic attyline();
86247139Sbostic if (syntax == BASESYNTAX)
86347139Sbostic return readtoken();
86447139Sbostic c = pgetc();
86547139Sbostic goto loop;
86647139Sbostic }
86747139Sbostic #endif
86847139Sbostic CHECKEND(); /* set c to PEOF if at end of here document */
86947139Sbostic for (;;) { /* until end of line or end of word */
87047139Sbostic CHECKSTRSPACE(3, out); /* permit 3 calls to USTPUTC */
87147139Sbostic switch(syntax[c]) {
87247139Sbostic case CNL: /* '\n' */
87347139Sbostic if (syntax == BASESYNTAX)
87447139Sbostic goto endword; /* exit outer loop */
87547139Sbostic USTPUTC(c, out);
87647139Sbostic plinno++;
87754322Smarc if (doprompt)
87854322Smarc setprompt(2);
87954322Smarc else
88054322Smarc setprompt(0);
88147139Sbostic c = pgetc();
88247139Sbostic goto loop; /* continue outer loop */
88347139Sbostic case CWORD:
88447139Sbostic USTPUTC(c, out);
88547139Sbostic break;
88647139Sbostic case CCTL:
88747139Sbostic if (eofmark == NULL || dblquote)
88847139Sbostic USTPUTC(CTLESC, out);
88947139Sbostic USTPUTC(c, out);
89047139Sbostic break;
89147139Sbostic case CBACK: /* backslash */
89247139Sbostic c = pgetc();
89347139Sbostic if (c == PEOF) {
89447139Sbostic USTPUTC('\\', out);
89547139Sbostic pungetc();
89647139Sbostic } else if (c == '\n') {
89747139Sbostic if (doprompt)
89854322Smarc setprompt(2);
89954322Smarc else
90054322Smarc setprompt(0);
90147139Sbostic } else {
90247139Sbostic if (dblquote && c != '\\' && c != '`' && c != '$'
90347139Sbostic && (c != '"' || eofmark != NULL))
90447139Sbostic USTPUTC('\\', out);
90547139Sbostic if (SQSYNTAX[c] == CCTL)
90647139Sbostic USTPUTC(CTLESC, out);
90747139Sbostic USTPUTC(c, out);
90847139Sbostic quotef++;
90947139Sbostic }
91047139Sbostic break;
91147139Sbostic case CSQUOTE:
91247139Sbostic syntax = SQSYNTAX;
91347139Sbostic break;
91447139Sbostic case CDQUOTE:
91547139Sbostic syntax = DQSYNTAX;
91647139Sbostic dblquote = 1;
91747139Sbostic break;
91847139Sbostic case CENDQUOTE:
91947139Sbostic if (eofmark) {
92047139Sbostic USTPUTC(c, out);
92147139Sbostic } else {
92253302Smarc if (arinest)
92353302Smarc syntax = ARISYNTAX;
92453302Smarc else
92553302Smarc syntax = BASESYNTAX;
92647139Sbostic quotef++;
92747139Sbostic dblquote = 0;
92847139Sbostic }
92947139Sbostic break;
93047139Sbostic case CVAR: /* '$' */
93147139Sbostic PARSESUB(); /* parse substitution */
93247139Sbostic break;
93347139Sbostic case CENDVAR: /* '}' */
93447139Sbostic if (varnest > 0) {
93547139Sbostic varnest--;
93647139Sbostic USTPUTC(CTLENDVAR, out);
93747139Sbostic } else {
93847139Sbostic USTPUTC(c, out);
93947139Sbostic }
94047139Sbostic break;
94153302Smarc case CLP: /* '(' in arithmetic */
94253302Smarc parenlevel++;
94353302Smarc USTPUTC(c, out);
94453302Smarc break;
94553302Smarc case CRP: /* ')' in arithmetic */
94653302Smarc if (parenlevel > 0) {
94753302Smarc USTPUTC(c, out);
94853302Smarc --parenlevel;
94953302Smarc } else {
95053302Smarc if (pgetc() == ')') {
95153302Smarc if (--arinest == 0) {
95253302Smarc USTPUTC(CTLENDARI, out);
95353302Smarc syntax = prevsyntax;
95453302Smarc } else
95553302Smarc USTPUTC(')', out);
95653302Smarc } else {
95753302Smarc /*
95853302Smarc * unbalanced parens
95953302Smarc * (don't 2nd guess - no error)
96053302Smarc */
96153302Smarc pungetc();
96253302Smarc USTPUTC(')', out);
96353302Smarc }
96453302Smarc }
96553302Smarc break;
96647139Sbostic case CBQUOTE: /* '`' */
96747139Sbostic PARSEBACKQOLD();
96847139Sbostic break;
96947139Sbostic case CEOF:
97047139Sbostic goto endword; /* exit outer loop */
97147139Sbostic default:
97247139Sbostic if (varnest == 0)
97347139Sbostic goto endword; /* exit outer loop */
97447139Sbostic USTPUTC(c, out);
97547139Sbostic }
97647139Sbostic c = pgetc_macro();
97747139Sbostic }
97847139Sbostic }
97947139Sbostic endword:
98053302Smarc if (syntax == ARISYNTAX)
98153302Smarc synerror("Missing '))'");
98260296Smarc if (syntax != BASESYNTAX && ! parsebackquote && eofmark == NULL)
98347139Sbostic synerror("Unterminated quoted string");
98447139Sbostic if (varnest != 0) {
98547139Sbostic startlinno = plinno;
98647139Sbostic synerror("Missing '}'");
98747139Sbostic }
98847139Sbostic USTPUTC('\0', out);
98947139Sbostic len = out - stackblock();
99047139Sbostic out = stackblock();
99147139Sbostic if (eofmark == NULL) {
99247139Sbostic if ((c == '>' || c == '<')
99347139Sbostic && quotef == 0
99447139Sbostic && len <= 2
99547139Sbostic && (*out == '\0' || is_digit(*out))) {
99647139Sbostic PARSEREDIR();
99747139Sbostic return lasttoken = TREDIR;
99847139Sbostic } else {
99947139Sbostic pungetc();
100047139Sbostic }
100147139Sbostic }
100247139Sbostic quoteflag = quotef;
100347139Sbostic backquotelist = bqlist;
100447139Sbostic grabstackblock(len);
100547139Sbostic wordtext = out;
100647139Sbostic return lasttoken = TWORD;
100747139Sbostic /* end of readtoken routine */
100847139Sbostic
100947139Sbostic
101047139Sbostic
101147139Sbostic /*
101247139Sbostic * Check to see whether we are at the end of the here document. When this
101347139Sbostic * is called, c is set to the first character of the next input line. If
101447139Sbostic * we are at the end of the here document, this routine sets the c to PEOF.
101547139Sbostic */
101647139Sbostic
101747139Sbostic checkend: {
101847139Sbostic if (eofmark) {
101947139Sbostic if (striptabs) {
102047139Sbostic while (c == '\t')
102147139Sbostic c = pgetc();
102247139Sbostic }
102347139Sbostic if (c == *eofmark) {
102447139Sbostic if (pfgets(line, sizeof line) != NULL) {
102547139Sbostic register char *p, *q;
102647139Sbostic
102747139Sbostic p = line;
102847139Sbostic for (q = eofmark + 1 ; *q && *p == *q ; p++, q++);
102947139Sbostic if (*p == '\n' && *q == '\0') {
103047139Sbostic c = PEOF;
103147139Sbostic plinno++;
103247139Sbostic needprompt = doprompt;
103347139Sbostic } else {
103454322Smarc pushstring(line, strlen(line), NULL);
103547139Sbostic }
103647139Sbostic }
103747139Sbostic }
103847139Sbostic }
103947139Sbostic goto checkend_return;
104047139Sbostic }
104147139Sbostic
104247139Sbostic
104347139Sbostic /*
104447139Sbostic * Parse a redirection operator. The variable "out" points to a string
104547139Sbostic * specifying the fd to be redirected. The variable "c" contains the
104647139Sbostic * first character of the redirection operator.
104747139Sbostic */
104847139Sbostic
104947139Sbostic parseredir: {
105047139Sbostic char fd = *out;
105147139Sbostic union node *np;
105247139Sbostic
105347139Sbostic np = (union node *)stalloc(sizeof (struct nfile));
105447139Sbostic if (c == '>') {
105547139Sbostic np->nfile.fd = 1;
105647139Sbostic c = pgetc();
105747139Sbostic if (c == '>')
105847139Sbostic np->type = NAPPEND;
105947139Sbostic else if (c == '&')
106047139Sbostic np->type = NTOFD;
106147139Sbostic else {
106247139Sbostic np->type = NTO;
106347139Sbostic pungetc();
106447139Sbostic }
106547139Sbostic } else { /* c == '<' */
106647139Sbostic np->nfile.fd = 0;
106747139Sbostic c = pgetc();
106847139Sbostic if (c == '<') {
106947139Sbostic if (sizeof (struct nfile) != sizeof (struct nhere)) {
107047139Sbostic np = (union node *)stalloc(sizeof (struct nhere));
107147139Sbostic np->nfile.fd = 0;
107247139Sbostic }
107347139Sbostic np->type = NHERE;
107447139Sbostic heredoc = (struct heredoc *)stalloc(sizeof (struct heredoc));
107547139Sbostic heredoc->here = np;
107647139Sbostic if ((c = pgetc()) == '-') {
107747139Sbostic heredoc->striptabs = 1;
107847139Sbostic } else {
107947139Sbostic heredoc->striptabs = 0;
108047139Sbostic pungetc();
108147139Sbostic }
108247139Sbostic } else if (c == '&')
108347139Sbostic np->type = NFROMFD;
108447139Sbostic else {
108547139Sbostic np->type = NFROM;
108647139Sbostic pungetc();
108747139Sbostic }
108847139Sbostic }
108947139Sbostic if (fd != '\0')
109047139Sbostic np->nfile.fd = digit_val(fd);
109147139Sbostic redirnode = np;
109247139Sbostic goto parseredir_return;
109347139Sbostic }
109447139Sbostic
109547139Sbostic
109647139Sbostic /*
109747139Sbostic * Parse a substitution. At this point, we have read the dollar sign
109847139Sbostic * and nothing else.
109947139Sbostic */
110047139Sbostic
110147139Sbostic parsesub: {
110247139Sbostic int subtype;
110347139Sbostic int typeloc;
110447139Sbostic int flags;
110547139Sbostic char *p;
110647139Sbostic #ifndef GDB_HACK
110747139Sbostic static const char types[] = "}-+?=";
110847139Sbostic #endif
110947139Sbostic
111047139Sbostic c = pgetc();
111147300Smarc if (c != '(' && c != '{' && !is_name(c) && !is_special(c)) {
111247139Sbostic USTPUTC('$', out);
111347139Sbostic pungetc();
111453302Smarc } else if (c == '(') { /* $(command) or $((arith)) */
111553302Smarc if (pgetc() == '(') {
111653302Smarc PARSEARITH();
111753302Smarc } else {
111853302Smarc pungetc();
111953302Smarc PARSEBACKQNEW();
112053302Smarc }
112147139Sbostic } else {
112247139Sbostic USTPUTC(CTLVAR, out);
112347139Sbostic typeloc = out - stackblock();
112447139Sbostic USTPUTC(VSNORMAL, out);
112547139Sbostic subtype = VSNORMAL;
112647139Sbostic if (c == '{') {
112747139Sbostic c = pgetc();
112869090Sbostic if (c == '#') {
1129*69509Schristos if ((c = pgetc()) == '}')
1130*69509Schristos c = '#';
1131*69509Schristos else
1132*69509Schristos subtype = VSLENGTH;
113369090Sbostic }
113469090Sbostic else
113569090Sbostic subtype = 0;
113647139Sbostic }
113747139Sbostic if (is_name(c)) {
113847139Sbostic do {
113947139Sbostic STPUTC(c, out);
114047139Sbostic c = pgetc();
114147139Sbostic } while (is_in_name(c));
114247139Sbostic } else {
114347139Sbostic if (! is_special(c))
114447300Smarc badsub: synerror("Bad substitution");
114547139Sbostic USTPUTC(c, out);
114647139Sbostic c = pgetc();
114747139Sbostic }
114847139Sbostic STPUTC('=', out);
114947139Sbostic flags = 0;
115047139Sbostic if (subtype == 0) {
115169090Sbostic switch (c) {
115269090Sbostic case ':':
115347139Sbostic flags = VSNUL;
115447139Sbostic c = pgetc();
115569090Sbostic /*FALLTHROUGH*/
115669090Sbostic default:
115769090Sbostic p = strchr(types, c);
115869090Sbostic if (p == NULL)
115969090Sbostic goto badsub;
116069090Sbostic subtype = p - types + VSNORMAL;
116169090Sbostic break;
116269090Sbostic case '%':
116369090Sbostic case '#':
116469090Sbostic {
116569090Sbostic int cc = c;
116669090Sbostic subtype = c == '#' ? VSTRIMLEFT :
116769090Sbostic VSTRIMRIGHT;
116869090Sbostic c = pgetc();
116969090Sbostic if (c == cc)
117069090Sbostic subtype++;
117169090Sbostic else
117269090Sbostic pungetc();
117369090Sbostic break;
117469090Sbostic }
117547139Sbostic }
117647139Sbostic } else {
117747139Sbostic pungetc();
117847139Sbostic }
117953302Smarc if (dblquote || arinest)
118047139Sbostic flags |= VSQUOTE;
118147139Sbostic *(stackblock() + typeloc) = subtype | flags;
118247139Sbostic if (subtype != VSNORMAL)
118347139Sbostic varnest++;
118447139Sbostic }
118547139Sbostic goto parsesub_return;
118647139Sbostic }
118747139Sbostic
118847139Sbostic
118947139Sbostic /*
119047139Sbostic * Called to parse command substitutions. Newstyle is set if the command
119147139Sbostic * is enclosed inside $(...); nlpp is a pointer to the head of the linked
119247139Sbostic * list of commands (passed by reference), and savelen is the number of
119347139Sbostic * characters on the top of the stack which must be preserved.
119447139Sbostic */
119547139Sbostic
119647139Sbostic parsebackq: {
119747139Sbostic struct nodelist **nlpp;
119847139Sbostic int savepbq;
119947139Sbostic union node *n;
120047139Sbostic char *volatile str;
120147139Sbostic struct jmploc jmploc;
120247139Sbostic struct jmploc *volatile savehandler;
120347139Sbostic int savelen;
120447139Sbostic
120547139Sbostic savepbq = parsebackquote;
120647139Sbostic if (setjmp(jmploc.loc)) {
120747139Sbostic if (str)
120847139Sbostic ckfree(str);
120947139Sbostic parsebackquote = 0;
121047139Sbostic handler = savehandler;
121154322Smarc longjmp(handler->loc, 1);
121247139Sbostic }
121347139Sbostic INTOFF;
121447139Sbostic str = NULL;
121547139Sbostic savelen = out - stackblock();
121647139Sbostic if (savelen > 0) {
121747139Sbostic str = ckmalloc(savelen);
121869272Schristos memcpy(str, stackblock(), savelen);
121947139Sbostic }
122047139Sbostic savehandler = handler;
122147139Sbostic handler = &jmploc;
122247139Sbostic INTON;
122360296Smarc if (oldstyle) {
122460296Smarc /* We must read until the closing backquote, giving special
122560296Smarc treatment to some slashes, and then push the string and
122660296Smarc reread it as input, interpreting it normally. */
122760296Smarc register char *out;
122860296Smarc register c;
122960296Smarc int savelen;
123060296Smarc char *str;
123160296Smarc
123260296Smarc STARTSTACKSTR(out);
123360296Smarc while ((c = pgetc ()) != '`') {
123460296Smarc if (c == '\\') {
123560296Smarc c = pgetc ();
123660296Smarc if (c != '\\' && c != '`' && c != '$'
123760296Smarc && (!dblquote || c != '"'))
123860296Smarc STPUTC('\\', out);
123960296Smarc }
124060296Smarc STPUTC(c, out);
124160296Smarc }
124260296Smarc STPUTC('\0', out);
124360296Smarc savelen = out - stackblock();
124460296Smarc if (savelen > 0) {
124560296Smarc str = ckmalloc(savelen);
124669272Schristos memcpy(str, stackblock(), savelen);
124769272Schristos setinputstring(str, 1);
124860296Smarc }
124960296Smarc }
125047139Sbostic nlpp = &bqlist;
125147139Sbostic while (*nlpp)
125247139Sbostic nlpp = &(*nlpp)->next;
125347139Sbostic *nlpp = (struct nodelist *)stalloc(sizeof (struct nodelist));
125447139Sbostic (*nlpp)->next = NULL;
125547139Sbostic parsebackquote = oldstyle;
125647139Sbostic n = list(0);
125760296Smarc if (!oldstyle && (readtoken() != TRP))
125860296Smarc synexpect(TRP);
125947139Sbostic (*nlpp)->n = n;
126060296Smarc /* Start reading from old file again. */
126160296Smarc if (oldstyle)
126260296Smarc popfile();
126347139Sbostic while (stackblocksize() <= savelen)
126447139Sbostic growstackblock();
126547139Sbostic STARTSTACKSTR(out);
126647139Sbostic if (str) {
126769272Schristos memcpy(out, str, savelen);
126847139Sbostic STADJUST(savelen, out);
126947139Sbostic INTOFF;
127047139Sbostic ckfree(str);
127147139Sbostic str = NULL;
127247139Sbostic INTON;
127347139Sbostic }
127447139Sbostic parsebackquote = savepbq;
127547139Sbostic handler = savehandler;
127653302Smarc if (arinest || dblquote)
127753302Smarc USTPUTC(CTLBACKQ | CTLQUOTE, out);
127853302Smarc else
127953302Smarc USTPUTC(CTLBACKQ, out);
128047139Sbostic if (oldstyle)
128147139Sbostic goto parsebackq_oldreturn;
128247139Sbostic else
128347139Sbostic goto parsebackq_newreturn;
128447139Sbostic }
128547139Sbostic
128653302Smarc /*
128753302Smarc * Parse an arithmetic expansion (indicate start of one and set state)
128853302Smarc */
128953302Smarc parsearith: {
129053302Smarc
129153302Smarc if (++arinest == 1) {
129253302Smarc prevsyntax = syntax;
129353302Smarc syntax = ARISYNTAX;
129453302Smarc USTPUTC(CTLARI, out);
129553302Smarc } else {
129653302Smarc /*
129753302Smarc * we collapse embedded arithmetic expansion to
129853302Smarc * parenthesis, which should be equivalent
129953302Smarc */
130053302Smarc USTPUTC('(', out);
130153302Smarc }
130253302Smarc goto parsearith_return;
130353302Smarc }
130453302Smarc
130547139Sbostic } /* end of readtoken */
130647139Sbostic
130747139Sbostic
130847139Sbostic
130947139Sbostic #ifdef mkinit
131047139Sbostic RESET {
131147139Sbostic tokpushback = 0;
131254322Smarc checkkwd = 0;
131347139Sbostic }
131447139Sbostic #endif
131547139Sbostic
131647139Sbostic /*
131747139Sbostic * Returns true if the text contains nothing to expand (no dollar signs
131847139Sbostic * or backquotes).
131947139Sbostic */
132047139Sbostic
132147139Sbostic STATIC int
noexpand(text)132247139Sbostic noexpand(text)
132347139Sbostic char *text;
132447139Sbostic {
132547139Sbostic register char *p;
132647139Sbostic register char c;
132747139Sbostic
132847139Sbostic p = text;
132947139Sbostic while ((c = *p++) != '\0') {
133047139Sbostic if (c == CTLESC)
133147139Sbostic p++;
133247139Sbostic else if (BASESYNTAX[c] == CCTL)
133347139Sbostic return 0;
133447139Sbostic }
133547139Sbostic return 1;
133647139Sbostic }
133747139Sbostic
133847139Sbostic
133947139Sbostic /*
134047139Sbostic * Return true if the argument is a legal variable name (a letter or
134147139Sbostic * underscore followed by zero or more letters, underscores, and digits).
134247139Sbostic */
134347139Sbostic
134447139Sbostic int
goodname(name)134547139Sbostic goodname(name)
134647139Sbostic char *name;
134747139Sbostic {
134847139Sbostic register char *p;
134947139Sbostic
135047139Sbostic p = name;
135147139Sbostic if (! is_name(*p))
135247139Sbostic return 0;
135347139Sbostic while (*++p) {
135447139Sbostic if (! is_in_name(*p))
135547139Sbostic return 0;
135647139Sbostic }
135747139Sbostic return 1;
135847139Sbostic }
135947139Sbostic
136047139Sbostic
136147139Sbostic /*
136247139Sbostic * Called when an unexpected token is read during the parse. The argument
136347139Sbostic * is the token that is expected, or -1 if more than one type of token can
136447139Sbostic * occur at this point.
136547139Sbostic */
136647139Sbostic
136747139Sbostic STATIC void
synexpect(token)136869272Schristos synexpect(token)
136969272Schristos int token;
137069272Schristos {
137147139Sbostic char msg[64];
137247139Sbostic
137347139Sbostic if (token >= 0) {
137447139Sbostic fmtstr(msg, 64, "%s unexpected (expecting %s)",
137547139Sbostic tokname[lasttoken], tokname[token]);
137647139Sbostic } else {
137747139Sbostic fmtstr(msg, 64, "%s unexpected", tokname[lasttoken]);
137847139Sbostic }
137947139Sbostic synerror(msg);
138047139Sbostic }
138147139Sbostic
138247139Sbostic
138347139Sbostic STATIC void
synerror(msg)138447139Sbostic synerror(msg)
138547139Sbostic char *msg;
138647139Sbostic {
138747139Sbostic if (commandname)
138847139Sbostic outfmt(&errout, "%s: %d: ", commandname, startlinno);
138947139Sbostic outfmt(&errout, "Syntax error: %s\n", msg);
139047139Sbostic error((char *)NULL);
139147139Sbostic }
139254322Smarc
139354322Smarc STATIC void
setprompt(which)139454322Smarc setprompt(which)
139554322Smarc int which;
139654322Smarc {
139754322Smarc whichprompt = which;
139854322Smarc
139969272Schristos #ifndef NO_HISTORY
140054322Smarc if (!el)
140169272Schristos #endif
140254322Smarc out2str(getprompt(NULL));
140354322Smarc }
140454322Smarc
140554322Smarc /*
140654322Smarc * called by editline -- any expansions to the prompt
140754322Smarc * should be added here.
140854322Smarc */
140954322Smarc char *
getprompt(unused)141054322Smarc getprompt(unused)
141154322Smarc void *unused;
141254322Smarc {
141354322Smarc switch (whichprompt) {
141454322Smarc case 0:
141554322Smarc return "";
141654322Smarc case 1:
141754322Smarc return ps1val();
141854322Smarc case 2:
141954322Smarc return ps2val();
142054322Smarc default:
142154322Smarc return "<internal prompt error>";
142254322Smarc }
142354322Smarc }
1424