xref: /csrg-svn/bin/csh/csh.c (revision 69126)
147823Sbostic /*-
260765Sbostic  * Copyright (c) 1980, 1991, 1993
360765Sbostic  *	The Regents of the University of California.  All rights reserved.
447823Sbostic  *
547823Sbostic  * %sccs.include.redist.c%
621925Sdist  */
721925Sdist 
817516Sedward #ifndef lint
960765Sbostic static char copyright[] =
1060765Sbostic "@(#) Copyright (c) 1980, 1991, 1993\n\
1160765Sbostic 	The Regents of the University of California.  All rights reserved.\n";
1247823Sbostic #endif /* not lint */
131287Sbill 
1447823Sbostic #ifndef lint
15*69126Schristos static char sccsid[] = "@(#)csh.c	8.4 (Berkeley) 04/29/95";
1647823Sbostic #endif /* not lint */
1747823Sbostic 
1850028Sbostic #include <sys/types.h>
1950028Sbostic #include <sys/ioctl.h>
2050028Sbostic #include <sys/stat.h>
2150028Sbostic #include <fcntl.h>
2250028Sbostic #include <errno.h>
2350028Sbostic #include <pwd.h>
2450028Sbostic #include <stdlib.h>
2550028Sbostic #include <string.h>
2650028Sbostic #include <locale.h>
2750028Sbostic #include <unistd.h>
2851589Schristos #include <vis.h>
2950033Schristos #if __STDC__
3050033Schristos # include <stdarg.h>
3150033Schristos #else
3250033Schristos # include <varargs.h>
3350033Schristos #endif
3450033Schristos 
3550023Sbostic #include "csh.h"
3664711Schristos #include "proc.h"
3750023Sbostic #include "extern.h"
3850028Sbostic #include "pathnames.h"
3936786Sbostic 
4049992Sbostic extern bool MapsAreInited;
4149992Sbostic extern bool NLSMapsAreInited;
4249992Sbostic 
431287Sbill /*
441287Sbill  * C Shell
451287Sbill  *
461287Sbill  * Bill Joy, UC Berkeley, California, USA
471287Sbill  * October 1978, May 1980
481287Sbill  *
491287Sbill  * Jim Kulp, IIASA, Laxenburg, Austria
501287Sbill  * April 1980
5150023Sbostic  *
5250023Sbostic  * Christos Zoulas, Cornell University
5350023Sbostic  * June, 1991
541287Sbill  */
551287Sbill 
5649992Sbostic Char   *dumphist[] = {STRhistory, STRmh, 0, 0};
5752786Schristos Char   *loadhist[] = {STRsource, STRmh, STRtildothist, 0};
581287Sbill 
5949992Sbostic int     nofile = 0;
6049992Sbostic bool    reenter = 0;
6149992Sbostic bool    nverbose = 0;
6249992Sbostic bool    nexececho = 0;
6349992Sbostic bool    quitit = 0;
6449992Sbostic bool    fast = 0;
6549992Sbostic bool    batch = 0;
6649992Sbostic bool    mflag = 0;
6749992Sbostic bool    prompt = 1;
6849992Sbostic bool    enterhist = 0;
6949992Sbostic bool    tellwhat = 0;
7026965Slepreau 
7149992Sbostic extern char **environ;
7246649Sbostic 
7350439Schristos static int	readf __P((void *, char *, int));
7450439Schristos static fpos_t	seekf __P((void *, fpos_t, int));
7550439Schristos static int	writef __P((void *, const char *, int));
7650439Schristos static int	closef __P((void *));
7750024Schristos static int	srccat __P((Char *, Char *));
7850024Schristos static int	srcfile __P((char *, bool, bool));
7950024Schristos static void	phup __P((int));
8050024Schristos static void	srcunit __P((int, bool, bool));
8150024Schristos static void	mailchk __P((void));
8250024Schristos static Char   **defaultpath __P((void));
8349992Sbostic 
8449992Sbostic int
main(argc,argv)8545559Sbostic main(argc, argv)
8649992Sbostic     int     argc;
8749992Sbostic     char  **argv;
881287Sbill {
8949992Sbostic     register Char *cp;
9049992Sbostic     register char *tcp;
9149992Sbostic     register int f;
9249992Sbostic     register char **tempv;
9368576Schristos     struct sigaction oact;
9468576Schristos     sigset_t sigset;
951287Sbill 
9650439Schristos     cshin = stdin;
9750439Schristos     cshout = stdout;
9850439Schristos     csherr = stderr;
991287Sbill 
10049992Sbostic     settimes();			/* Immed. estab. timing base */
1011287Sbill 
10249992Sbostic     /*
10349992Sbostic      * Initialize non constant strings
10449992Sbostic      */
10549992Sbostic #ifdef _PATH_BSHELL
10649992Sbostic     STR_BSHELL = SAVE(_PATH_BSHELL);
10749992Sbostic #endif
10849992Sbostic #ifdef _PATH_CSHELL
10949992Sbostic     STR_SHELLPATH = SAVE(_PATH_CSHELL);
11049992Sbostic #endif
11149992Sbostic     STR_environ = blk2short(environ);
11249992Sbostic     environ = short2blk(STR_environ);	/* So that we can free it */
11349992Sbostic     STR_WORD_CHARS = SAVE(WORD_CHARS);
1141287Sbill 
11549992Sbostic     HIST = '!';
11649992Sbostic     HISTSUB = '^';
11749992Sbostic     word_chars = STR_WORD_CHARS;
1181287Sbill 
11949992Sbostic     tempv = argv;
12049992Sbostic     if (eq(str2short(tempv[0]), STRaout))	/* A.out's are quittable */
12149992Sbostic 	quitit = 1;
12249992Sbostic     uid = getuid();
12349992Sbostic     gid = getgid();
12453387Schristos     euid = geteuid();
12553387Schristos     egid = getegid();
12649992Sbostic     /*
12749992Sbostic      * We are a login shell if: 1. we were invoked as -<something> and we had
12849992Sbostic      * no arguments 2. or we were invoked only with the -l flag
12949992Sbostic      */
13049992Sbostic     loginsh = (**tempv == '-' && argc == 1) ||
13149992Sbostic 	(argc == 2 && tempv[1][0] == '-' && tempv[1][1] == 'l' &&
13249992Sbostic 	 tempv[1][2] == '\0');
1331287Sbill 
13449992Sbostic     if (loginsh && **tempv != '-') {
1351287Sbill 	/*
13649992Sbostic 	 * Mangle the argv space
1371287Sbill 	 */
13849992Sbostic 	tempv[1][0] = '\0';
13949992Sbostic 	tempv[1][1] = '\0';
14049992Sbostic 	tempv[1] = NULL;
14151437Sleres 	for (tcp = *tempv; *tcp++;)
14251437Sleres 	    continue;
14349992Sbostic 	for (tcp--; tcp >= *tempv; tcp--)
14449992Sbostic 	    tcp[1] = tcp[0];
14549992Sbostic 	*++tcp = '-';
14649992Sbostic 	argc--;
14749992Sbostic     }
14849992Sbostic     if (loginsh)
14949992Sbostic 	(void) time(&chktim);
15039206Sbostic 
15149992Sbostic     AsciiOnly = 1;
15249992Sbostic #ifdef NLS
15349992Sbostic     (void) setlocale(LC_ALL, "");
15449992Sbostic     {
15549992Sbostic 	int     k;
1561287Sbill 
15751437Sleres 	for (k = 0200; k <= 0377 && !Isprint(k); k++)
15851437Sleres 	    continue;
15949992Sbostic 	AsciiOnly = k > 0377;
16049992Sbostic     }
16149992Sbostic #else
16249992Sbostic     AsciiOnly = getenv("LANG") == NULL && getenv("LC_CTYPE") == NULL;
16349992Sbostic #endif				/* NLS */
1641287Sbill 
16549992Sbostic     /*
16649992Sbostic      * Move the descriptors to safe places. The variable didfds is 0 while we
16749992Sbostic      * have only FSH* to work with. When didfds is true, we have 0,1,2 and
16849992Sbostic      * prefer to use these.
16949992Sbostic      */
17049992Sbostic     initdesc();
17155361Smarc     /*
17255361Smarc      * XXX: This is to keep programs that use stdio happy.
17355361Smarc      *	    what we really want is freunopen() ....
17455361Smarc      *	    Closing cshin cshout and csherr (which are really stdin stdout
17555361Smarc      *	    and stderr at this point and then reopening them in the same order
17655361Smarc      *	    gives us again stdin == cshin stdout == cshout and stderr == csherr.
17755361Smarc      *	    If that was not the case builtins like printf that use stdio
17855361Smarc      *	    would break. But in any case we could fix that with memcpy and
17955361Smarc      *	    a bit of pointer manipulation...
18055361Smarc      *	    Fortunately this is not needed under the current implementation
18155361Smarc      *	    of stdio.
18255361Smarc      */
18350439Schristos     (void) fclose(cshin);
18450439Schristos     (void) fclose(cshout);
18550439Schristos     (void) fclose(csherr);
18650439Schristos     if (!(cshin  = funopen((void *) &SHIN,  readf, writef, seekf, closef)))
18750439Schristos 	exit(1);
18850439Schristos     if (!(cshout = funopen((void *) &SHOUT, readf, writef, seekf, closef)))
18950439Schristos 	exit(1);
19050439Schristos     if (!(csherr = funopen((void *) &SHERR, readf, writef, seekf, closef)))
19150439Schristos 	exit(1);
19250439Schristos     (void) setvbuf(cshin,  NULL, _IOLBF, 0);
19350439Schristos     (void) setvbuf(cshout, NULL, _IOLBF, 0);
19450439Schristos     (void) setvbuf(csherr, NULL, _IOLBF, 0);
19517170Sralph 
19649992Sbostic     /*
19749992Sbostic      * Initialize the shell variables. ARGV and PROMPT are initialized later.
19849992Sbostic      * STATUS is also munged in several places. CHILD is munged when
19949992Sbostic      * forking/waiting
20049992Sbostic      */
20149992Sbostic     set(STRstatus, Strsave(STR0));
2021287Sbill 
20350024Schristos     if ((tcp = getenv("HOME")) != NULL)
20449992Sbostic 	cp = SAVE(tcp);
20549992Sbostic     else
20649992Sbostic 	cp = NULL;
2071287Sbill 
20849992Sbostic     if (cp == NULL)
20949992Sbostic 	fast = 1;		/* No home -> can't read scripts */
21049992Sbostic     else
21149992Sbostic 	set(STRhome, cp);
21249992Sbostic     dinit(cp);			/* dinit thinks that HOME == cwd in a login
21349992Sbostic 				 * shell */
21449992Sbostic     /*
21549992Sbostic      * Grab other useful things from the environment. Should we grab
21649992Sbostic      * everything??
21749992Sbostic      */
21850024Schristos     if ((tcp = getenv("LOGNAME")) != NULL ||
21950024Schristos 	(tcp = getenv("USER")) != NULL)
22049992Sbostic 	set(STRuser, SAVE(tcp));
22150024Schristos     if ((tcp = getenv("TERM")) != NULL)
22249992Sbostic 	set(STRterm, SAVE(tcp));
2231287Sbill 
22449992Sbostic     /*
22549992Sbostic      * Re-initialize path if set in environment
22649992Sbostic      */
22750024Schristos     if ((tcp = getenv("PATH")) == NULL)
22849992Sbostic 	set1(STRpath, defaultpath(), &shvhed);
22949992Sbostic     else
23049992Sbostic 	importpath(SAVE(tcp));
2311287Sbill 
23249992Sbostic     set(STRshell, Strsave(STR_SHELLPATH));
23336488Sbostic 
23449992Sbostic     doldol = putn((int) getpid());	/* For $$ */
23549992Sbostic     shtemp = Strspl(STRtmpsh, doldol);	/* For << */
2361287Sbill 
23749992Sbostic     /*
23849992Sbostic      * Record the interrupt states from the parent process. If the parent is
23949992Sbostic      * non-interruptible our hand must be forced or we (and our children) won't
24049992Sbostic      * be either. Our children inherit termination from our parent. We catch it
24149992Sbostic      * only if we are the login shell.
24249992Sbostic      */
24349992Sbostic     /* parents interruptibility */
24468576Schristos     (void) sigaction(SIGINT, NULL, &oact);
24568576Schristos     parintr = oact.sa_handler;
24668576Schristos     (void) sigaction(SIGTERM, NULL, &oact);
24768576Schristos     parterm = oact.sa_handler;
2481287Sbill 
249*69126Schristos     (void) signal(SIGHUP, phup);	/* exit processing on HUP */
250*69126Schristos     (void) signal(SIGXCPU, phup);	/* ...and on XCPU */
251*69126Schristos     (void) signal(SIGXFSZ, phup);	/* ...and on XFSZ */
2521287Sbill 
25349992Sbostic     /*
25449992Sbostic      * Process the arguments.
25551437Sleres      *
25649992Sbostic      * Note that processing of -v/-x is actually delayed till after script
25749992Sbostic      * processing.
25851437Sleres      *
25950439Schristos      * We set the first character of our name to be '-' if we are a shell
26051437Sleres      * running interruptible commands.  Many programs which examine ps'es
26150439Schristos      * use this to filter such shells out.
26249992Sbostic      */
26349992Sbostic     argc--, tempv++;
26449992Sbostic     while (argc > 0 && (tcp = tempv[0])[0] == '-' && *++tcp != '\0' && !batch) {
26549992Sbostic 	do
26649992Sbostic 	    switch (*tcp++) {
2671287Sbill 
26849992Sbostic 	    case 0:		/* -	Interruptible, no prompt */
26949992Sbostic 		prompt = 0;
27049992Sbostic 		setintr = 1;
27149992Sbostic 		nofile = 1;
27249992Sbostic 		break;
2731287Sbill 
27449992Sbostic 	    case 'b':		/* -b	Next arg is input file */
27549992Sbostic 		batch = 1;
27649992Sbostic 		break;
2771287Sbill 
27849992Sbostic 	    case 'c':		/* -c	Command input from arg */
27949992Sbostic 		if (argc == 1)
28049992Sbostic 		    xexit(0);
28149992Sbostic 		argc--, tempv++;
28249992Sbostic 		arginp = SAVE(tempv[0]);
28349992Sbostic 		prompt = 0;
28449992Sbostic 		nofile = 1;
28549992Sbostic 		break;
2861287Sbill 
28749992Sbostic 	    case 'e':		/* -e	Exit on any error */
28849992Sbostic 		exiterr = 1;
28949992Sbostic 		break;
2901287Sbill 
29149992Sbostic 	    case 'f':		/* -f	Fast start */
29249992Sbostic 		fast = 1;
29349992Sbostic 		break;
2941287Sbill 
29549992Sbostic 	    case 'i':		/* -i	Interactive, even if !intty */
29649992Sbostic 		intact = 1;
29749992Sbostic 		nofile = 1;
29849992Sbostic 		break;
2991287Sbill 
30049992Sbostic 	    case 'm':		/* -m	read .cshrc (from su) */
30149992Sbostic 		mflag = 1;
30249992Sbostic 		break;
30349992Sbostic 
30449992Sbostic 	    case 'n':		/* -n	Don't execute */
30549992Sbostic 		noexec = 1;
30649992Sbostic 		break;
30749992Sbostic 
30849992Sbostic 	    case 'q':		/* -q	(Undoc'd) ... die on quit */
30949992Sbostic 		quitit = 1;
31049992Sbostic 		break;
31149992Sbostic 
31249992Sbostic 	    case 's':		/* -s	Read from std input */
31349992Sbostic 		nofile = 1;
31449992Sbostic 		break;
31549992Sbostic 
31649992Sbostic 	    case 't':		/* -t	Read one line from input */
31749992Sbostic 		onelflg = 2;
3181287Sbill 		prompt = 0;
31949992Sbostic 		nofile = 1;
32049992Sbostic 		break;
32149992Sbostic 
32249992Sbostic 	    case 'v':		/* -v	Echo hist expanded input */
32349992Sbostic 		nverbose = 1;	/* ... later */
32449992Sbostic 		break;
32549992Sbostic 
32649992Sbostic 	    case 'x':		/* -x	Echo just before execution */
32749992Sbostic 		nexececho = 1;	/* ... later */
32849992Sbostic 		break;
32949992Sbostic 
33049992Sbostic 	    case 'V':		/* -V	Echo hist expanded input */
33149992Sbostic 		setNS(STRverbose);	/* NOW! */
33249992Sbostic 		break;
33349992Sbostic 
33449992Sbostic 	    case 'X':		/* -X	Echo just before execution */
33549992Sbostic 		setNS(STRecho);	/* NOW! */
33649992Sbostic 		break;
33749992Sbostic 
33849992Sbostic 	} while (*tcp);
33949992Sbostic 	tempv++, argc--;
34049992Sbostic     }
34149992Sbostic 
34249992Sbostic     if (quitit)			/* With all due haste, for debugging */
34349992Sbostic 	(void) signal(SIGQUIT, SIG_DFL);
34449992Sbostic 
34549992Sbostic     /*
34649992Sbostic      * Unless prevented by -, -c, -i, -s, or -t, if there are remaining
34749992Sbostic      * arguments the first of them is the name of a shell file from which to
34849992Sbostic      * read commands.
34949992Sbostic      */
35049992Sbostic     if (nofile == 0 && argc > 0) {
35149992Sbostic 	nofile = open(tempv[0], O_RDONLY);
35249992Sbostic 	if (nofile < 0) {
35349992Sbostic 	    child = 1;		/* So this doesn't return */
35449992Sbostic 	    stderror(ERR_SYSTEM, tempv[0], strerror(errno));
3551287Sbill 	}
35649992Sbostic 	ffile = SAVE(tempv[0]);
35751437Sleres 	/*
35849992Sbostic 	 * Replace FSHIN. Handle /dev/std{in,out,err} specially
35949992Sbostic 	 * since once they are closed we cannot open them again.
36049992Sbostic 	 * In that case we use our own saved descriptors
36149992Sbostic 	 */
36251437Sleres 	if ((SHIN = dmove(nofile, FSHIN)) < 0)
36349992Sbostic 	    switch(nofile) {
36449992Sbostic 	    case 0:
36549992Sbostic 		SHIN = FSHIN;
36649992Sbostic 		break;
36749992Sbostic 	    case 1:
36849992Sbostic 		SHIN = FSHOUT;
36949992Sbostic 		break;
37049992Sbostic 	    case 2:
37150439Schristos 		SHIN = FSHERR;
37249992Sbostic 		break;
37349992Sbostic 	    default:
37449992Sbostic 		stderror(ERR_SYSTEM, tempv[0], strerror(errno));
37549992Sbostic 		break;
37649992Sbostic 	    }
37750024Schristos 	(void) ioctl(SHIN, FIOCLEX, NULL);
37849992Sbostic 	prompt = 0;
37949992Sbostic 	 /* argc not used any more */ tempv++;
38049992Sbostic     }
38150439Schristos 
38249992Sbostic     intty = isatty(SHIN);
38349992Sbostic     intty |= intact;
38449992Sbostic     if (intty || (intact && isatty(SHOUT))) {
38553387Schristos 	if (!batch && (uid != euid || gid != egid)) {
38649992Sbostic 	    errno = EACCES;
38749992Sbostic 	    child = 1;		/* So this doesn't return */
38849992Sbostic 	    stderror(ERR_SYSTEM, "csh", strerror(errno));
38917170Sralph 	}
39049992Sbostic     }
39149992Sbostic     /*
39249992Sbostic      * Decide whether we should play with signals or not. If we are explicitly
39349992Sbostic      * told (via -i, or -) or we are a login shell (arg0 starts with -) or the
39449992Sbostic      * input and output are both the ttys("csh", or "csh</dev/ttyx>/dev/ttyx")
39549992Sbostic      * Note that in only the login shell is it likely that parent may have set
39649992Sbostic      * signals to be ignored
39749992Sbostic      */
39860237Schristos     if (loginsh || intact || (intty && isatty(SHOUT)))
39949992Sbostic 	setintr = 1;
40049992Sbostic     settell();
40149992Sbostic     /*
40249992Sbostic      * Save the remaining arguments in argv.
40349992Sbostic      */
40449992Sbostic     setq(STRargv, blk2short(tempv), &shvhed);
4051287Sbill 
40649992Sbostic     /*
40749992Sbostic      * Set up the prompt.
40849992Sbostic      */
40949992Sbostic     if (prompt) {
41049992Sbostic 	set(STRprompt, Strsave(uid == 0 ? STRsymhash : STRsymcent));
41149992Sbostic 	/* that's a meta-questionmark */
41249992Sbostic 	set(STRprompt2, Strsave(STRmquestion));
41349992Sbostic     }
4141287Sbill 
41549992Sbostic     /*
41649992Sbostic      * If we are an interactive shell, then start fiddling with the signals;
41749992Sbostic      * this is a tricky game.
41849992Sbostic      */
41949992Sbostic     shpgrp = getpgrp();
42049992Sbostic     opgrp = tpgrp = -1;
42149992Sbostic     if (setintr) {
42249992Sbostic 	**argv = '-';
42349992Sbostic 	if (!quitit)		/* Wary! */
42449992Sbostic 	    (void) signal(SIGQUIT, SIG_IGN);
42549992Sbostic 	(void) signal(SIGINT, pintr);
42668576Schristos 	sigemptyset(&sigset);
42768576Schristos 	sigaddset(&sigset, SIGINT);
42868576Schristos 	sigprocmask(SIG_BLOCK, &sigset, NULL);
42949992Sbostic 	(void) signal(SIGTERM, SIG_IGN);
43049992Sbostic 	if (quitit == 0 && arginp == 0) {
43149992Sbostic 	    (void) signal(SIGTSTP, SIG_IGN);
43249992Sbostic 	    (void) signal(SIGTTIN, SIG_IGN);
43349992Sbostic 	    (void) signal(SIGTTOU, SIG_IGN);
43449992Sbostic 	    /*
43549992Sbostic 	     * Wait till in foreground, in case someone stupidly runs csh &
43649992Sbostic 	     * dont want to try to grab away the tty.
43749992Sbostic 	     */
43850439Schristos 	    if (isatty(FSHERR))
43950439Schristos 		f = FSHERR;
44049992Sbostic 	    else if (isatty(FSHOUT))
44149992Sbostic 		f = FSHOUT;
44249992Sbostic 	    else if (isatty(OLDSTD))
44349992Sbostic 		f = OLDSTD;
44449992Sbostic 	    else
44549992Sbostic 		f = -1;
44649992Sbostic     retry:
44749992Sbostic 	    if ((tpgrp = tcgetpgrp(f)) != -1) {
44849992Sbostic 		if (tpgrp != shpgrp) {
44949992Sbostic 		    sig_t old = signal(SIGTTIN, SIG_DFL);
45049992Sbostic 		    (void) kill(0, SIGTTIN);
45149992Sbostic 		    (void) signal(SIGTTIN, old);
45249992Sbostic 		    goto retry;
45349992Sbostic 		}
45449992Sbostic 		opgrp = shpgrp;
45549992Sbostic 		shpgrp = getpid();
45649992Sbostic 		tpgrp = shpgrp;
45749992Sbostic 		/*
45851437Sleres 		 * Setpgid will fail if we are a session leader and
45949992Sbostic 		 * mypid == mypgrp (POSIX 4.3.3)
46049992Sbostic 		 */
46149992Sbostic 		if (opgrp != shpgrp)
46249992Sbostic 		    if (setpgid(0, shpgrp) == -1)
46349992Sbostic 			goto notty;
46449992Sbostic 		/*
46549992Sbostic 		 * We do that after we set our process group, to make sure
46649992Sbostic 		 * that the process group belongs to a process in the same
46749992Sbostic 		 * session as the tty (our process and our group) (POSIX 7.2.4)
46849992Sbostic 		 */
46949992Sbostic 		if (tcsetpgrp(f, shpgrp) == -1)
47049992Sbostic 		    goto notty;
47150024Schristos 		(void) ioctl(dcopy(f, FSHTTY), FIOCLEX, NULL);
47249992Sbostic 	    }
47349992Sbostic 	    if (tpgrp == -1) {
4741287Sbill notty:
47551437Sleres 		(void) fprintf(csherr, "Warning: no access to tty (%s).\n",
47650439Schristos 			       strerror(errno));
47750439Schristos 		(void) fprintf(csherr, "Thus no job control in this shell.\n");
47849992Sbostic 	    }
4791287Sbill 	}
48049992Sbostic     }
48149992Sbostic     if ((setintr == 0) && (parintr == SIG_DFL))
48249992Sbostic 	setintr = 1;
48349992Sbostic     (void) signal(SIGCHLD, pchild);	/* while signals not ready */
4841287Sbill 
48549992Sbostic     /*
48649992Sbostic      * Set an exit here in case of an interrupt or error reading the shell
48749992Sbostic      * start-up scripts.
48849992Sbostic      */
48949992Sbostic     reenter = setexit();	/* PWP */
49049992Sbostic     haderr = 0;			/* In case second time through */
49149992Sbostic     if (!fast && reenter == 0) {
49249992Sbostic 	/* Will have value(STRhome) here because set fast if don't */
49349992Sbostic 	{
49449992Sbostic 	    int     osetintr = setintr;
49551523Schristos 	    sig_t   oparintr = parintr;
49668576Schristos 	    sigset_t osigset;
49749992Sbostic 
49868576Schristos 	    sigemptyset(&sigset);
49968576Schristos 	    sigaddset(&sigset, SIGINT);
50068576Schristos 	    sigprocmask(SIG_BLOCK, &sigset, &osigset);
50168576Schristos 
50249992Sbostic 	    setintr = 0;
50351523Schristos 	    parintr = SIG_IGN;	/* Disable onintr */
50449992Sbostic #ifdef _PATH_DOTCSHRC
50549992Sbostic 	    (void) srcfile(_PATH_DOTCSHRC, 0, 0);
50649992Sbostic #endif
50749992Sbostic 	    if (!fast && !arginp && !onelflg)
50850439Schristos 		dohash(NULL, NULL);
50949992Sbostic #ifdef _PATH_DOTLOGIN
51049992Sbostic 	    if (loginsh)
51149992Sbostic 		(void) srcfile(_PATH_DOTLOGIN, 0, 0);
51249992Sbostic #endif
51368576Schristos 	    sigprocmask(SIG_SETMASK, &osigset, NULL);
51449992Sbostic 	    setintr = osetintr;
51551523Schristos 	    parintr = oparintr;
5161287Sbill 	}
51749992Sbostic 	(void) srccat(value(STRhome), STRsldotcshrc);
5181287Sbill 
51949992Sbostic 	if (!fast && !arginp && !onelflg && !havhash)
52050439Schristos 	    dohash(NULL, NULL);
52152786Schristos 	/*
52252786Schristos 	 * Source history before .login so that it is available in .login
52352786Schristos 	 */
52452786Schristos 	if ((cp = value(STRhistfile)) != STRNULL)
52552786Schristos 	    loadhist[2] = cp;
52652786Schristos 	dosource(loadhist, NULL);
52749992Sbostic         if (loginsh)
52849992Sbostic 	      (void) srccat(value(STRhome), STRsldotlogin);
52949992Sbostic     }
5301287Sbill 
53149992Sbostic     /*
53249992Sbostic      * Now are ready for the -v and -x flags
53349992Sbostic      */
53449992Sbostic     if (nverbose)
53549992Sbostic 	setNS(STRverbose);
53649992Sbostic     if (nexececho)
53749992Sbostic 	setNS(STRecho);
5381287Sbill 
53949992Sbostic     /*
54049992Sbostic      * All the rest of the world is inside this call. The argument to process
54149992Sbostic      * indicates whether it should catch "error unwinds".  Thus if we are a
54249992Sbostic      * interactive shell our call here will never return by being blown past on
54349992Sbostic      * an error.
54449992Sbostic      */
54549992Sbostic     process(setintr);
54649992Sbostic 
54749992Sbostic     /*
54849992Sbostic      * Mop-up.
54949992Sbostic      */
55049992Sbostic     if (intty) {
5511287Sbill 	if (loginsh) {
55250439Schristos 	    (void) fprintf(cshout, "logout\n");
55349992Sbostic 	    (void) close(SHIN);
55449992Sbostic 	    child = 1;
55549992Sbostic 	    goodbye();
5561287Sbill 	}
55749992Sbostic 	else {
55850439Schristos 	    (void) fprintf(cshout, "exit\n");
55949992Sbostic 	}
56049992Sbostic     }
56149992Sbostic     rechist();
56249992Sbostic     exitstat();
56349992Sbostic     return (0);
5641287Sbill }
5651287Sbill 
56649992Sbostic void
untty()5671287Sbill untty()
5681287Sbill {
56949992Sbostic     if (tpgrp > 0) {
57049992Sbostic 	(void) setpgid(0, opgrp);
57149992Sbostic 	(void) tcsetpgrp(FSHTTY, opgrp);
57249992Sbostic     }
5731287Sbill }
5741287Sbill 
57549992Sbostic void
importpath(cp)5761287Sbill importpath(cp)
57749992Sbostic     Char   *cp;
5781287Sbill {
57949992Sbostic     register int i = 0;
58049992Sbostic     register Char *dp;
58149992Sbostic     register Char **pv;
58249992Sbostic     int     c;
5831287Sbill 
58449992Sbostic     for (dp = cp; *dp; dp++)
58549992Sbostic 	if (*dp == ':')
58649992Sbostic 	    i++;
58749992Sbostic     /*
58849992Sbostic      * i+2 where i is the number of colons in the path. There are i+1
58949992Sbostic      * directories in the path plus we need room for a zero terminator.
59049992Sbostic      */
59149992Sbostic     pv = (Char **) xcalloc((size_t) (i + 2), sizeof(Char **));
59249992Sbostic     dp = cp;
59349992Sbostic     i = 0;
59449992Sbostic     if (*dp)
5951287Sbill 	for (;;) {
59649992Sbostic 	    if ((c = *dp) == ':' || c == 0) {
59749992Sbostic 		*dp = 0;
59853387Schristos 		if ((*cp != '/' || *cp == '\0') && (euid == 0 || uid == 0))
59953387Schristos 		    (void) fprintf(csherr,
60053387Schristos 	    "Warning: imported path contains relative components\n");
60149992Sbostic 		pv[i++] = Strsave(*cp ? cp : STRdot);
60249992Sbostic 		if (c) {
60349992Sbostic 		    cp = dp + 1;
60449992Sbostic 		    *dp = ':';
6051287Sbill 		}
60649992Sbostic 		else
60749992Sbostic 		    break;
60849992Sbostic 	    }
60949992Sbostic 	    dp++;
6101287Sbill 	}
61149992Sbostic     pv[i] = 0;
61249992Sbostic     set1(STRpath, pv, &shvhed);
6131287Sbill }
6141287Sbill 
6151287Sbill /*
6161287Sbill  * Source to the file which is the catenation of the argument names.
6171287Sbill  */
61849992Sbostic static int
srccat(cp,dp)6191287Sbill srccat(cp, dp)
62049992Sbostic     Char   *cp, *dp;
6211287Sbill {
62249992Sbostic     register Char *ep = Strspl(cp, dp);
62349992Sbostic     char   *ptr = short2str(ep);
6241287Sbill 
62549992Sbostic     xfree((ptr_t) ep);
62649992Sbostic     return srcfile(ptr, mflag ? 0 : 1, 0);
6271287Sbill }
6281287Sbill 
6291287Sbill /*
63049992Sbostic  * Source to a file putting the file descriptor in a safe place (> 2).
6311287Sbill  */
63249992Sbostic static int
srcfile(f,onlyown,flag)63349992Sbostic srcfile(f, onlyown, flag)
63449992Sbostic     char   *f;
63549992Sbostic     bool    onlyown, flag;
63649992Sbostic {
63749992Sbostic     register int unit;
63849992Sbostic 
63949992Sbostic     if ((unit = open(f, O_RDONLY)) == -1)
64049992Sbostic 	return 0;
64149992Sbostic     unit = dmove(unit, -1);
64249992Sbostic 
64350024Schristos     (void) ioctl(unit, FIOCLEX, NULL);
64449992Sbostic     srcunit(unit, onlyown, flag);
64549992Sbostic     return 1;
64649992Sbostic }
64749992Sbostic 
64849992Sbostic /*
64949992Sbostic  * Source to a unit.  If onlyown it must be our file or our group or
65049992Sbostic  * we don't chance it.	This occurs on ".cshrc"s and the like.
65149992Sbostic  */
65249992Sbostic int     insource;
65346649Sbostic static void
srcunit(unit,onlyown,hflg)6544946Smckusic srcunit(unit, onlyown, hflg)
65549992Sbostic     register int unit;
65649992Sbostic     bool    onlyown, hflg;
6571287Sbill {
65849992Sbostic     /* We have to push down a lot of state here */
65949992Sbostic     /* All this could go into a structure */
66049992Sbostic     int     oSHIN = -1, oldintty = intty, oinsource = insource;
66149992Sbostic     struct whyle *oldwhyl = whyles;
66249992Sbostic     Char   *ogointr = gointr, *oarginp = arginp;
66349992Sbostic     Char   *oevalp = evalp, **oevalvec = evalvec;
66449992Sbostic     int     oonelflg = onelflg;
66549992Sbostic     bool    oenterhist = enterhist;
66649992Sbostic     char    OHIST = HIST;
66749992Sbostic     bool    otell = cantell;
6681287Sbill 
66949992Sbostic     struct Bin saveB;
67068576Schristos     sigset_t sigset, osigset;
67149992Sbostic     jmp_buf oldexit;
6721287Sbill 
67349992Sbostic     /* The (few) real local variables */
67449992Sbostic     int     my_reenter;
6751287Sbill 
67649992Sbostic     if (unit < 0)
67749992Sbostic 	return;
67849992Sbostic     if (didfds)
67949992Sbostic 	donefds();
68049992Sbostic     if (onlyown) {
68149992Sbostic 	struct stat stb;
68249992Sbostic 
68349992Sbostic 	if (fstat(unit, &stb) < 0) {
68449992Sbostic 	    (void) close(unit);
68549992Sbostic 	    return;
6861287Sbill 	}
68749992Sbostic     }
6881287Sbill 
68949992Sbostic     /*
69049992Sbostic      * There is a critical section here while we are pushing down the input
69149992Sbostic      * stream since we have stuff in different structures. If we weren't
69249992Sbostic      * careful an interrupt could corrupt SHIN's Bin structure and kill the
69349992Sbostic      * shell.
69451437Sleres      *
69549992Sbostic      * We could avoid the critical region by grouping all the stuff in a single
69649992Sbostic      * structure and pointing at it to move it all at once.  This is less
69749992Sbostic      * efficient globally on many variable references however.
69849992Sbostic      */
69949992Sbostic     insource = 1;
70049992Sbostic     getexit(oldexit);
70149992Sbostic 
70268576Schristos     if (setintr) {
70368576Schristos 	sigemptyset(&sigset);
70468576Schristos 	sigaddset(&sigset, SIGINT);
70568576Schristos 	sigprocmask(SIG_BLOCK, &sigset, &osigset);
70668576Schristos     }
70749992Sbostic     /* Setup the new values of the state stuff saved above */
708*69126Schristos     memmove(&saveB, &B, sizeof(B));
70950024Schristos     fbuf = NULL;
71049992Sbostic     fseekp = feobp = fblocks = 0;
71149992Sbostic     oSHIN = SHIN, SHIN = unit, arginp = 0, onelflg = 0;
71249992Sbostic     intty = isatty(SHIN), whyles = 0, gointr = 0;
71349992Sbostic     evalvec = 0;
71449992Sbostic     evalp = 0;
71549992Sbostic     enterhist = hflg;
71649992Sbostic     if (enterhist)
71749992Sbostic 	HIST = '\0';
71849992Sbostic 
71949992Sbostic     /*
72049992Sbostic      * Now if we are allowing commands to be interrupted, we let ourselves be
72149992Sbostic      * interrupted.
72249992Sbostic      */
72349992Sbostic     if (setintr)
72468576Schristos 	sigprocmask(SIG_SETMASK, &osigset, NULL);
72549992Sbostic     settell();
7261287Sbill 
72749992Sbostic     if ((my_reenter = setexit()) == 0)
72849992Sbostic 	process(0);		/* 0 -> blow away on errors */
7291287Sbill 
73049992Sbostic     if (setintr)
73168576Schristos 	sigprocmask(SIG_SETMASK, &osigset, NULL);
73249992Sbostic     if (oSHIN >= 0) {
73349992Sbostic 	register int i;
7341287Sbill 
73549992Sbostic 	/* We made it to the new state... free up its storage */
73649992Sbostic 	/* This code could get run twice but xfree doesn't care */
73749992Sbostic 	for (i = 0; i < fblocks; i++)
73849992Sbostic 	    xfree((ptr_t) fbuf[i]);
73949992Sbostic 	xfree((ptr_t) fbuf);
74049992Sbostic 
74149992Sbostic 	/* Reset input arena */
742*69126Schristos 	memmove(&B, &saveB, sizeof(B));
74349992Sbostic 
74449992Sbostic 	(void) close(SHIN), SHIN = oSHIN;
74549992Sbostic 	arginp = oarginp, onelflg = oonelflg;
74649992Sbostic 	evalp = oevalp, evalvec = oevalvec;
74749992Sbostic 	intty = oldintty, whyles = oldwhyl, gointr = ogointr;
74849992Sbostic 	if (enterhist)
74949992Sbostic 	    HIST = OHIST;
75049992Sbostic 	enterhist = oenterhist;
75149992Sbostic 	cantell = otell;
75249992Sbostic     }
7531287Sbill 
75449992Sbostic     resexit(oldexit);
75549992Sbostic     /*
75649992Sbostic      * If process reset() (effectively an unwind) then we must also unwind.
75749992Sbostic      */
75849992Sbostic     if (my_reenter)
75949992Sbostic 	stderror(ERR_SILENT);
76049992Sbostic     insource = oinsource;
7611287Sbill }
7621287Sbill 
76349992Sbostic void
rechist()7644946Smckusic rechist()
7651287Sbill {
76652369Schristos     Char    buf[BUFSIZ], hbuf[BUFSIZ], *hfile;
76749992Sbostic     int     fp, ftmp, oldidfds;
76852369Schristos     struct  varent *shist;
7691287Sbill 
77049992Sbostic     if (!fast) {
77152369Schristos 	/*
77252369Schristos 	 * If $savehist is just set, we use the value of $history
77352369Schristos 	 * else we use the value in $savehist
77452369Schristos 	 */
77560237Schristos 	if ((shist = adrof(STRsavehist)) != NULL) {
77652369Schristos 	    if (shist->vec[0][0] != '\0')
77752369Schristos 		(void) Strcpy(hbuf, shist->vec[0]);
77852369Schristos 	    else if ((shist = adrof(STRhistory)) && shist->vec[0][0] != '\0')
77952369Schristos 		(void) Strcpy(hbuf, shist->vec[0]);
78052369Schristos 	    else
78152369Schristos 		return;
78252369Schristos 	}
78352369Schristos 	else
78452369Schristos   	    return;
78552369Schristos 
78652369Schristos   	if ((hfile = value(STRhistfile)) == STRNULL) {
78752369Schristos   	    hfile = Strcpy(buf, value(STRhome));
78852369Schristos   	    (void) Strcat(buf, STRsldthist);
78952369Schristos   	}
79052369Schristos 
791*69126Schristos   	if ((fp = open(short2str(hfile), O_WRONLY | O_CREAT | O_TRUNC,
792*69126Schristos 	    0600)) == -1)
79352369Schristos   	    return;
79452369Schristos 
79549992Sbostic 	oldidfds = didfds;
79649992Sbostic 	didfds = 0;
79749992Sbostic 	ftmp = SHOUT;
79849992Sbostic 	SHOUT = fp;
79952369Schristos 	dumphist[2] = hbuf;
80050439Schristos 	dohist(dumphist, NULL);
80150439Schristos 	SHOUT = ftmp;
80249992Sbostic 	(void) close(fp);
80349992Sbostic 	didfds = oldidfds;
80449992Sbostic     }
8054946Smckusic }
8064946Smckusic 
80749992Sbostic void
goodbye()8084946Smckusic goodbye()
8094946Smckusic {
81049992Sbostic     rechist();
81149992Sbostic 
81249992Sbostic     if (loginsh) {
81349992Sbostic 	(void) signal(SIGQUIT, SIG_IGN);
81449992Sbostic 	(void) signal(SIGINT, SIG_IGN);
81549992Sbostic 	(void) signal(SIGTERM, SIG_IGN);
81649992Sbostic 	setintr = 0;		/* No interrupts after "logout" */
81749992Sbostic 	if (!(adrof(STRlogout)))
81849992Sbostic 	    set(STRlogout, STRnormal);
81949992Sbostic #ifdef _PATH_DOTLOGOUT
82049992Sbostic 	(void) srcfile(_PATH_DOTLOGOUT, 0, 0);
82149992Sbostic #endif
82249992Sbostic 	if (adrof(STRhome))
82349992Sbostic 	    (void) srccat(value(STRhome), STRsldtlogout);
82449992Sbostic     }
82549992Sbostic     exitstat();
8261287Sbill }
8271287Sbill 
82849992Sbostic void
exitstat()8291287Sbill exitstat()
8301287Sbill {
83150439Schristos     Char *s;
83217516Sedward #ifdef PROF
83349992Sbostic     monitor(0);
83417516Sedward #endif
83549992Sbostic     /*
83649992Sbostic      * Note that if STATUS is corrupted (i.e. getn bombs) then error will exit
83749992Sbostic      * directly because we poke child here. Otherwise we might continue
83849992Sbostic      * unwarrantedly (sic).
83949992Sbostic      */
84049992Sbostic     child = 1;
84150439Schristos     s = value(STRstatus);
84250439Schristos     xexit(s ? getn(s) : 0);
8431287Sbill }
8441287Sbill 
8454946Smckusic /*
8464946Smckusic  * in the event of a HUP we want to save the history
8474946Smckusic  */
84849992Sbostic static void
phup(sig)84950024Schristos phup(sig)
85050024Schristos int sig;
8514946Smckusic {
85249992Sbostic     rechist();
85364711Schristos 
85464711Schristos     /*
85564711Schristos      * We kill the last foreground process group. It then becomes
85664711Schristos      * responsible to propagate the SIGHUP to its progeny.
85764711Schristos      */
85864711Schristos     {
85964711Schristos 	struct process *pp, *np;
86064711Schristos 
86164711Schristos 	for (pp = proclist.p_next; pp; pp = pp->p_next) {
86264711Schristos 	    np = pp;
86364711Schristos 	    /*
86464711Schristos 	     * Find if this job is in the foreground. It could be that
86564711Schristos 	     * the process leader has exited and the foreground flag
86664711Schristos 	     * is cleared for it.
86764711Schristos 	     */
86864711Schristos 	    do
86964711Schristos 		/*
87064711Schristos 		 * If a process is in the foreground; we try to kill
87164711Schristos 		 * it's process group. If we succeed, then the
87264711Schristos 		 * whole job is gone. Otherwise we keep going...
87364711Schristos 		 * But avoid sending HUP to the shell again.
87464711Schristos 		 */
87564711Schristos 		if ((np->p_flags & PFOREGND) != 0 && np->p_jobid != shpgrp &&
87664711Schristos 		    killpg(np->p_jobid, SIGHUP) != -1) {
87764711Schristos 		    /* In case the job was suspended... */
87864711Schristos 		    (void) killpg(np->p_jobid, SIGCONT);
87964711Schristos 		    break;
88064711Schristos 		}
88164711Schristos 	    while ((np = np->p_friends) != pp);
88264711Schristos 	}
88364711Schristos     }
884*69126Schristos     xexit(sig);
8854946Smckusic }
8864946Smckusic 
88749992Sbostic Char   *jobargv[2] = {STRjobs, 0};
88849992Sbostic 
8891287Sbill /*
8901287Sbill  * Catch an interrupt, e.g. during lexical input.
8911287Sbill  * If we are an interactive shell, we reset the interrupt catch
8921287Sbill  * immediately.  In any case we drain the shell output,
8931287Sbill  * and finally go through the normal error mechanism, which
8941287Sbill  * gets a chance to make the shell go away.
8951287Sbill  */
89650023Sbostic /* ARGSUSED */
89746657Sbostic void
pintr(notused)89850023Sbostic pintr(notused)
89950023Sbostic 	int notused;
9001287Sbill {
90149992Sbostic     pintr1(1);
9023213Swnj }
9033213Swnj 
90449992Sbostic void
pintr1(wantnl)9053213Swnj pintr1(wantnl)
90649992Sbostic     bool    wantnl;
9073213Swnj {
90850439Schristos     Char **v;
90968576Schristos     sigset_t sigset, osigset;
9101287Sbill 
91168576Schristos     sigemptyset(&sigset);
91268576Schristos     sigprocmask(SIG_BLOCK, &sigset, &osigset);
91349992Sbostic     if (setintr) {
91468576Schristos 	sigset = osigset;
91568576Schristos 	sigdelset(&sigset, SIGINT);
91668576Schristos 	sigprocmask(SIG_SETMASK, &sigset, NULL);
91749992Sbostic 	if (pjobs) {
91849992Sbostic 	    pjobs = 0;
91950439Schristos 	    (void) fprintf(cshout, "\n");
92050439Schristos 	    dojobs(jobargv, NULL);
92149992Sbostic 	    stderror(ERR_NAME | ERR_INTR);
9221287Sbill 	}
92349992Sbostic     }
92468576Schristos     sigdelset(&osigset, SIGCHLD);
92568576Schristos     sigprocmask(SIG_SETMASK, &osigset, NULL);
92650439Schristos     (void) fpurge(cshout);
92749992Sbostic     (void) endpwent();
9281287Sbill 
92949992Sbostic     /*
93049992Sbostic      * If we have an active "onintr" then we search for the label. Note that if
93149992Sbostic      * one does "onintr -" then we shan't be interruptible so we needn't worry
93249992Sbostic      * about that here.
93349992Sbostic      */
93449992Sbostic     if (gointr) {
93551420Schristos 	gotolab(gointr);
93649992Sbostic 	timflg = 0;
93760237Schristos 	if ((v = pargv) != NULL)
93849992Sbostic 	    pargv = 0, blkfree(v);
93960237Schristos 	if ((v = gargv) != NULL)
94049992Sbostic 	    gargv = 0, blkfree(v);
94149992Sbostic 	reset();
94249992Sbostic     }
94349992Sbostic     else if (intty && wantnl) {
94450439Schristos 	(void) fputc('\r', cshout);
94550439Schristos 	(void) fputc('\n', cshout);
94649992Sbostic     }
94749992Sbostic     stderror(ERR_SILENT);
9481287Sbill }
9491287Sbill 
9501287Sbill /*
9511287Sbill  * Process is the main driving routine for the shell.
9521287Sbill  * It runs all command processing, except for those within { ... }
9531287Sbill  * in expressions (which is run by a routine evalav in sh.exp.c which
9541287Sbill  * is a stripped down process), and `...` evaluation which is run
9551287Sbill  * also by a subset of this code in sh.glob.c in the routine backeval.
9561287Sbill  *
9571287Sbill  * The code here is a little strange because part of it is interruptible
9581287Sbill  * and hence freeing of structures appears to occur when none is necessary
9591287Sbill  * if this is ignored.
9601287Sbill  *
9611287Sbill  * Note that if catch is not set then we will unwind on any error.
9621287Sbill  * If an end-of-file occurs, we return.
9631287Sbill  */
96450439Schristos static struct command *savet = NULL;
96549992Sbostic void
process(catch)9661287Sbill process(catch)
96749992Sbostic     bool    catch;
9681287Sbill {
96949992Sbostic     jmp_buf osetexit;
97050439Schristos     struct command *t = savet;
97168576Schristos     sigset_t sigset;
9721287Sbill 
97350439Schristos     savet = NULL;
97449992Sbostic     getexit(osetexit);
97549992Sbostic     for (;;) {
97649992Sbostic 	pendjob();
97749992Sbostic 	paraml.next = paraml.prev = &paraml;
97849992Sbostic 	paraml.word = STRNULL;
97949992Sbostic 	(void) setexit();
98049992Sbostic 	justpr = enterhist;	/* execute if not entering history */
9811287Sbill 
98249992Sbostic 	/*
98349992Sbostic 	 * Interruptible during interactive reads
98449992Sbostic 	 */
98568576Schristos 	if (setintr) {
98668576Schristos 	    sigemptyset(&sigset);
98768576Schristos 	    sigaddset(&sigset, SIGINT);
98868576Schristos 	    sigprocmask(SIG_UNBLOCK, &sigset, NULL);
98968576Schristos 	}
9901287Sbill 
99149992Sbostic 	/*
99249992Sbostic 	 * For the sake of reset()
99349992Sbostic 	 */
99449992Sbostic 	freelex(&paraml);
99550439Schristos 	if (savet)
99650439Schristos 	    freesyn(savet), savet = NULL;
9971287Sbill 
99849992Sbostic 	if (haderr) {
99949992Sbostic 	    if (!catch) {
100049992Sbostic 		/* unwind */
100149992Sbostic 		doneinp = 0;
100249992Sbostic 		resexit(osetexit);
100350439Schristos 		savet = t;
100449992Sbostic 		reset();
100549992Sbostic 	    }
100649992Sbostic 	    haderr = 0;
100749992Sbostic 	    /*
100849992Sbostic 	     * Every error is eventually caught here or the shell dies.  It is
100949992Sbostic 	     * at this point that we clean up any left-over open files, by
101049992Sbostic 	     * closing all but a fixed number of pre-defined files.  Thus
101149992Sbostic 	     * routines don't have to worry about leaving files open due to
101249992Sbostic 	     * deeper errors... they will get closed here.
101349992Sbostic 	     */
101449992Sbostic 	    closem();
101549992Sbostic 	    continue;
101649992Sbostic 	}
101749992Sbostic 	if (doneinp) {
101849992Sbostic 	    doneinp = 0;
101949992Sbostic 	    break;
102049992Sbostic 	}
102149992Sbostic 	if (chkstop)
102249992Sbostic 	    chkstop--;
102349992Sbostic 	if (neednote)
102449992Sbostic 	    pnote();
102549992Sbostic 	if (intty && prompt && evalvec == 0) {
102649992Sbostic 	    mailchk();
102749992Sbostic 	    /*
102849992Sbostic 	     * If we are at the end of the input buffer then we are going to
102949992Sbostic 	     * read fresh stuff. Otherwise, we are rereading input and don't
103049992Sbostic 	     * need or want to prompt.
103149992Sbostic 	     */
103250944Schristos 	    if (aret == F_SEEK && fseekp == feobp)
103349992Sbostic 		printprompt();
103450439Schristos 	    (void) fflush(cshout);
103549992Sbostic 	}
103649992Sbostic 	if (seterr) {
103749992Sbostic 	    xfree((ptr_t) seterr);
103850024Schristos 	    seterr = NULL;
103949992Sbostic 	}
10401287Sbill 
104149992Sbostic 	/*
104249992Sbostic 	 * Echo not only on VERBOSE, but also with history expansion. If there
104349992Sbostic 	 * is a lexical error then we forego history echo.
104449992Sbostic 	 */
104560237Schristos 	if ((lex(&paraml) && !seterr && intty) || adrof(STRverbose)) {
104650439Schristos 	    prlex(csherr, &paraml);
104749992Sbostic 	}
10481287Sbill 
104949992Sbostic 	/*
105049992Sbostic 	 * The parser may lose space if interrupted.
105149992Sbostic 	 */
105249992Sbostic 	if (setintr)
105368576Schristos 	    sigprocmask(SIG_BLOCK, &sigset, NULL);
10541287Sbill 
105549992Sbostic 	/*
105649992Sbostic 	 * Save input text on the history list if reading in old history, or it
105749992Sbostic 	 * is from the terminal at the top level and not in a loop.
105851437Sleres 	 *
105949992Sbostic 	 * PWP: entry of items in the history list while in a while loop is done
106049992Sbostic 	 * elsewhere...
106149992Sbostic 	 */
106260237Schristos 	if (enterhist || (catch && intty && !whyles))
106349992Sbostic 	    savehist(&paraml);
10641287Sbill 
106549992Sbostic 	/*
106649992Sbostic 	 * Print lexical error messages, except when sourcing history lists.
106749992Sbostic 	 */
106849992Sbostic 	if (!enterhist && seterr)
106949992Sbostic 	    stderror(ERR_OLD);
10701287Sbill 
107149992Sbostic 	/*
107249992Sbostic 	 * If had a history command :p modifier then this is as far as we
107349992Sbostic 	 * should go
107449992Sbostic 	 */
107549992Sbostic 	if (justpr)
107649992Sbostic 	    reset();
10771287Sbill 
107849992Sbostic 	alias(&paraml);
10791287Sbill 
108049992Sbostic 	/*
108149992Sbostic 	 * Parse the words of the input into a parse tree.
108249992Sbostic 	 */
108350439Schristos 	savet = syntax(paraml.next, &paraml, 0);
108449992Sbostic 	if (seterr)
108549992Sbostic 	    stderror(ERR_OLD);
10861287Sbill 
108751437Sleres 	execute(savet, (tpgrp > 0 ? tpgrp : -1), NULL, NULL);
10881287Sbill 
108949992Sbostic 	/*
109049992Sbostic 	 * Made it!
109149992Sbostic 	 */
109249992Sbostic 	freelex(&paraml);
109350439Schristos 	freesyn((struct command *) savet), savet = NULL;
109449992Sbostic     }
109549992Sbostic     resexit(osetexit);
109650439Schristos     savet = t;
10971287Sbill }
10981287Sbill 
109949992Sbostic void
110050439Schristos /*ARGSUSED*/
dosource(v,t)110150439Schristos dosource(v, t)
110250439Schristos     Char **v;
110350439Schristos     struct command *t;
110450439Schristos 
11051287Sbill {
110649992Sbostic     register Char *f;
110749992Sbostic     bool    hflg = 0;
110849992Sbostic     Char    buf[BUFSIZ];
11091287Sbill 
111050439Schristos     v++;
111150439Schristos     if (*v && eq(*v, STRmh)) {
111250439Schristos 	if (*++v == NULL)
111349992Sbostic 	    stderror(ERR_NAME | ERR_HFLAG);
111449992Sbostic 	hflg++;
111549992Sbostic     }
111650439Schristos     (void) Strcpy(buf, *v);
111749992Sbostic     f = globone(buf, G_ERROR);
111849992Sbostic     (void) strcpy((char *) buf, short2str(f));
111949992Sbostic     xfree((ptr_t) f);
112049992Sbostic     if (!srcfile((char *) buf, 0, hflg) && !hflg)
112149992Sbostic 	stderror(ERR_SYSTEM, (char *) buf, strerror(errno));
11221287Sbill }
11231287Sbill 
11241287Sbill /*
11251287Sbill  * Check for mail.
11261287Sbill  * If we are a login shell, then we don't want to tell
11271287Sbill  * about any mail file unless its been modified
11281287Sbill  * after the time we started.
11291287Sbill  * This prevents us from telling the user things he already
11301287Sbill  * knows, since the login program insists on saying
11311287Sbill  * "You have mail."
11321287Sbill  */
113349992Sbostic static void
mailchk()11341287Sbill mailchk()
11351287Sbill {
113649992Sbostic     register struct varent *v;
113749992Sbostic     register Char **vp;
113849992Sbostic     time_t  t;
113949992Sbostic     int     intvl, cnt;
114049992Sbostic     struct stat stb;
114149992Sbostic     bool    new;
11421287Sbill 
114349992Sbostic     v = adrof(STRmail);
114449992Sbostic     if (v == 0)
114549992Sbostic 	return;
114649992Sbostic     (void) time(&t);
114749992Sbostic     vp = v->vec;
114849992Sbostic     cnt = blklen(vp);
114949992Sbostic     intvl = (cnt && number(*vp)) ? (--cnt, getn(*vp++)) : MAILINTVL;
115049992Sbostic     if (intvl < 1)
115149992Sbostic 	intvl = 1;
115249992Sbostic     if (chktim + intvl > t)
115349992Sbostic 	return;
115449992Sbostic     for (; *vp; vp++) {
115549992Sbostic 	if (stat(short2str(*vp), &stb) < 0)
115649992Sbostic 	    continue;
115749992Sbostic 	new = stb.st_mtime > time0.tv_sec;
115849992Sbostic 	if (stb.st_size == 0 || stb.st_atime > stb.st_mtime ||
115949992Sbostic 	    (stb.st_atime < chktim && stb.st_mtime < chktim) ||
116060237Schristos 	    (loginsh && !new))
116149992Sbostic 	    continue;
116249992Sbostic 	if (cnt == 1)
116350439Schristos 	    (void) fprintf(cshout, "You have %smail.\n", new ? "new " : "");
116449992Sbostic 	else
116551437Sleres 	    (void) fprintf(cshout, "%s in %s.\n", new ? "New mail" : "Mail",
116651589Schristos 			   vis_str(*vp));
116749992Sbostic     }
116849992Sbostic     chktim = t;
11691287Sbill }
11701287Sbill 
11711287Sbill /*
11721287Sbill  * Extract a home directory from the password file
11731287Sbill  * The argument points to a buffer where the name of the
11741287Sbill  * user whose home directory is sought is currently.
11751287Sbill  * We write the home directory of the user back there.
11761287Sbill  */
117749992Sbostic int
gethdir(home)11781287Sbill gethdir(home)
117949992Sbostic     Char   *home;
11801287Sbill {
118149992Sbostic     Char   *h;
118249992Sbostic     struct passwd *pw;
11831287Sbill 
118449992Sbostic     /*
118549992Sbostic      * Is it us?
118649992Sbostic      */
118749992Sbostic     if (*home == '\0') {
118860237Schristos 	if ((h = value(STRhome)) != NULL) {
118949992Sbostic 	    (void) Strcpy(home, h);
119049992Sbostic 	    return 0;
119149992Sbostic 	}
119249992Sbostic 	else
119349992Sbostic 	    return 1;
119449992Sbostic     }
119549992Sbostic 
119660237Schristos     if ((pw = getpwnam(short2str(home))) != NULL) {
119749992Sbostic 	(void) Strcpy(home, str2short(pw->pw_dir));
119849992Sbostic 	return 0;
119949992Sbostic     }
120049992Sbostic     else
120149992Sbostic 	return 1;
12021287Sbill }
12031287Sbill 
12041287Sbill /*
120550439Schristos  * When didfds is set, we do I/O from 0, 1, 2 otherwise from 15, 16, 17
120650460Schristos  * We also check if the shell has already changed the decriptor to point to
120750439Schristos  * 0, 1, 2 when didfds is set.
120850439Schristos  */
120950439Schristos #define DESC(a) (*((int *) (a)) - (didfds && *((int *) a) >= FSHIN ? FSHIN : 0))
121050439Schristos 
121150439Schristos static int
readf(oreo,buf,siz)121250439Schristos readf(oreo, buf, siz)
121350439Schristos     void *oreo;
121450439Schristos     char *buf;
121550439Schristos     int siz;
121650439Schristos {
121750439Schristos     return read(DESC(oreo), buf, siz);
121850439Schristos }
121950439Schristos 
122050439Schristos 
122150439Schristos static int
writef(oreo,buf,siz)122250439Schristos writef(oreo, buf, siz)
122350439Schristos     void *oreo;
122450439Schristos     const char *buf;
122550439Schristos     int siz;
122650439Schristos {
122750439Schristos     return write(DESC(oreo), buf, siz);
122850439Schristos }
122950439Schristos 
123050439Schristos static fpos_t
seekf(oreo,off,whence)123150439Schristos seekf(oreo, off, whence)
123250439Schristos     void *oreo;
123350439Schristos     fpos_t off;
123450439Schristos     int whence;
123550439Schristos {
123650439Schristos     return lseek(DESC(oreo), off, whence);
123750439Schristos }
123850439Schristos 
123950439Schristos 
124050439Schristos static int
closef(oreo)124150439Schristos closef(oreo)
124250439Schristos     void *oreo;
124350439Schristos {
124450439Schristos     return close(DESC(oreo));
124550439Schristos }
124650439Schristos 
124750439Schristos 
124850439Schristos /*
124951589Schristos  * Print the visible version of a string.
125051589Schristos  */
125151589Schristos int
vis_fputc(ch,fp)125251589Schristos vis_fputc(ch, fp)
125351589Schristos     int ch;
125451589Schristos     FILE *fp;
125551589Schristos {
125651589Schristos     char uenc[5];	/* 4 + NULL */
125751589Schristos 
125851589Schristos     if (ch & QUOTE)
125951589Schristos 	return fputc(ch & TRIM, fp);
126052369Schristos     /*
126152369Schristos      * XXX: When we are in AsciiOnly we want all characters >= 0200 to
126252369Schristos      * be encoded, but currently there is no way in vis to do that.
126352369Schristos      */
126452369Schristos     (void) vis(uenc, ch & TRIM, VIS_NOSLASH, 0);
126551589Schristos     return fputs(uenc, fp);
126651589Schristos }
126751589Schristos 
126851589Schristos /*
12691287Sbill  * Move the initial descriptors to their eventual
12701287Sbill  * resting places, closin all other units.
12711287Sbill  */
127249992Sbostic void
initdesc()12731287Sbill initdesc()
12741287Sbill {
12751287Sbill 
127649992Sbostic     didfds = 0;			/* 0, 1, 2 aren't set up */
127750024Schristos     (void) ioctl(SHIN = dcopy(0, FSHIN), FIOCLEX, NULL);
127850024Schristos     (void) ioctl(SHOUT = dcopy(1, FSHOUT), FIOCLEX, NULL);
127950439Schristos     (void) ioctl(SHERR = dcopy(2, FSHERR), FIOCLEX, NULL);
128050024Schristos     (void) ioctl(OLDSTD = dcopy(SHIN, FOLDSTD), FIOCLEX, NULL);
128149992Sbostic     closem();
12821287Sbill }
12831287Sbill 
128449992Sbostic 
128549992Sbostic void
128616679Ssam #ifdef PROF
done(i)128716679Ssam done(i)
128816679Ssam #else
128949992Sbostic xexit(i)
129016679Ssam #endif
129149992Sbostic     int     i;
12921287Sbill {
129349992Sbostic     untty();
129449992Sbostic     _exit(i);
129549992Sbostic }
12961287Sbill 
129749992Sbostic static Char **
defaultpath()129849992Sbostic defaultpath()
129949992Sbostic {
130049992Sbostic     char   *ptr;
130149992Sbostic     Char  **blk, **blkp;
130249992Sbostic     struct stat stb;
130349992Sbostic 
130449992Sbostic     blkp = blk = (Char **) xmalloc((size_t) sizeof(Char *) * 10);
130549992Sbostic 
130649992Sbostic #define DIRAPPEND(a)  \
130749992Sbostic 	if (stat(ptr = a, &stb) == 0 && (stb.st_mode & S_IFMT) == S_IFDIR) \
130849992Sbostic 		*blkp++ = SAVE(ptr)
130949992Sbostic 
131049992Sbostic     DIRAPPEND(_PATH_BIN);
131149992Sbostic     DIRAPPEND(_PATH_USRBIN);
131249992Sbostic 
131349992Sbostic #undef DIRAPPEND
131449992Sbostic 
131553387Schristos     if (euid != 0 && uid != 0)
131653387Schristos 	*blkp++ = Strsave(STRdot);
131750024Schristos     *blkp = NULL;
131849992Sbostic     return (blk);
13191287Sbill }
132015373Slayer 
132149992Sbostic void
printprompt()132216677Ssam printprompt()
132315373Slayer {
132449992Sbostic     register Char *cp;
132516677Ssam 
132649992Sbostic     if (!whyles) {
132749992Sbostic 	for (cp = value(STRprompt); *cp; cp++)
132849992Sbostic 	    if (*cp == HIST)
132950439Schristos 		(void) fprintf(cshout, "%d", eventno + 1);
133049992Sbostic 	    else {
133149992Sbostic 		if (*cp == '\\' && cp[1] == HIST)
133249992Sbostic 		    cp++;
133351589Schristos 		(void) vis_fputc(*cp | QUOTE, cshout);
133449992Sbostic 	    }
133549992Sbostic     }
133649992Sbostic     else
133749992Sbostic 	/*
133849992Sbostic 	 * Prompt for forward reading loop body content.
133949992Sbostic 	 */
134050439Schristos 	(void) fprintf(cshout, "? ");
134150439Schristos     (void) fflush(cshout);
134215373Slayer }
1343